(-)-alpha-Thujene
-
Identifiers
CAS number
3917-48-4Molecular formula
C10H16SMILES
CC1=CC[C@]2([C@@H]1C2)C(C)C
Retention indicies (RI)
- DB5: 935.43
- Carbowax: 1027.57
-
Odor profile
Woody 85.19% Herbal 64.19% Green 60.66% Spicy 58.77% Fresh 45.37% Terpenic 43.63% Citrus 41.44% Oily 39.29% Dry 38.74% Pine 38.35% Scent© AI
-
Properties
XLogP3-AA
2.8pKa est.
9.93 (weak base)Molecular weight
136.23 g/molVapor pressure est.
- hPa @ 20°C
- hPa @ 25°C
Evaporation rate
Very fastBoiling point est.
161°CFlash point est.
36.52 ˚C -
Synonyms
- (-)-alpha-Thujene
- 3917-48-4
- RN746W3HMX
- alpha-Thujene, (-)-
- UNII-RN746W3HMX
- (1R,5S)-5-isopropyl-2-methylbicyclo[3.1.0]hex-2-ene
- (-)-.ALPHA.-THUJENE
- CHEBI:50033
- Bicyclo(3.1.0)hex-2-ene, 2-methyl-5-(1-methylethyl)-, (1R)-
- .ALPHA.-THUJENE, (-)-
- 3-THUJENE, (1R,5R)-(-)-
- (1R,5S)-2-methyl-5-(propan-2-yl)bicyclo[3.1.0]hex-2-ene (1R,5S)-thuj-2-ene
- (1R,5S)-2-methyl-5-(propan-2-yl)bicyclo[3.1.0]hex-2-ene
- (1R,5R)-2-METHYL-5-(1-METHYLETHYL)BICYCLO(3.1.0)HEX-2-ENE
- BICYCLO(3.1.0)HEX-2-ENE, 2-METHYL-5-(1-METHYLETHYL)-, (1R,5R)-
- (1R,5S)-5-Isopropyl-2-methylbicyclo(3.1.0)hex-2-ene
- (1R,5S)-2-methyl-5-(propan-2-yl)bicyclo(3.1.0)hex-2-ene
- trans-Thujene
- (1R,5S)-2-methyl-5-(propan-2-yl)bicyclo(3.1.0)hex-2-ene (1R,5S)-thuj-2-ene
- (-)-I+/--Thujene
- (1R)-2-methyl-5-propan-2-ylbicyclo[3.1.0]hex-2-ene
- KQAZVFVOEIRWHN-NXEZZACHSA-N
- DTXSID001317501
- LMPR0102120038
- Q27121815
-
Applications
(-)-alpha-Thujene (CAS 3917-48-4) is a chiral bicyclic monoterpene occurring as a minor constituent in many essential oils from conifers and aromatic herbs (e.g., Thuja, Juniperus, and some Salvia species) and is used primarily as a fragrance/flavor ingredient to supply fresh herbal-resinous, slightly peppery top notes in fine fragrance, cosmetics, cleaners, and air-care; in analysis and quality control as a GC/MS reference, a chemotaxonomic marker for botanical authentication, and a spike for formulation tracking/adulteration screening; as a renewable feedstock for selective transformation (oxidation/functionalization) to monoterpene derivatives, with the (-) configuration leveraged for enantioselective odor effects and for chiral method development; and in bio-based product research where laboratory studies report antimicrobial, insect-repellent/fumigant, and antioxidant activities, suggesting potential in natural preservation, post-harvest handling, or plant-protection formulations (subject to safety assessment, formulation compatibility, and local regulation); being a volatile, readily oxidizable VOC, it should be stored tightly closed, cool, and protected from light/air with stabilizers to minimize formation of oxidation products that may increase skin-sensitization risk.
-
Solubility @25˚C
Solvent Solubility (g/L) ethanol 422.14 methanol 286.26 isopropanol 483.87 water 0.96 ethyl acetate 685.27 n-propanol 481.41 acetone 696.17 n-butanol 508.77 acetonitrile 511.79 DMF 516.94 toluene 583.38 isobutanol 385.94 1,4-dioxane 1246.06 methyl acetate 626.02 THF 1428.35 2-butanone 676.88 n-pentanol 312.98 sec-butanol 444.07 n-hexane 218.24 ethylene glycol 92.56 NMP 288.66 cyclohexane 264.0 DMSO 326.08 n-butyl acetate 624.59 n-octanol 281.55 chloroform 1140.17 n-propyl acetate 361.37 acetic acid 181.08 dichloromethane 833.21 cyclohexanone 610.71 propylene glycol 155.0 isopropyl acetate 580.5 DMAc 474.58 2-ethoxyethanol 417.99 isopentanol 469.15 n-heptane 197.37 ethyl formate 285.13 1,2-dichloroethane 618.64 n-hexanol 620.65 2-methoxyethanol 580.05 isobutyl acetate 327.79 tetrachloromethane 334.61 n-pentyl acetate 348.95 transcutol 1139.48 n-heptanol 287.05 ethylbenzene 329.06 MIBK 523.57 2-propoxyethanol 842.47 tert-butanol 602.57 MTBE 919.92 2-butoxyethanol 430.82 propionic acid 237.89 o-xylene 352.42 formic acid 49.95 diethyl ether 930.24 m-xylene 435.25 p-xylene 420.61 chlorobenzene 448.8 dimethyl carbonate 247.56 n-octane 94.7 formamide 108.51 cyclopentanone 707.51 2-pentanone 603.28 anisole 586.58 cyclopentyl methyl ether 690.95 gamma-butyrolactone 567.32 1-methoxy-2-propanol 591.77 pyridine 670.06 3-pentanone 517.69 furfural 441.12 n-dodecane 73.2 diethylene glycol 423.47 diisopropyl ether 451.4 tert-amyl alcohol 475.41 acetylacetone 644.21 n-hexadecane 84.19 acetophenone 370.88 methyl propionate 485.83 