beta-CARYOPHYLLENE OXIDE
-
Identifiers
CAS number
1139-30-6Molecular formula
C15H24OSMILES
C[C@@]12CC[C@@H]3[C@H](CC3(C)C)C(=C)CC[C@H]1O2
Safety labels
Irritant
EnvironmentalRetention indicies (RI)
- DB5: 1594.86
- Carbowax: 1976.57
-
Odor profile
Woody 83.22% Amber 49.33% Sweet 49.28% Cedar 48.65% Spicy 48.42% Dry 47.01% Fresh 41.95% Tobacco 38.61% Camphoreous 37.15% Earthy 36.41% Scent© AI
-
Properties
XLogP3-AA
3.6Molecular weight
220.35 g/molVapor pressure est.
- hPa @ 20°C
- hPa @ 25°C
Evaporation rate
SlowBoiling point est.
290°CFlash point est.
102.41 ˚CSolubility expt.
- Insoluble in water; Soluble in fat
- Soluble (in ethanol)
-
Synonyms
- Caryophyllene oxide
- (-)-Caryophyllene oxide
- 1139-30-6
- beta-Caryophyllene oxide
- beta-Caryophyllene epoxide
- (-)-Epoxycaryophyllene
- Epoxycaryophyllene
- trans-caryophyllene oxide
- (-)Carophyllene oxide
- UNII-S2XU9K448U
- MFCD00134216
- (-)-Epoxydihydrocaryophyllene
- S2XU9K448U
- Caryophylene oxide
- HSDB 5466
- EINECS 214-519-7
- (-)-BETA-CARYOPHYLLENE EPOXIDE
- CARYOPHYLLENE, EPOXIDE
- CHEMBL508894
- DTXSID4051586
- FEMA NO. 4085
- CHEBI:67818
- (1R,4R,6R,10S)-4,12,12-trimethyl-9-methylidene-5-oxatricyclo[8.2.0.04,6]dodecane
- 4,11,11-Trimethyl-8-methylene-5-oxatricyclo(8.2.0.0(4,6))dodecane
- .beta.-Caryophyllene oxide
- 4,12,12-Trimethyl-9-methylene-5-oxatricyclo(8.2.0.04,6)dodecane, (1R,4R,6R,10S)-
- 5-Oxatricyclo(8.2.0.0(4,6))dodecane, 4,12,12-trimethyl-9-methylene-, (1R,4R,6R,10S)-
- Caryophyllene Oxide 1000 microg/mL in Isopropanol
- epoxide
- (-)-.beta.-Caryophyllene epoxide
- 4-12,12-TRIMETHYL-9-METHYLENE-5-OXATRICYLO (8.2.0.04,6) DODECANE
- (1R,4R,6R,10S)-4,12,12-TRIMETHYL-9-METHYLIDENE-5-OXATRICYCLO[8.2.0.0?,?]DODECANE
- 5-Oxatricyclo(8.2.0.04,6)dodecane, 4,12,12-trimethyl-9-methylene-, (1R,4R,6R,10S)-
- b-Caryophyllene Epoxide
- [1R-(1R*,4R*,6R*,10S*)]-4,12,12-trimethyl-9-methylene-5-oxatricyclo[8.2.0.04,6]dodecane
- 5-Oxatricyclo(8.2.0.0(sup 4,6))dodecane, 4,12,12-trimethyl-9-methylene-, (1R,4R,6R,10S)-
- 5-OXATRICYCLO(8.2.0.04,6)DODECANE, 4,12,12-TRIMETHYL-9-METHYLENE-, (1R-(1R*,4R*,6R*,10S*))-
- ambar crystal
- bcp oxide
- (1R-(1R*,4R*,6R*,10S*))-4,12,12-Trimethyl-9-methylene-5-oxatricyclo(8.2.0.04,6)dodecane
- b-Caryophyllene oxide
- ?-caryophyllene oxide
- CARYOPHYLLENEOXIDE
- trimethyl(methylene)[?]