isopentyl acetate 661.63 trichloroethylene 830.23 n-nonanol 265.43 cyclohexanol 376.88 benzyl alcohol 283.48 2-ethylhexanol 374.54 isooctanol 248.42 dipropyl ether 665.84 1,2-dichlorobenzene 396.38 ethyl lactate 171.35 propylene carbonate 332.97 n-methylformamide 232.45 2-pentanol 437.78 n-pentane 220.42 1-propoxy-2-propanol 642.91 1-methoxy-2-propyl acetate 693.43 2-(2-methoxypropoxy) propanol 418.63 mesitylene 325.07 ε-caprolactone 502.13 p-cymene 276.39 epichlorohydrin 790.23 1,1,1-trichloroethane 747.71 2-aminoethanol 190.44 morpholine-4-carbaldehyde 523.59 sulfolane 438.9 2,2,4-trimethylpentane 115.91 2-methyltetrahydrofuran 917.71 n-hexyl acetate 498.14 isooctane 128.97 2-(2-butoxyethoxy)ethanol 540.35 sec-butyl acetate 357.72 tert-butyl acetate 648.5 decalin 153.07 glycerin 170.72 diglyme 939.1 acrylic acid 166.16 isopropyl myristate 276.85 n-butyric acid 367.05 acetyl acetate 433.95 di(2-ethylhexyl) phthalate 187.97 ethyl propionate 392.81 nitromethane 382.74 1,2-diethoxyethane 749.6 benzonitrile 356.92 trioctyl phosphate 141.38 1-bromopropane 585.25 gamma-valerolactone 753.5 n-decanol 211.49 triethyl phosphate 218.33 4-methyl-2-pentanol 330.11 propionitrile 582.2 vinylene carbonate 320.61 1,1,2-trichlorotrifluoroethane 373.08 DMS 403.48 cumene 265.91 2-octanol 213.97 2-hexanone 433.57 octyl acetate 293.06 limonene 333.36 1,2-dimethoxyethane 844.47 ethyl orthosilicate 236.27 tributyl phosphate 176.46 diacetone alcohol 476.73 N,N-dimethylaniline 361.1 acrylonitrile 468.0 aniline 422.82 1,3-propanediol 307.87 bromobenzene 522.73 dibromomethane 636.11 1,1,2,2-tetrachloroethane 740.81 2-methyl-cyclohexyl acetate 351.1 tetrabutyl urea 199.1 diisobutyl methanol 301.25 2-phenylethanol 427.09 styrene 355.58 dioctyl adipate 262.33 dimethyl sulfate 239.06 ethyl butyrate 454.7 methyl lactate 221.36 butyl lactate 221.38 diethyl carbonate 301.0 propanediol butyl ether 308.66 triethyl orthoformate 358.96 p-tert-butyltoluene 298.42 methyl 4-tert-butylbenzoate 391.63 morpholine 1039.65 tert-butylamine 505.08 n-dodecanol 174.07 dimethoxymethane 673.19 ethylene carbonate 322.34 cyrene 228.77 2-ethoxyethyl acetate 481.19 2-ethylhexyl acetate 515.27 1,2,4-trichlorobenzene 414.2 4-methylpyridine 649.28 dibutyl ether 468.86 2,6-dimethyl-4-heptanol 301.25 DEF 455.79 dimethyl isosorbide 591.9 tetrachloroethylene 488.12 eugenol 324.73 triacetin 372.5 span 80 316.05 1,4-butanediol 132.36 1,1-dichloroethane 746.87 2-methyl-1-pentanol 292.56 methyl formate 189.97 2-methyl-1-butanol 408.29 n-decane 112.21 butyronitrile 541.75 3,7-dimethyl-1-octanol 330.73 1-chlorooctane 270.72 1-chlorotetradecane 139.03 n-nonane 109.09 undecane 87.58 tert-butylcyclohexane 156.61 cyclooctane 143.87 cyclopentanol 360.27 tetrahydropyran 1103.01 tert-amyl methyl ether 569.6 2,5,8-trioxanonane 608.87 1-hexene 401.65 2-isopropoxyethanol 364.26 2,2,2-trifluoroethanol 102.17 methyl butyrate 395.4 Scent© AI
| Maximum acceptable concentrations in the finished product (%) | |||
|---|---|---|---|
|
Category 1
Products applied to the lips
|
No restriction |
Category 7A
Rinse-off products applied to the hair with some hand contact
|
No restriction |
|
Category 2
Products applied to the axillae
|
No restriction |
Category 7B
Leave-on products applied to the hair with some hand contact
|
No restriction |
|
Category 3
Products applied to the face/body using fingertips
|
No restriction |
Category 8
Products with significant anogenital exposure
|
No restriction |
|
Category 4
Products related to fine fragrance
|
No restriction |
Category 9
Products with body and hand exposure, primarily rinse off
|
No restriction |
|
Category 5A
Body lotion products applied to the body using the hands (palms), primarily leave on
|
No restriction |
Category 10A
Household care products with mostly hand contact
|
No restriction |
|
Category 5B
Face moisturizer products applied to the face using the hands (palms), primarily leave on
|
No restriction |
Category 10B
Household care products with mostly hand contact, including aerosol/spray products (with potential leave-on skin contact)
|
No restriction |
|
Category 5C
Hand cream products applied to the hands using the hands (palms), primarily leave on
|
No restriction |
Category 11A
Products with intended skin contact but minimal transfer of fragrance to skin from inert substrate without UV exposure
|
No restriction |
|
Category 5D
Baby Creams, baby Oils and baby talc
|
No restriction |
Category 11B
Products with intended skin contact but minimal transfer of fragrance to skin from inert substrate with potential UV exposure
|
No restriction |
|
Category 6
Products with oral and lip exposure
|
No restriction |
Category 12
Products not intended for direct skin contact, minimal or insignificant transfer to skin
|
No restriction |
| Name | CAS | Botanical | Proportion |
|---|---|---|---|
| Achillea abrotanoides | Achillea abrotanoides (Vis.) Vis., fam. Asteraceae (Compositae) | 5.5% | |
| Amomum villosum | Amomum villosum Lour., fam. Zingiberaceae | 0.35% | |
| Angelica root (Finland) 1 | 8015-64-3 | Angelica archangelica L., fam. Apiaceae (Umbelliferae) | 0.01% |
| Armoise flower | 8008-93-3 | Artemisia vulgaris L., fam. Asteraceae (Compositae) | 1.42% |
| Artemisia nilagirica (vulgaris) (India) 2 | Artemisia nilagirica (C.B. Clarks) Pamp. (A. vulgaris Hook f.), Asteraceae | 0.01% | |
| Artemisia nilagirica (vulgaris) (India) 1 | Artemisia nilagirica (C.B. Clarks) Pamp. (A. vulgaris Hook f.), Asteraceae | 0.09% | |
| Ayou | Aydendron barbeyana Mez. (Nectandra globosa Mez.), fam. Lauraceae | 0.05% | |
| Basil (Italy) 1a CO2-extract | 8015-73-4 | Ocimum basilicum L., fam. Lamiaceae (Labiatae) | 0.01% |
| Basil 2 | 8015-73-4 | Ocimum basilicum L., fam. Lamiaceae (Labiatae) | 0.14% |
| Bergamot (China) 5 | 8007-75-8 | Citrus bergamia Risso et Poiteau, fam. Rutaceae | 0.03% |
| Bergamot (China) 2 | 8007-75-8 | Citrus bergamia Risso et Poiteau, fam. Rutaceae | 0.01% |
| Bergamot (Italy) 1 | 8007-75-8 | Citrus bergamia Risso et Poiteau, fam. Rutaceae | 0.01% |
| Bergamot (Italy, Calabria) 4 | 8007-75-8 | Citrus bergamia Risso et Poiteau, fam. Rutaceae | 0.36% |
| Bergamot (Italy, Calabria) 6 | 8007-75-8 | Citrus bergamia Risso et Poiteau, fam. Rutaceae | 0.36% |
| Bergamot (Italy, Calabria) 5 | 8007-75-8 | Citrus bergamia Risso et Poiteau, fam. Rutaceae | 0.35% |
| Bergamot (China) 1 | 8007-75-8 | Citrus bergamia Risso et Poiteau, fam. Rutaceae | 0.18% |
| Blackcurrant bud, absolute | 68606-81-5 | Ribes nigrum L., fam. Grossulariaceae | 0.38% |
| Lemon (Spain) 7 | 84929-31-7 | Citrus limon (L.) Burm. f., fam. Rutaceae | 0.35% |
| Bupleurum linearifolium | Bupleurum linearifolium DC., fam. Apiaceae (Umbelliferae) | 1.9% | |
| Calamintha nepeta (Belgium) | Calamintha nepeta (L.) Savi (Melissa nepeta L.), fam. Lamiaceae (Labiatae) | 0.05% | |
| Calamintha sylvatica (Belgium) | Calamintha sylvatica Bromf., fam. Lamiaceae (Labiatae) | 0.05% | |
| Caraway seed 1 | 8000-42-8 | Carum carvi L., fam. Apiaceae (Umbelliferae) | 0.01% |
| Cardamom (Costa Rica) | 8000-66-6 | Elettaria cardamomum (L.) Maton, fam. Zingiberaceae | 0.01% |
| Carrot leaf (India) | 8015-88-1 | Daucus carota L. var. sativa, fam. Apiaceae (Umbelliferae) | 1.06% |
| Carrot seed (France) 1 | 8015-88-1 | Daucus carota L., fam. Apiaceae (Umbelliferae) | 0.68% |
| Cinnamon bark 2a | 8007-80-5 | Cinnamomum zeylanicum Blume (C. verum L. Presl), fam. Lauraceae | 0.04% |
| Cinnamon bark 3 | 8007-80-5 | Cinnamomum zeylanicum Blume (C. verum L. Presl), fam. Lauraceae | 0.04% |
| Citronella java (Argentina) 2 | 8000-29-1 | Cymbopogon winterianus Jowitt., fam. Poaceae (Gramineae) | 0.1% |
| Citronella ceylon 5 | 8000-29-1 | Cymbopogon nardus (L.) Rendle, fam. Poaceae (Gramineae) | 0.02% |
| Clementine (Italy) 1 | Citrus clementina Hort. ex Tan., (C. deliciosa Ten. var. Clementina) | 0.01% | |
| Clove bud 3 | 8000-34-8 | Eugenia caryophyllus (Spreng.) Bullock & Harrison (E.caryophyllata Thunb.) | 0.25% |
| Ginger (Australia) 1 | 8007-08-7 | Zingiber officinale Roscoe, fam. Zingiberaceae | 0.03% |
| Coriander fruit (Italy) 1 | 8008-52-4 | Coriandrum sativum L., fam. Apiaceae (Umbelliferae) | 0.05% |
| Coriander, headspace | 8008-52-4 | Coriandrum sativum L., fam. Apiaceae (Umbelliferae) | 0.2% |
| Mandarin (Spain) 1 | 8008-31-9 | Citrus deliciosa Tenore (C. reticulata Blanco, cv.mandarin), fam. Rutaceae | 0.57% |
| Cubeb 1 | 8007-87-2 | Piper cubeba L., fam. Piperaceae | 0.2% |
| Cumin (Egypt) 1 | 8014-30-9 | Cuminum cyminum L., fam. Apiaceae (Umbelliferae) | 0.1% |
| Cymbopogon jwarancusa (India) | Cymbopogon jwarancusa (Jones) Schult., fam. Poaceae (Gramineae) | 1.9% | |