- Caryophyllene Oxide 90001
- SCHEMBL127077
- Caryophyllene oxide (Standard)
- DTXCID8030138
- (-)-Caryophyllene oxide, 95%
- HY-N3544R
- NVEQFIOZRFFVFW-RGCMKSIDSA-N
- 4,12,12-trimethyl-9-methylene-
- 4beta,5alpha-EPOXYCARYOPHYLLENE
- HY-N3544
- Tox21_303807
- BDBM50241720
- CARYOPHYLLENE 4beta,5alpha-OXIDE
- s3983
- AKOS030241571
- CARYOPHYLLENE 4beta,5alpha-EPOXIDE
- CCG-208462
- FC63185
- (1R,4R,6R,10S)-9-Methylene-4,12,12-trimethyl-5-oxatricyclo[8.2.0.04,6]dodecane
- NCGC00357089-01
- AS-58060
- BETA-CARYOPHYLLENE EPOXIDE, (-)-
- .BETA.-CARYOPHYLLENE OXIDE [FHFI]
- CAS-1139-30-6
- 4.BETA.,5.ALPHA.-EPOXYCARYOPHYLLENE
- CS-0023810
- CARYOPHYLLENE 4.BETA.,5.ALPHA.-OXIDE
- (-)-BETA-CARYOPHYLLENE EPOXIDE [HSDB]
- C16908
- CARYOPHYLLENE 4.BETA.,5.ALPHA.-EPOXIDE
- E80731
- SR-05000002236
- SR-05000002236-2
- (-)-Caryophyllene oxide, analytical reference material
- (1R,4R,5R,9S)-4,5-epoxycaryophyllan-8(13)-ene
- Q27136294
- (-)-Caryophyllene oxide, >=99.0% (sum of enantiomers, GC)
- (1R,4R,6R,10S)- 5-Oxatricyclo[8.2.0.0(4,6)-]dodecane
- 4,12,12-trimethyl-9-methylene-5-oxatricyclo[8.2.0.0~4,6~]dodecane
- (-)-5-Oxatricyclo[8.2.0.0(4,6)]dodecane,4,12,12-trimethyl-9-methylene-
- (1R,4R,6R,10S)-4,12,12-Trimethyl-9-methylene-5-oxatricyclo[8.2.0.04,6]dodecane
- (1R,4R,6R,10S)-9-Methylene-4,12,12-trimethyl-5-oxatricyclo[8.2.0.0(4,6])dodecane
- (1R,4R,6R,10S)- 4,12,12-trimethyl-9-methylene-5-oxatricyclo[8.2.0.]dodecane (caryophyllene oxide) 5-Oxatricyclo(8.2.0.0(4,6))dodecane
- [1R-(1R*,4R*,6R*,10S*)]- (-)-Epoxydihydrocaryophyllene (-)-<
>-Caryophyllene epoxide (-)-< >-Caryophyllene oxide 4,11,11-Trimethyl-8-methylene-5-oxatricyclo(8.2.0.0(4,6))dodecane - [1R-(1R*,4R*,6R*,10S*)]- Caryophylene oxide Caryophyllene epoxide Caryophyllene oxyde Epoxycaryophyllene [1R-(1R*,4R*,6R*,10S*)]-4,12,12-trimethyl-9-methylene-5-oxatricyclo[8.2.0.04,6]dodecane <
>-Caryophyllene epoxide < >-Caryophyllene oxide - 214-519-7
- 5-OXATRICYCLO(8.2.0.0(4,6))DODECANE, 4,12,12-TRIMETHYL-9-METHYLENE-, (1R-(1R*,4R*,6R*,10S*))-
- 5-OXATRICYCLO(8.20.0(4,6))DODECANE, 4,12,12-TRIMETHYL-9-METHYLENE-, (1R,4R,6R,10S)-
-
Applications
(−)-Caryophyllene oxide (CAS 1139-30-6) is an oxygenated sesquiterpene naturally present in essential oils of clove, black pepper, lemongrass and cannabis, and its warm spicy-woody scent underpins diverse applications: in food technology it is a GRAS flavor and fragrance additive for confectionery, baked goods and beverages; in perfumery and cosmetics it supplies woody notes, acts as a fixative and prolongs aroma longevity; in agriculture it functions as a botanical insect repellent and bio-fungicide for seed and crop protection; in medicine it is under investigation for anti-inflammatory, analgesic, antibacterial, antifungal, P-glycoprotein-inhibitory and anticancer activities that may enhance drug bioavailability and inspire new therapies; additionally, the compound serves as a reference standard in essential-oil analysis, a canine scent marker for cannabis detection, and a versatile chiral scaffold in synthetic chemistry, education and pharmacological assays.
-
Solubility @25˚C
Solvent Solubility (g/L) ethanol 258.93 methanol 199.75 isopropanol 232.43 water 0.98 ethyl acetate 273.32 n-propanol 221.58 acetone 266.46 n-butanol 225.18 acetonitrile 242.32 DMF 231.73 toluene 287.96 isobutanol 172.84 1,4-dioxane 595.99 methyl acetate 250.5 THF 780.65 2-butanone 268.14 n-pentanol 158.76 sec-butanol 166.54 n-hexane 27.67 ethylene glycol 52.26 NMP 203.77 cyclohexane 71.69 DMSO 176.1 n-butyl acetate 297.12 n-octanol 129.16 chloroform 807.36 n-propyl acetate 212.08 acetic acid 183.98 dichloromethane 603.47 cyclohexanone 359.4 propylene glycol 90.7 isopropyl acetate 237.36 DMAc 235.29 2-ethoxyethanol 234.95 isopentanol 202.84 n-heptane 41.76 ethyl formate 185.72 1,2-dichloroethane 281.91 n-hexanol 241.58 2-methoxyethanol 340.02 isobutyl acetate 197.89 tetrachloromethane 127.24 n-pentyl acetate 199.32 transcutol 886.93 n-heptanol 133.67 ethylbenzene 149.37 MIBK 202.4 2-propoxyethanol 384.1 tert-butanol 220.67 MTBE 236.85 2-butoxyethanol 246.9 propionic acid 153.08 o-xylene 162.26 formic acid 61.15 diethyl ether 245.66 m-xylene 201.36 p-xylene 203.1 chlorobenzene 271.37 dimethyl carbonate 115.57 n-octane 17.69 formamide 101.02 cyclopentanone 387.6 2-pentanone 232.5 anisole 267.99 cyclopentyl methyl ether 282.09 gamma-butyrolactone 373.85 1-methoxy-2-propanol 290.87 pyridine 423.87 3-pentanone 178.88 furfural 361.05 n-dodecane 17.42 diethylene glycol 268.5 diisopropyl ether 109.65 tert-amyl alcohol 155.76 acetylacetone 298.43 n-hexadecane 20.36 acetophenone 231.43 methyl propionate 195.52 isopentyl acetate 313.9 trichloroethylene 540.49 n-nonanol 121.07 cyclohexanol 189.75 benzyl alcohol 203.78 2-ethylhexanol 156.01 isooctanol 114.66 dipropyl ether 195.27 1,2-dichlorobenzene 240.82 ethyl lactate 114.1 propylene carbonate 264.59 n-methylformamide 136.87 2-pentanol 156.71 n-pentane 34.56 1-propoxy-2-propanol 299.89 1-methoxy-2-propyl acetate 354.99 2-(2-methoxypropoxy) propanol 253.9 mesitylene 129.31 ε-caprolactone 328.1 p-cymene 127.23 epichlorohydrin 459.61 1,1,1-trichloroethane 288.52 2-aminoethanol 110.84 morpholine-4-carbaldehyde 356.85 sulfolane 271.67 2,2,4-trimethylpentane 23.48 2-methyltetrahydrofuran 422.31 n-hexyl acetate 264.14 isooctane 25.56 2-(2-butoxyethoxy)ethanol 328.79 sec-butyl acetate 184.89 tert-butyl acetate 241.98 decalin 40.86 glycerin 113.74 diglyme 582.77 acrylic acid 127.94 isopropyl myristate 125.96 n-butyric acid 224.95 acetyl acetate 219.54 di(2-ethylhexyl) phthalate 129.26 ethyl propionate 180.73 nitromethane 257.43 1,2-diethoxyethane 344.17 benzonitrile 286.28 trioctyl phosphate 93.09 1-bromopropane 214.11 gamma-valerolactone 543.63 n-decanol 91.52 triethyl phosphate 112.97 4-methyl-2-pentanol 130.38 propionitrile 228.38 vinylene carbonate 282.06 1,1,2-trichlorotrifluoroethane 281.89 DMS 212.4 cumene 111.71 2-octanol 91.37 2-hexanone 209.96 octyl acetate 143.38 limonene 144.44 1,2-dimethoxyethane 413.42 ethyl orthosilicate 114.27 tributyl phosphate 107.85 diacetone alcohol 209.96 N,N-dimethylaniline 166.48 acrylonitrile 233.77 aniline 233.96 1,3-propanediol 191.75 bromobenzene 295.91 dibromomethane 398.46 1,1,2,2-tetrachloroethane 424.49 2-methyl-cyclohexyl acetate 214.87 tetrabutyl urea 125.21 diisobutyl methanol 118.67 2-phenylethanol 250.91 styrene 173.74 dioctyl adipate 166.46 dimethyl sulfate 121.48 ethyl butyrate 217.52 methyl lactate 120.23 butyl lactate 170.37 diethyl carbonate 164.41 propanediol butyl ether 