| Dragonhead | Dracocephalum moldavica L., fam. Lamiaceae (Labiatae) | 0.05% | |
| Ducrosia anethifolia (Pakistan) | Ducrosia anethifolia (DC.) Boiss., fam. Apiaceae (Umbelliferae) | 0.07% | |
| Elsholtzia blanda (China) | Elsholtzia blanda Benth., fam. Lamiaceae (Labiatae) | 0.67% | |
| Tarragon 1 | 8016-88-4 | Artemisia dracunculus L., fam. Asteraceae (Compositae) | 0.16% |
| Ginger (India) 3 | 8007-08-7 | Zingiber officinale Roscoe, fam. Zingiberaceae | 0.01% |
| Grapefruit (Israel) 2 | 8016-20-4 | Citrus paradisi Macfayden, fam. Rutaceae | 0.01% |
| Fern, sweet 1 | Comptonia peregrina (L.) Coulter, fam. Pteridophytae | 0.23% | |
| Fern, sweet 2 | Comptonia peregrina (L.) Coulter, fam. Pteridophytae | 0.27% | |
| Galangal root (Indonesia) | 8023-91-4 | Alpinia galanga (L.) Willd., fam. Zingiberaceae | 6.2% |
| Germander, common (Italy) | Teucrium chamaedrys L., fam. Lamiaceae (Labiatae) | 0.05% | |
| Germander, common (Italy) headspace | Teucrium chamaedrys L., fam. Lamiaceae (Labiatae) | 0.7% | |
| Ginger (India) 1 | 8007-08-7 | Zingiber officinale Roscoe, fam. Zingiberaceae | 0.1% |
| Mandarin 2 | 8008-31-9 | Citrus deliciosa Tenore (C. reticulata Blanco, cv.mandarin), fam. Rutaceae | 0.63% |
| Orange, sweet (Italy) 1 | 8028-48-6 | Citrus sinensis (L.) Osbeck, fam. Rutaceae | 0.01% |
| Orange, sweet (China) 1, Wenzhou | 8028-48-6 | Citrus sinensis (L.) Osbeck, Wenzhou honey orange, fam. Rutaceae | 0.15% |
| Cedarleaf 5 | 8000-27-9 | Thuja occidentalis L., fam. Taxodiaceae | 1.0% |
| Nutmeg (Sri Lanka) 2 | 8008-45-5 | Myristica fragrans Houtt., fam. Myristicaceae | 2.46% |
| Celery plant | 8015-90-5 | Apium graveolens L. var. dulce, fam. Apiaceae (Umbelliferae) | 0.1% |
| Thyme 5 | 8007-46-3 | Thymus vulgaris L., fam. Lamiaceae (Labiatae) | 1.2% |
| Lovage seed (France) | 8016-31-7 | Levisticum officinale Koch, fam. Apiaceae (Umbelliferae) | 0.11% |
| Myrtle leaf (Spain) | 8008-46-6 | Myrtus communis L., fam. Myrtaceae | 0.06% |
| Myrtle flower (Spain) | 8008-46-6 | Myrtus communis L., fam. Myrtaceae | 0.16% |
| Myrtle unripe fruits (Spain) | 8008-46-6 | Myrtus communis L., fam. Myrtaceae | 0.08% |
| Myrtle ripe fruits (Spain) | 8008-46-6 | Myrtus communis L., fam. Myrtaceae | 0.06% |
| Laurel leaf (Pakistan) | 8006-78-8 | Laurus nobilis L., fam. Lauraceae | 0.31% |
| Tea Tree (Australia) 7 | 68647-73-4 | Melaleuca alternifolia (Maiden et Betche) Cheel, fam. Myrtaceae | 0.9% |
| Tea Tree (Australia) 8 | 68647-73-4 | Melaleuca alternifolia (Maiden et Betche) Cheel, fam. Myrtaceae | 1.1% |
| Patchouli (India) 1 | 8014-09-3 | Pogostemon cablin Benth., fam. Lamiaceae (Labiatae) | 0.01% |
| Tarragon (USA) 1 | 8016-88-4 | Artemisia dracunculus L. (French type), fam. Asteraceae (Compositae) | 0.01% |
| Tarragon (USA) 2 | 8016-88-4 | Artemisia dracunculus L. (French type), fam. Asteraceae (Compositae) | 0.01% |
| Tarragon (USA) 3 | 8016-88-4 | Artemisia dracunculus L. (Russian type), fam. Asteraceae (Compositae) | 0.01% |
| Tarragon (USA) 4 | 8016-88-4 | Artemisia dracunculus L. (Russian type), fam. Asteraceae (Compositae) | 0.02% |
| Sage, spanish (Spain) 4 | 8016-65-7 | Salvia lavandulaefolia Vahl., fam. Lamiaceae (Labiatae) | 0.22% |
| Pimento (Allspice) (Jamaica) 2 | 8006-77-7 | Pimenta dioica (L.) Merr. (P. officinalis Lindl.), fam. Myrtaceae | 0.45% |
| Sage, dalmatian 3 | 8022-56-8 | Salvia officinalis L., fam. Lamiaceae (Labiatae) | 0.1% |
| Galbanum 1 | 9000-24-2 | Ferula galbaniflua Boiss. et Buhse, fam. Apiaceae (Umbelliferae) | 0.4% |
| Angelica root 1 | 8015-64-3 | Angelica archangelica L., fam. Apiaceae (Umbelliferae) | 0.69% |
| Lemon (Argentina) 2 | 84929-31-7 | Citrus limon (L.) Burm. f., fam. Rutaceae | 0.01% |
| Lemon (Italy-Sicily) 3 | 84929-31-7 | Citrus limon (L.) Burm. f., fam. Rutaceae | 0.01% |
| Lemon (Italy-Sicily) 2 | 84929-31-7 | Citrus limon (L.) Burm. f., fam. Rutaceae | 0.37% |
| Lemon (Spain) 1 | 84929-31-7 | Citrus limon (L.) Burm. f., cultivar Verna, fam. Rutaceae | 0.33% |
| Lemon (Spain) 2 | 84929-31-7 | Citrus limon (L.) Burm. f., cultivar Fino, fam. Rutaceae | 0.24% |
| Lemon (Spain) 3 | 84929-31-7 | Citrus limon (L.) Burm. f., cultivar Eureka, fam. Rutaceae | 0.25% |
| Lemon (Spain) 4 | 84929-31-7 | Citrus limon (L.) Burm. f., cultivar Villafranca, fam. Rutaceae | 0.27% |