217.98 triethyl orthoformate 187.9 p-tert-butyltoluene 126.16 methyl 4-tert-butylbenzoate 194.85 morpholine 539.92 tert-butylamine 166.96 n-dodecanol 73.64 dimethoxymethane 286.3 ethylene carbonate 250.48 cyrene 199.39 2-ethoxyethyl acetate 286.06 2-ethylhexyl acetate 255.25 1,2,4-trichlorobenzene 266.15 4-methylpyridine 409.5 dibutyl ether 165.6 2,6-dimethyl-4-heptanol 118.67 DEF 199.6 dimethyl isosorbide 391.19 tetrachloroethylene 265.95 eugenol 197.43 triacetin 260.87 span 80 222.67 1,4-butanediol 82.91 1,1-dichloroethane 321.93 2-methyl-1-pentanol 149.95 methyl formate 121.42 2-methyl-1-butanol 163.55 n-decane 27.78 butyronitrile 257.0 3,7-dimethyl-1-octanol 152.65 1-chlorooctane 90.29 1-chlorotetradecane 44.16 n-nonane 24.53 undecane 21.35 tert-butylcyclohexane 36.23 cyclooctane 30.37 cyclopentanol 193.94 tetrahydropyran 496.45 tert-amyl methyl ether 158.81 2,5,8-trioxanonane 372.12 1-hexene 94.64 2-isopropoxyethanol 191.22 2,2,2-trifluoroethanol 81.64 methyl butyrate 212.97 Scent© AI
| Maximum acceptable concentrations in the finished product (%) | |||
|---|---|---|---|
|
Category 1
Products applied to the lips
|
No restriction |
Category 7A
Rinse-off products applied to the hair with some hand contact
|
No restriction |
|
Category 2
Products applied to the axillae
|
No restriction |
Category 7B
Leave-on products applied to the hair with some hand contact
|
No restriction |
|
Category 3
Products applied to the face/body using fingertips
|
No restriction |
Category 8
Products with significant anogenital exposure
|
No restriction |
|
Category 4
Products related to fine fragrance
|
No restriction |
Category 9
Products with body and hand exposure, primarily rinse off
|
No restriction |
|
Category 5A
Body lotion products applied to the body using the hands (palms), primarily leave on
|
No restriction |
Category 10A
Household care products with mostly hand contact
|
No restriction |
|
Category 5B
Face moisturizer products applied to the face using the hands (palms), primarily leave on
|
No restriction |
Category 10B
Household care products with mostly hand contact, including aerosol/spray products (with potential leave-on skin contact)
|
No restriction |
|
Category 5C
Hand cream products applied to the hands using the hands (palms), primarily leave on
|
No restriction |
Category 11A
Products with intended skin contact but minimal transfer of fragrance to skin from inert substrate without UV exposure
|
No restriction |
|
Category 5D
Baby Creams, baby Oils and baby talc
|
No restriction |
Category 11B
Products with intended skin contact but minimal transfer of fragrance to skin from inert substrate with potential UV exposure
|
No restriction |
|
Category 6
Products with oral and lip exposure
|
No restriction |
Category 12
Products not intended for direct skin contact, minimal or insignificant transfer to skin
|
No restriction |
| Name | CAS | Botanical | Proportion |
|---|---|---|---|
| Achillea wilhelmsii (Egypt) | Achillea wilhelmsii C. Koch (A. santolina Auct. Mult.), fam. Asteraceae | 0.5% | |
| Achillea wilhelmsii (Turkey) | Achillea wilhelmsii C. Koch (A. santolina Auct. Mult.), fam. Asteraceae | 1.1% | |
| Ageratum conyzoides (Vietnam) | 85480-32-6 | Ageratum conyzoides L., fam. Asteraceae (Compositae) | 0.5% |
| Chamomile, wild (Morocco) | Ormenis mixta, fam. Asteraceae (Compositae) | 0.8% | |
| Artemisia scoparia (India) 1 | Artemisia scoparia Waldst. & Kit., fam. Asteraceae (Compositae) | 0.05% | |