| Lemon (Spain) 5 | 84929-31-7 | Citrus limon (L.) Burm. f., cultivar Lisbon, fam. Rutaceae | 0.26% |
| Lemon (Spain) 6 | 84929-31-7 | Citrus limon (L.) Burm. f., cultivar Rodrejo, fam. Rutaceae | 0.47% |
| Oregano, spanish (Italy) 1 | 8007-11-2 | Coridothymus capitatus Rchb. (Thymus capitatus Hoffm. et Link.), Lamiaceae | 0.31% |
| Lavender (France) 6 | 8000-28-0 | Lavandula angustifolia Mill., fam. Lamiaceae (Labiatae) | 0.22% |
| Thyme 3 | 8007-46-3 | Thymus vulgaris L., fam. Lamiaceae (Labiatae) | 0.36% |
| Thyme 4 | 8007-46-3 | Thymus vulgaris L., fam. Lamiaceae (Labiatae) | 0.03% |
| Thyme red (Spain) 2 | 8007-46-3 | Thymus zygis L. ssp. sylvestris (Hoffm. et Link) Morales, fam. Lamiaceae | 0.36% |
| Thymus satureoides (Morocco) | 8007-46-3 | Thymus satureoides Boiss. et Reut., fam. Lamiaceae (Labiatae) | 0.4% |
| Achillea biebersteinii (Turkey) 1 | Achillea biebersteinii Afan., fam. Asteraceae (Compositae) | 0.01% | |
| Peppermint (Lithuania) | 8006-90-4 | Mentha piperita L. cultivar Lekartstvenaya-1, fam. Lamiaceae (Labiatae) | 1.2% |
| Peppermint (Italy) 6a | 8006-90-4 | Mentha piperita L., fam. Lamiaceae (Labiatae) | 0.1% |
| Peppermint (Italy) 6b | 8006-90-4 | Mentha piperita L., fam. Lamiaceae (Labiatae) | 0.4% |
| Ginger (China) 5 | 8007-08-7 | Zingiber officinale Roscoe, fam. Zingiberaceae | 0.1% |
| Sage, dalmatian (Yugoslavia) 1 | 8022-56-8 | Salvia officinalis L., fam. Lamiaceae (Labiatae) | 0.1% |
| Sage, dalmatian (Albany) 1 | 8022-56-8 | Salvia officinalis L., fam. Lamiaceae (Labiatae) | 0.17% |
| Sage, dalmatian (Dalmatia) 2 | 8022-56-8 | Salvia officinalis L., fam. Lamiaceae (Labiatae) | 0.12% |
| Juniper berry 4 | 8012-91-7 | Juniperus communis L., fam. Cupressaceae | 0.7% |
| Ajowan 2 seed | Trachyspermum copticum (L.) Link., fam. Apiaceae (Umbelliferae) | 0.2% | |
| Sideritis lycia (Turkey) | Sideritis lycia Boiss. et Heldr., fam. Lamiaceae (Labiatae) | 0.5% | |
| Coleus aromaticus (Vietnam) | Coleus aromaticus Benth. (wild oregano), fam. Lamiaceae (Labiatae) | 0.05% | |
| Coleus aromaticus (Java) | Coleus aromaticus Benth. (wild oregano), fam. Lamiaceae (Labiatae) | 0.2% | |
| Chenopodium ambrosioides | Chenopodium ambrosioides L., fam. Chenopodiaceae | 0.26% | |
| Geum montanum root | Geum montanum L., fam. Rosaceae | 0.13% | |
| Zingiber zerumbet (Vietnam) 2a stem | Zingiber zerumbet (L.) Sm., fam. Zingiberaceae | 0.05% | |
| Zingiber zerumbet (Vietnam) 2b leaf | Zingiber zerumbet (L.) Sm., fam. Zingiberaceae | 0.05% | |
| Athamanta macedonia (Greece) | Athamanta macedonia (L.) Sprengel, ssp. macedonia, fam. Apiaceae (Umbell.) | 0.64% | |
| Lippia multiflora leaf (Benin) | Lippia multiflora Moldenke (syn.L.adoensis & L.grandiflora) fam.Verbenacea | 0.1% | |
| Sage, spanish (Spain) 11 | 8016-65-7 | Salvia lavandulaefolia Vahl. ssp. vellerea, fam. Lamiaceae (Labiatae) | 0.18% |
| Sage, dalmatian (Spain) | 8022-56-8 | Salvia officinalis L., fam. Lamiaceae (Labiatae) | 0.06% |
| Salvia officinalis x S. lavandulaefolia vellerea | Salvia officinalis x S. lavandulaefolia ssp. vellerea, fam. Lamiaceae | 0.28% | |
| Camphor (Cote d'Ivoire), 1a leaf | 8008-51-3 | Cinnamomum camphora (L.) Nees et Ebermaier, fam. Lauraceae | 0.05% |
| Camphor (Cote d'Ivoire), 1b stem | 8008-51-3 | Cinnamomum camphora (L.) Nees et Ebermaier, fam. Lauraceae | 0.05% |
| Otostegia fruticosa | Otostegia fruticosa Forssk., fam. Lamiaceae (Labiatae) | 0.7% | |
| Curcuma pierreana (Vietnam), 1a rhizome | Curcuma pierreana Gagnep., fam. Zingiberaceae | 0.05% | |
| Curcuma pierreana (Vietnam), 1b stem | Curcuma pierreana Gagnep., fam. Zingiberaceae | 0.01% | |
| Curcuma pierreana (Vietnam), 1c leaf | Curcuma pierreana Gagnep., fam. Zingiberaceae | 0.05% | |
| Illicium griffithii fruit | Illicium griffithii Hook. f. et Thoms., fam. Magnoliaceae (Illiciaceae) | 0.05% | |
| Sage, dalmatian (Italy) 5 | 8022-56-8 | Salvia officinalis L. var. angustifolia Ten., fam. Lamiaceae (Labiatae) | 0.25% |
| Cymbopogon caesius leaf | Cymbopogon caesius (Nees ex Hook. et Arn.) Stapf., fam. Poaceae (Graminea) | 0.57% | |
| Mandarin (Columbia) | 8008-31-9 | Citrus deliciosa Tenore (C. reticulata Blanco, cv.mandarin), fam. Rutaceae | 0.17% |
| Mandarin (Italy) 7 | 8008-31-9 | Citrus deliciosa Tenore (C. reticulata Blanco, cv.mandarin), fam. Rutacaea | 0.91% |