| Ayou | Aydendron barbeyana Mez. (Nectandra globosa Mez.), fam. Lauraceae | 1.1% | |
| Lemon balm (Finland) | 8014-71-9 | Melissa officinalis L., fam. Lamiaceae (Labiatae) | 7.7% |
| Lemon balm (Germany) | 8014-71-9 | Melissa officinalis L., fam. Lamiaceae (Labiatae) | 12.3% |
| Lemon balm (Spain) | 8014-71-9 | Melissa officinalis L., fam. Lamiaceae (Labiatae) | 2.0% |
| Lemon balm 1 | 8014-71-9 | Melissa officinalis L., fam. Lamiaceae (Labiatae) | 3.6% |
| Lemon balm 2 | 8014-71-9 | Melissa officinalis L., fam. Lamiaceae (Labiatae) | 0.6% |
| Lemon balm 3 | 8014-71-9 | Melissa officinalis L., fam. Lamiaceae (Labiatae) | 0.55% |
| Basil 1 | 8015-73-4 | Ocimum basilicum L., fam. Lamiaceae (Labiatae) | 0.01% |
| Basil (Nigeria) 1 | 8015-73-4 | Ocimum basilicum L., fam. Lamiaceae (Labiatae) | 0.54% |
| Basil (Nigeria) 2 | 8015-73-4 | Ocimum basilicum L., fam. Lamiaceae (Labiatae) | 0.24% |
| Basil (Comoro Islands) 2 | 8015-73-4 | Ocimum basilicum L., fam. Lamiaceae (Labiatae) | 0.01% |
| Bergamot (Italy) 1 | 8007-75-8 | Citrus bergamia Risso et Poiteau, fam. Rutaceae | 0.01% |
| Blackcurrant bud, absolute | 68606-81-5 | Ribes nigrum L., fam. Grossulariaceae | 0.25% |
| Blackcurrant bud 1 | 68606-81-5 | Ribes nigrum L., fam. Grossulariaceae | 1.0% |
| Calamintha nepeta (Greece) 1 | Calamintha nepeta (L.) Savi (Melissa nepeta L.), fam. Lamiaceae (Labiatae) | 0.05% | |
| Carrot seed (France) 1 | 8015-88-1 | Daucus carota L., fam. Apiaceae (Umbelliferae) | 3.04% |
| Cedarleaf 3 | 8000-27-9 | Thuja occidentalis L., fam. Taxodiaceae | 0.3% |
| Cedarleaf 2 | 8000-27-9 | Thuja occidentalis L., fam. Taxodiaceae | 0.4% |
| Celery seed (France) | 8015-90-5 | Apium graveolens L., fam. Apiaceae (Umbelliferae) | 0.35% |
| Celery seed (China) 1 | 8015-90-5 | Apium graveolens L., fam. Apiaceae (Umbelliferae) | 0.55% |
| Clove bud 2 | 8000-34-8 | Eugenia caryophyllus (Spreng.) Bullock & Harrison (E.caryophyllata Thunb.) | 0.3% |
| Clove bud (Malagasy) | 8000-34-8 | Eugenia caryophyllus (Spreng.) Bullock & Harrison (E.caryophyllata Thunb.) | 0.2% |
| Coleonema pulchellum | Coleonema pulchellum Williams (C. pulchrum Hook.), fam. Rutaceae | 0.02% | |
| Cymbopogon jwarancusa (Himalaya) | Cymbopogon jwarancusa (Jones) Schult., fam. Poaceae (Gramineae) | 0.24% | |
| Cymbopogon microstachys | Cymbopogon microstachys (Hook. f.) S. Soenarko, fam. Poaceae (Gramineae) | 0.5% | |
| Dragonhead | Dracocephalum moldavica L., fam. Lamiaceae (Labiatae) | 0.3% | |
| Fern, sweet 1 | Comptonia peregrina (L.) Coulter, fam. Pteridophytae | 3.6% | |
| Fern, sweet 2 | Comptonia peregrina (L.) Coulter, fam. Pteridophytae | 1.97% | |
| Germander, common (Italy) | Teucrium chamaedrys L., fam. Lamiaceae (Labiatae) | 6.2% | |
| Spike lavender (Spain) 3 | 8016-78-2 | Lavandula latifolia Medikus (L. spica D.C.), fam. Lamiaceae (Labiatae) | 2.4% |
| Helichrysum italicum (Yugoslavia) | 8023-95-8 | Helichrysum italicum (Roth) G. Don (H. angustifolium D.C.), fam.Asteraceae | 2.6% |
| Hemizygia welwitschii | Hemizygia welwitschii (Rolfe) M.Ashby (Orthosiphon welwitschii) | 1.9% | |
| Hyptis pectinata | Hyptis pectinata (L.) Poit., fam. Lamiaceae (Labiatae) | 0.05% | |
| Hyssop (USA) | 8006-83-5 | Hyssopus officinalis L., fam. Lamiaceae (Labiatae) | 0.23% |
| Juniper berry 1 | 8012-91-7 | Juniperus communis L., fam. Cupressaceae | 0.15% |
| Juniper berry 5 | 8012-91-7 | Juniperus communis L., fam. Cupressaceae | 1.1% |
| Juniper branch | 8012-91-7 | Juniperus communis L., fam. Cupressaceae | 0.2% |
| Juniperus foetidissima leaf | Juniperus foetidissima Willd., fam. Cupressaceae | 0.05% | |
| Dracocephalum kotschyi | Dracocephalum kotschyi Boiss., fam. Lamiaceae (Labiatae) | 0.1% | |
| Larix conifer bark | Larix decidua Mill., fam. Pinaceae | 1.95% | |
| Larix conifer wood | Larix decidua Mill., fam. Pinaceae | 0.89% | |
| Laurel leaf (Spain) 2 | 8006-78-8 | Laurus nobilis L., fam. Lauraceae | 0.05% |
| Laurel leaf (Spain) 3 | 8006-78-8 | Laurus nobilis L., fam. Lauraceae | 0.05% |
| Lavender (Spain) (var. pyrenaica) | Lavandula angustifolia Mill. ssp. pyrenaica, fam. Lamiaceae (Labiatae) | 3.3% | |
| Lavandula dentata (Chemotype A) | Lavandula dentata L. (Chemotype A), fam. Lamiaceae (Labiatae) | 0.6% | |
| Dacryodes buettneri fruit | Dacryodes buettneri H.J. Lam, fam. Burseraceae | 0.4% | |
| Dacryodes igaganga fruit | Dacryodes igaganga Aubrev. et Pellegr., fam. Burseraceae | 2.7% | |
| Calamintha nepeta (Turkey) 2 | Calamintha nepeta (L.) Savi ssp. glandulosa (Req.) P.W.Ball, fam.Lamiaceae | 0.16% | |
| Thymus sibthorpii (Turkey) | Thymus sibthorpii Bentham, fam. Lamiaceae (Labiatae) | 0.22% | |
| Elsholtzia eriostachya | Elsholtzia eriostachya var. pusilla Benth., fam. Lamiaceae (Labiatae) | 0.08% | |
| Eucalyptus dealbata (Morocco) | Eucalyptus dealbata A. Cunn. ex Schau, fam. Myrtaceae | 16.4% | |
| Tithonia diversifolia | Tithonia diversifolia (Hemsl.) A. Gray, fam. Asteraceae (Compositae) | 1.3% | |
| Kaempferia galanga rhizome (Malaysia) | Kaempferia galanga L. (Alpinia sessilis Kon.), fam. Zingiberaceae | 0.05% | |
| Thymus villosus (Portugal) | Thymus villosus L., ssp. villosus, fam. Lamiaceae (Labiatae) | 0.95% | |
| Thymus camphoratus (Portugal) | Thymus camphoratus Hoffmanns et Link, fam. Lamiaceae (Labiatae) | 3.2% | |
| Thymus capitatus (Portugal) | Thymus capitatus (L.) Hoffmanns et Link, fam. Lamiaceae (Labiatae) | 0.6% | |
| Cleonia lusitanica (Spain) | Cleonia lusitanica (L.) L., (Prunella lusitanica L.), fam. Lamiaceae | 1.0% | |
| Eucalyptus camaldulensis (Morocco) 3 | Eucalyptus camaldulensis Dehn., fam. Myrtaceae | 0.3% | |
| Eucalyptus camaldulensis (Morocco) 1 | Eucalyptus camaldulensis Dehn., fam. Myrtaceae | 0.92% | |
| Curcuma aeruginosa (Indonesia) | Curcuma aeruginosa Roxb., fam. Zingiberaceae | 2.5% | |
| Curcuma heyneana (Indonesia) | Curcuma heyneana Val., fam. Zingiberaceae | 3.7% | |
| Scandix australis | Scandix australis L., fam. Apiaceae (Umbelliferae) | 0.05% | |
| Eupatorium stoechadosmum | Eupatorium stoechadosmum Hance, fam. Asteraceae (Compositae) | 0.4% | |
| Savory, winter (Italy) 3 | 90106-57-3 | Satureja montana L., fam. Lamiaceae (Labiatae) | 1.03% |
| Blackcurrant bud 3 | 68606-81-5 | Ribes nigrum L., fam. Grossulariaceae | 0.75% |
| Pepper, black 7 | 8006-82-4 | Piper nigrum L., fam. Piperaceae | 0.4% |
| Pepper, black 5 | 8006-82-4 | Piper nigrum L., fam. Piperaceae | 5.7% |
| Pepper, black 3 | 8006-82-4 | Piper nigrum L., fam. Piperaceae | 0.01% |
| Pepper, black 2 | 8006-82-4 | Piper nigrum L., fam. Piperaceae | 0.17% |
| Cinnamomum albiflorum (Kampuchea) | Cinnamomum albiflorum Nees, fam. Lauraceae | 0.2% | |
| Grape flower | 84929-27-1 | Vitis vinifera L., ssp. Gruener Veltliner, fam. Vitaceae | 0.2% |
| Lavandin (Italy) 1 (Grosso) | 8022-15-9 | Lavandula x hybrida Rev. (L. x intermedia Emeric ex Loiseleur), Lamiaceae | 0.01% |