| Ocimum gratissimum (Cuba) 1a | Ocimum gratissimum L., fam. Lamiaceae (Labiatae) | 8.23% | |
| Ocimum gratissimum (Cuba) 1b | Ocimum gratissimum L., fam. Lamiaceae (Labiatae) | 2.21% | |
| Lemon (Italy-Sardinia) | 84929-31-7 | Citrus limon (L.) Burm. f., fam. Rutaceae | 0.2% |
| Satureja gilliesii | Satureja gilliesii (Grah.) Briq., fam. Lamiaceae (Labiatae) | 0.1% | |
| Bay, West Indian (Benin) | 8015-73-4 | Pimenta racemosa var. racemosa (P. Miller) J.W. Moore, fam. Myrtaceae | 0.2% |
| Bay, West Indian 3 | 8015-73-4 | Pimenta racemosa var. racemosa (P. Miller) J.W. Moore, fam. Myrtaceae | 0.01% |
| Myrica cerifera leaf (Cuba) | Myrica cerifera L., fam. Myricaceae | 0.1% | |
| Hyssop (Spain) | 8006-83-5 | Hyssopus officinalis L., fam. Lamiaceae (Labiatae) | 0.21% |
| Achillea ligustica leaf (Greece) | Achillea ligustica All., fam. Asteraceae (Compositae) | 0.04% | |
| Achillea ligustica flower (Greece) | Achillea ligustica All., fam. Asteraceae (Compositae) | 0.03% | |
| Psiadia viscosa | Psiadia viscosa (Lam.) A.J. Scott, fam. Asteraceae (Compositae) | 0.1% | |
| Turmeric (Vietnam) 2 leaf | 8024-37-1 | Curcuma longa L. (C. domestica Val.), fam. Zingiberaceae | 0.2% |
| Canella winterana (French West Indies) stem bark | Canella winterana (L.) Gaertn., fam. Canellaceae | 0.2% | |
| Cardamom, large (Nepalese) (India) 2 | Amomum subulatum Roxb., fam. Zingiberaceae | 0.32% | |
| Vassoura (Brazil) 3 | Baccharis dracunculifolia DC., fam. Asteraceae (Compositae) | 0.1% | |
| Lime (Persian) (Japan) | Citrus latifolia Tanaka, fam. Rutaceae | 0.02% | |
| Minthostachys spicata | Minthostachys spicata (Benth.) Epl., fam Lamiaceae (Labiatae) | 0.01% | |
| Artemisia umbelliformis (Italy) | Artemisia umbelliformis Lam., fam. Asteraceae (Compositae) | 0.3% | |
| Artemisia campestris (Italy) 1 | Artemisia campestris L. ssp. borealis (Pallas), H.M. Hall et Clements | 0.01% | |
| Artemisia genipi (Italy) | Artemisia genipi Weber, fam. Asteraceae (Compositae) | 0.8% | |
| Artemisia petrosa (Italy) | Artemisia petrosa Baumg. ssp. eriantha Ten., fam. Asteraceae (Compositae) | 0.1% | |
| Artemisia vallesiaca (Italy) | Artemisia vallesiaca All., fam. Asteraceae (Compositae) | 0.01% | |
| Wormwood (Mugwort) (Italy) 2 | 8008-93-3 | Artemisia absinthium L., fam. Asteraceae (Compositae) | 0.01% |
| Artemisia chamaemelifolia (Italy) | Artemisia chamaemelifolia Vill., fam. Asteraceae (Compositae) | 0.1% | |
| Artemisia glacialis (Italy) | Artemisia glacialis L., fam. Asteraceae (Compositae) | 0.01% | |
| Artemisia campestris (Italy) 2 | Artemisia campestris L. ssp. campestris, fam. Asteraceae (Compositae) | 0.01% | |
| Artemisia alba (Italy) | 84775-75-7 | Artemisia alba Turra, fam. Asteraceae (Compositae) | 0.2% |
| Oregano, spanish (Greece) 4 | 8007-11-2 | Coridothymus capitatus Rchb. (Thymus capitatus Hoffm. et Link.), Lamiaceae | 0.7% |
| Eucalyptus camaldulensis (Burkina Faso) | Eucalyptus camaldulensis Dehn., fam. Myrtaceae | 1.3% | |
| Piper auritum (Cuba) | Piper auritum H.B.K., fam. Piperaceae | 0.1% | |
| Bupleurum gibraltarium (Spain) | Bupleurum gibraltarium Lam., fam. Apiaceae (Umbelliferae) | 0.2% | |
| Lemon (Italy-Sicily) 12a Femminello | 84929-31-7 | Citrus limon (L.) Burm. f., cultivar Femminello, fam. Rutaceae | 0.41% |
| Lemon (Italy-Sicily) 12b Lo Porto | 84929-31-7 | Citrus limon (L.) Burm. f., cultivar Lo Porto, fam. Rutaceae | 0.3% |
| Lemon (Italy-Sicily) 12c Monachello | 84929-31-7 | Citrus limon (L.) Burm. f., cultivar Monachello, fam. Rutaceae | 0.48% |
| Lime (Mexican, West Indian, Key) 6 | 8008-26-2 | Citrus aurantifolia (Christm.) Swingle, fam. Rutaceae | 0.43% |
| Santolina ligustica (Italy) | Santolina ligustica Arrigonia, fam. Asteraceae (Compositae) | 0.4% | |
| Cypress, Leyland (Poland) | Cupressocyparis leylandii (Dall. et Jacks.) Dall., fam. Cupressaceae | 0.6% | |
| Rosemary (Brazil) 1 | 8000-25-7 | Rosmarinus officinalis L., fam. Lamiaceae (Labiatae) | 6.0% |
| Rosemary (Uruguay) | 8000-25-7 | Rosmarinus officinalis L., fam. Lamiaceae (Labiatae) | 0.25% |
| Sage, dalmatian (Hungary) 2 | 8022-56-8 | Salvia officinalis L., fam. Lamiaceae (Labiatae) | 0.2% |
| Sage, spanish (Hungary) | 8016-65-7 | Salvia lavandulaefolia Vahl., fam. Lamiaceae (Labiatae) | 0.4% |
| Thyme 8 | 8007-46-3 | Thymus vulgaris L., fam. Lamiaceae (Labiatae) | 0.8% |