| Niaouli (Madagascar) 3 | Melaleuca quinquenervia (Cav.) S.T. Blake, fam. Myrtaceae | 0.82% | |
| Cinnamon leaf (Sri Lanka) | 8007-80-5 | Cinnamomum zeylanicum Blume (C. verum L. Presl), fam. Lauraceae | 0.64% |
| Clove bud 1 | 8000-34-8 | Eugenia caryophyllus (Spreng.) Bullock & Harrison (E.caryophyllata Thunb.) | 1.8% |
| Eucalyptus globulus (Burundi) | 8016-26-0 | Eucalyptus globulus Labill., fam. Myrtaceae | 0.3% |
| Eucalyptus citriodora (Burundi) | 8000-48-4 | Eucalyptus citriodora Hook. f., fam. Myrtaceae | 0.1% |
| Eucalyptus maidenii (Burundi) | Eucalyptus maidenii F. Muell., fam. Myrtaceae | 0.1% | |
| Juniper berry 2 | 8012-91-7 | Juniperus communis L., fam. Cupressaceae | 0.1% |
| Origanum solymicum (Turkey) | Origanum solymicum P.H. Davis, fam. Lamiaceae (Labiatae) | 1.97% | |
| Cornmint (Mentha arvensis) (India) 3 Shivalik | 68917-18-0 | Mentha arvensis (L.) var. piperascens Malinv., fam. Lamiaceae (Labiatae) | 0.29% |
| Parsley seed 2 | 8000-68-8 | Petroselinum crispum (Miller) A.W. Hill (P. sativum Hoffm.), fam. Apiaceae | 0.03% |
| Sage, dalmatian 1 | 8022-56-8 | Salvia officinalis L., fam. Lamiaceae (Labiatae) | 0.13% |
| Lemon verbena (Morocco) 1 | Aloysia triphylla (L'Herit.) Britton (Lippia citriodora (Lam.) O. Kuntze) | 5.5% | |
| Artemisia roxburghiana (Himalaya) | Artemisia roxburghiana Wall. ex Bies, var. hypolenca, fam. Asteraceae | 0.1% | |
| Alpinia chinensis root (Vietnam) | Alpinia chinensis Rosc., fam. Zingiberaceae | 13.2% | |
| Annual wormwood (France) | 84775-74-6 | Artemisia annua L., fam. Asteraceae (Compositae) | 0.36% |
| Rosemary (Morocco) 1 | 8000-25-7 | Rosmarinus officinalis L., fam. Lamiaceae (Labiatae) | 0.05% |
| Rosemary (France) 1 | 8000-25-7 | Rosmarinus officinalis L., fam. Lamiaceae (Labiatae) | 0.03% |
| Juniper leaf 2 | 8012-91-7 | Juniperus communis L., fam. Cupressaceae | 0.77% |
| Guava leaf 2 | 91770-12-6 | Psidium guajava L., fam. Myrtaceae | 5.16% |
| Peppermint (Italy) 10a | 8006-90-4 | Mentha piperita L., fam. Lamiaceae (Labiatae) | 0.1% |
| Peppermint (Italy) 10b | 8006-90-4 | Mentha piperita L., fam. Lamiaceae (Labiatae) | 0.2% |
| Rosemary (Spain) 5 | 8000-25-7 | Rosmarinus officinalis L., fam. Lamiaceae (Labiatae) | 0.3% |
| Rosmarinus eriocalyx (Spain) | Rosmarinus eriocalyx Jordan & Fourr., fam. Lamiaceae (Labiatae) | 0.35% | |
| Hesperozygis rhododon (Brazil) | Hesperozygis rhododon Epling, fam. Lamiaceae (Labiatae) | 0.2% | |
| Sage, dalmatian (New Zealand) 1a | 8022-56-8 | Salvia officinalis L., fam. Lamiaceae (Labiatae) | 0.97% |
| Sage, dalmatian (New Zealand) 1b | 8022-56-8 | Salvia officinalis L., fam. Lamiaceae (Labiatae) | 0.26% |
| Thymus funkii | Thymus funkii Cosson, fam. Lamiaceae (Labiatae) | 1.2% | |
| Cinnamon leaf (India) 1a | 8007-80-5 | Cinnamomum zeylanicum Blume (C. verum L. Presl), fam. Lauraceae | 0.11% |
| Cinnamon leaf (India) 1b | 8007-80-5 | Cinnamomum zeylanicum Blume (C. verum L. Presl), fam. Lauraceae | 0.1% |
| Leptospermum javanicum (Malaysia) | Leptospermum javanicum Blume, fam. Myrtaceae | 1.6% | |
| Indian curry leaf tree (flower) | Murraya koenigii Spreng., fam. Rutaceae | 0.7% | |
| Pinus sibirica (Mongolia) 1b | Pinus sibirica (Rupr.) Mayr (Siberian pine), fam. Pinaceae | 0.1% | |
| Lemon verbena (Turkey) | Aloysia triphylla (L'Herit.) Britton, fam. Verbenaceae | 4.0% | |
| Sage, dalmatian (Italy) 6 | 8022-56-8 | Salvia officinalis L., fam. Lamiaceae (Labiatae) | 0.34% |