| Myrtle leaf (Albania) 2 | 8008-46-6 | Myrtus communis L., fam. Myrtaceae | 0.28% |
| Myrtle flower (Albania) | 8008-46-6 | Myrtus communis L., fam. Myrtaceae | 0.1% |
| Myrtle berry (Albania) | 8008-46-6 | Myrtus communis L., fam. Myrtaceae | 0.12% |
| Artemisia verlotiorum (France) | Artemisia verlotiorum Lamotte, fam. Asteraceae (Compositae) | 0.3% | |
| Calycolpus australis leaf | Calycolpus australis Landrum, fam. Myrtaceae | 3.64% | |
| Fennel, bitter (Spain) 3 | 8006-84-6 | Foeniculum vulgare Miller, var. vulgare DC, fam. Apiaceae (Umbelliferae) | 0.2% |
| Kewda (India) | Pandanus fascicularis Lam., var. fascilarris, fam. Pandanaceae | 0.4% | |
| Mullilam seed (India) | Zanthoxylum rhetsa D.C. syn. Z. limonella (Dennst.) Alston, fam. Rutaceae | 0.5% | |
| Prangos uechtritzii (Turkey) fruit | Prangos uechtritzii Boiss. et Hausskn., fam. Apiaceae (Umbelliferae) | 0.3% | |
| Origanum libanoticum (Lebanon) | Origanum libanoticum Boiss., fam. Lamiaceae (Labiatae) | 1.4% | |
| Origanum syriacum (Lebanon) | Origanum syriacum L., fam. Lamiaceae (Labiatae) | 0.3% | |
| Alpinia laosensis (Vietnam) | Alpinia laosensis Gagnep., fam. Zingiberaceae | 0.01% | |
| Bergamot (Turkey) 2 | 8007-75-8 | Citrus bergamia Risso et Poiteau, fam. Rutaceae | 0.2% |
| Hyptis suaveolens (Nigeria) | Hyptis suaveolens (L.) Poit., fam. Lamiaceae (Labiatae) | 0.6% | |
| Abies alba needle (Serbia) | 8021-27-0 | Abies alba Mill., fam. Pinaceae | 2.8% |
| Abies cephalonica needle (Greece) | Abies cephalonica Loud., fam. Pinaceae | 1.2% | |
| Abies borisii-regis needle (Greece) | Abies borisii-regis Mattf., fam. Pinaceae | 1.6% | |
| Cupressus macrocarpa leaf (Argentina) | Cupressus macrocarpa Hartw., fam. Cupressaceae | 1.4% | |
| Artemisia scoparia (India) 2 | Artemisia scoparia Waldst. et Kit., fam. Asteraceae (Compositae) | 0.1% | |
| Bacuri fruit (Brazil) | Platonia insignis M., fam. Guttiferae | 1.1% | |
| Ocimum gratissimum (Benin) 2 | Ocimum gratissimum L., fam. Lamiaceae (Labiatae) | 5.0% | |
| Rosmarinus eriocalyx (Algeria) 2 | Rosmarinus eriocalyx Jordan & Fourr., fam. Lamiaceae (Labiatae) | 0.01% | |
| Rosemary (Algeria) 2 | 8000-25-7 | Rosmarinus officinalis L., fam. Lamiaceae (Labiatae) | 0.01% |
| Ravensara aromatica (Finland) | Ravensara aromatica Sonn., fam. Lauraceae | 1.2% | |
| Tagetes patula (India) | Tagetes patula L., fam. Asteraceae (Compositae) | 0.4% | |
| Curcuma mangga (Malaysia) | Curcuma mangga Val., fam Zingiberaceae | 0.05% | |
| Curcuma xanthorrhiza (Malaysia) | Curcuma xanthorrhiza Roxb., fam. Zingiberaceae | 0.05% | |
| Curcuma aeruginosa (Malaysia) 2 | Curcuma aeruginosa Roxb., fam. Zingiberaceae | 0.05% | |
| Coleus aromaticus (India) 2 | Coleus aromaticus Benth. (wild oregano), fam. Lamiaceae (Labiatae) | 0.7% | |
| Mandarin (Spain) 2 | 8008-31-9 | Citrus deliciosa Tenore (C. reticulata Blanco, cv.mandarin), fam. Rutaceae | 0.4% |
| Mandarin (Uruguay) 3 | 8008-31-9 | Citrus deliciosa Tenore cv. Nova (C. reticulata Blanco), fam. Rutaceae | 0.01% |
| Tansy, moroccan (Morocco) 1 | Tanacetum annuum L., fam. Asteraceae (Compositae) | 0.1% | |
| Tansy, moroccan (Morocco) 2 | Tanacetum annuum L., fam. Asteraceae (Compositae) | 0.7% | |
| Sage, dalmatian (Albany) 3 | 8022-56-8 | Salvia officinalis L., fam. Lamiaceae (Labiatae) | 0.5% |
| Manuka (New Zealand) 1 | Leptospermum scoparium J.R. et F. Forst., fam. Myrtaceae | 0.03% | |
| Marjoram, sweet 4c standard solvent extract | 8015-01-8 | Majorana hortensis Moench, Origanum majorana L., fam. Lamiaceae (Labiatae) | 2.1% |
| Cinnamomum cordatum (Malaysia) 1a leaf | Cinnamomum cordatum Kosterm., fam. Lauraceae | 0.2% | |
| Thymus transcaspicus (Iran) | Thymus transcaspicus Klokov, fam. Lamiaceae (Labiatae) | 0.25% | |
| Origanum glandulosum (Algeria) | Origanum glandulosum Desf., fam. Lamiaceae (Labiatae) | 0.5% | |
| Lanyana (South Afrika) 2 | Artemisia afra Jacq., fam. Asteraceae (Compositae) | 0.2% | |
| Pteronia incana 3 | Pteronia incana, fam. Asteraceae (Compositae) | 1.4% | |
| Savory, summer (Iran) 2 | 8016-68-0 | Satureja hortensis L., fam. Lamiaceae (Labiatae) | 1.7% |
| Orange leaf, sweet (Italy) 3 Valencia late | Citrus sinensis (L.) Osbeck, cultivar Valencia late, fam. Rutaceae | 0.3% | |
| Lemon leaf (petitgrain) (Italy) 5 Femminello | 84929-31-7 | Citrus limon (L.) Burm. f., cultivar Femminello, fam. Rutaceae | 0.05% |
| Citrus cybrid leaf (Italy) | Citrus sinensis (L.) Osbeck x C. limon (L.) Burm. f., fam. Rutaceae | 0.05% | |
| Zataria multiflora (Iran) 1a bud | Zataria multiflora Boiss., fam. Lamiaceae (Labiatae) | 0.01% | |
| Zataria multiflora (Iran) 1b flower | Zataria multiflora Boiss., fam. Lamiaceae (Labiatae) | 0.08% | |
| Baccharis cordobensis (Argentina) | Baccharis cordobensis Heering, fam. Asteraceae (Compisitae) | 0.05% | |
| Seafennel (Turkey) 1a Antalya | 89997-98-8 | Crithmum maritimum L., fam. Apiaceae (Umbelliferae) | 0.2% |
| Seafennel (Turkey) 1b Mersin | 89997-98-8 | Crithmum maritimum L., fam. Apiaceae (Umbelliferae) | 0.7% |
| Oregano, greek (Croatia) | 84012-24-8 | Origanum vulgare L. ssp. hirtum (Link) Ietsw., fam. Lamiaceae (Labiatae) | 0.5% |
| Lippia alba (India) | Lippia alba (Mill.) N.E. Br., fam. Verbenaceae | 0.3% | |
| Orange, sweet (Ethiopia) 1a cv Valencia | 8028-48-6 | Citrus sinensis (L.) Osbeck, fam. Rutaceae | 0.01% |
| Orange, sweet (Ethiopia) 1b cv Hamlin | 8028-48-6 | Citrus sinensis (L.) Osbeck, fam. Rutaceae | 0.01% |
| Ocimum gratissimum (Guinea) | Ocimum gratissimum L., fam. Lamiaceae (Labiatae) | 5.26% | |
| Ocimum suave (Guinea) | Ocimum suave L., fam. Lamiaceae (Labiatae) | 6.26% | |
| Zataria multiflora (Iran) 2 flowering tops | Zataria multiflora Boiss., fam. Lamiaceae (Labiatae) | 0.77% | |
| Pelargonium exstipulatum leaf | Pelargonium exstipulatum (Cav.) L'Herit., fam- Geraniaceae | 25.0% | |
| Pelargonium x fragrans leaf | Pelargonium x fragrans, fam. Geraniaceae | 5.9% | |
| Bergamot (Japan) 1 | 8007-75-8 | Citrus bergamia Risso et Poiteau, fam. Rutaceae | 0.15% |
| Bergamot (Italy, Sicily) 1a Castagnaro | 8007-75-8 | Citrus bergamia Risso et Poiteau, fam. Rutaceae | 0.3% |
| Bergamot (Italy, Sicily) 1b Fantastico | 8007-75-8 | Citrus bergamia Risso et Poiteau, fam. Rutaceae | 0.29% |
| Bergamot (Italy, Sicily) 1c Feminello | 8007-75-8 | Citrus bergamia Risso et Poiteau, fam. Rutaceae | 0.19% |
| Bergamot (Italy, Sicily) 1d PCF | 8007-75-8 | Citrus bergamia Risso et Poiteau, fam. Rutaceae | 0.22% |
| Bergamot (Italy, Calabria) 8 | 8007-75-8 | Citrus bergamia Risso et Poiteau, fam. Rutaceae | 0.32% |
| Bergamot (Italy) 7 | 8007-75-8 | Citrus bergamia Risso et Poiteau, fam. Rutaceae | 0.3% |
| Bergamot (Turkey) 3a green fruit | 8007-75-8 | Citrus bergamia Risso et Poiteau, fam. Rutaceae | 0.1% |
| Bergamot (Turkey) 3b green/yellow fruit | 8007-75-8 | Citrus bergamia Risso et Poiteau, fam. Rutaceae | 0.2% |
| Bergamot (Italy) 5a original oil | 8007-75-8 | Citrus bergamia Risso et Poiteau, fam. Rutaceae | 0.01% |
| Bergamot (Italy) 5b headspace of oil | 8007-75-8 | Citrus bergamia Risso et Poiteau, fam. Rutaceae | 0.01% |
| Bergamot (Italy) 5c headspace heated oil | 8007-75-8 | Citrus bergamia Risso et Poiteau, fam. Rutaceae | 0.01% |
| Bunium persicum fruit (Iran) | Bunium persicum (Boiss.) B. Fedtsch., fam. Apiaceae (Umbelliferae) | 0.3% | |
| Phlomis fruticosa (Yugoslavia) | Phlomis fruticosa L., fam. Lamiaceae (Labiatae) | 0.05% | |
| Peppermint (Mexico) | 8006-90-4 | Mentha piperita L., fam. Lamiaceae (Labiatae) | 0.01% |
| Minthostachys mollis (Argentina) | Minthostachys mollis (Kunth.) Grisebach, fam. Lamiaceae (Labiatae) | 0.37% | |
| Eucalyptus camaldulensis (Congo) | Eucalyptus camaldulensis Dehn., fam. Myrtaceae | 0.6% | |
| Eugenia uruguauensis (Brazil) | Eugenia uruguayensis Camb., fam. Myrtaceae | 23.5% | |
| Eugenia umbelliflora (Brazil) | Eugenia umbelliflora O. Berg, fam. Myrtaceae | 0.9% | |
| Ajowan (Iran) aerial part | Trachyspermum copticum (L.) Link., fam. Apiaceae (Umbelliferae) | 0.3% | |
| Ajowan (Iran) seed | Trachyspermum copticum (L.) Link., fam. Apiaceae (Umbelliferae) | 0.3% | |
| Semenovia tragioides (Iran) | Semenovia tragioides (Boiss.) Manden., fam. Apiaceae (Umbelliferae) | 0.01% | |
| Heracleum persicum (Iran) 1a leaf a | Heracleum persicum L., fam. Apiaceae (Umbelliferae) | 0.01% | |
| Annual wormwood (India) 2 | 84775-74-6 | Artemisia annua L., fam. Asteraceae (Compositae) | 0.1% |
| Sage, dalmatian (Italy) 9 | 8022-56-8 | Salvia officinalis L., fam. Lamiaceae (Labiatae) | 0.01% |
| Rosemary (Italy) 15 | 8000-25-7 | Rosmarinus officinalis L., fam. Lamiaceae (Labiatae) | 0.01% |