| Aegle marmelos leaf (India) 1 | Aegle marmelos (L.) Correa, fam. Rutaceae | 0.6% | |
| Verbena officinalis leaf (Morocco) | Verbena officinalis L., fam. Verbenaceae | 7.3% | |
| Cornmint (Mentha arvensis) (Cuba) | 68917-18-0 | Mentha arvensis (L.) var. piperascens Malinv., fam. Lamiaceae (Labiatae) | 0.3% |
| Curcuma aromatica (India) 1 petiole | Curcuma aromatica Salisb., fam. Zingiberaceae | 8.7% | |
| Tanacetum parthenium (The Netherlands) | Tanacetum parthenium (L.) Schultz-Bip. (Feverfew), Asteraceae (Compositae) | 2.06% | |
| Ylang Ylang leaf (Cameroon) | 8006-81-3 | Cananga odorata (Lamk.) Hook. f. et Thomson, fam. Annonaceae | 0.6% |
| Inula viscosa (Turkey) | Inula viscosa (L.) Aiton (Dittrichia viscosa (L.) Greuter), fam.Asteraceae | 1.1% | |
| Marjoram, sweet 2 | 8015-01-8 | Majorana hortensis Moench, Origanum majorana L., fam. Lamiaceae (Labiatae) | 0.7% |
| Clary sage (Spain) | 8016-63-5 | Salvia sclarea L., fam. Lamiaceae (Labiatae) | 0.99% |
| Lavender (Lithuania) | 8000-28-0 | Lavandula angustifolia Mill., fam. Lamiaceae (Labiatae) | 3.74% |
| Bois-de-Rose (Brazil) 1c | 8015-77-8 | Aniba rosaeodora var. amazonica Ducke, fam. Lauraceae | 0.2% |
| Bois-de-Rose (Brazil) 1b | 8015-77-8 | Abina rosaeodora var. amazonica Ducke, fam. Laureaceae | 0.13% |
| Bois-de-Rose (Brazil) 1a | 8015-77-8 | Aniba rosaeodora var. amazonica Ducke, fam. Lauraceae | 0.88% |
| Sage, spanish (Spain) 13 | 8016-65-7 | Salvia lavandulaefolia Vahl., fam. Lamiaceae (Labiatae) | 0.15% |
| Rosa rugosa (China) 1 | Rosa rugosa Thunb. (hybrids), fam. Rosaceae | 0.5% | |
| Yarrow (Poland) | 84082-83-7 | Achillea millefolium L., fam. Asteraceae (Compositae) | 7.8% |
| Yarrow (Greece) | 84082-83-7 | Achillea millefolium L., fam. Asteraceae (Compositae) | 0.2% |
| Ocimum gratissimum (Rwanda) | Ocimum gratissimum L., fam. Lamiaceae (Labiatae) | 0.8% | |
| Ocimum gratissimum (Aruba) | Ocimum gratissimum L., fam. Lamiaceae (Labiatae) | 5.5% | |
| Mentha citrata (Bergamot mint) (Argentina) 2a | 68917-15-7 | Mentha citrata Ehrh., fam. Lamiaceae (Labiatae) | 0.35% |
| Mentha citrata (Bergamot mint) (Argentina) 2b | 68917-15-7 | Mentha citrata Ehrh., fam. Lamiaceae (Labiatae) | 0.25% |
| Sugandha kokila fruit | Cinnamomum glaucescens (Nees) Drury (C. cecidodaphne Meissn.)fam.Lauraceae | 0.7% | |
| Sugandha kokila pericarp | Cinnamomum glaucescens (Nees) Drury (C. cecidodaphne Meissn.)fam.Lauraceae | 0.3% | |
| Rosemary (France) 3 | 8000-25-7 | Rosmarinus officinalis L., fam. Lamiaceae (Labiatae) | 0.2% |
| Cinnamon leaf (India) 3a | 8007-80-5 | Cinnamomum zeylanicum Blume (C. verum L. Presl), fam. Lauraceae | 0.36% |
| Cinnamon leaf (India) 3b | 8007-80-5 | Cinnamomum zeylanicum Blume (C. verum L. Presl), fam. Lauraceae | 0.26% |
| Cinnamon leaf (India) 3c | 8007-80-5 | Cinnamomum zeylanicum Blume (C. verum L. Presl), fam. Lauraceae | 0.02% |
| Sage, spanish (Spain) 10 | 8016-65-7 | Salvia lavandulaefolia Vahl, fam. Lamiaceae (Labiatae) | 0.3% |
| Thyme red (Spain) 5a | 8007-46-3 | Thymus zygis L. ssp. sylvestris (Hoffm. et Link) Morales, fam. Lamiaceae | 0.63% |
| Thyme red (Spain) 5b | 8007-46-3 | Thymus vulgaris L., ssp. gracilis, fam. Lamiaceae (Labiatae) | 0.07% |
| Cinnamon fruit (India) 1 | 8007-80-5 | Cinnamomum zeylanicum Blume (C. verum L. Presl), fam. Lauraceae | 1.0% |
| Cinnamon bark 6 | 8007-80-5 | Cinnamomum zeylanicum Blume (C. verum L. Presl), fam. Lauraceae | 0.1% |
| Wormwood (Mugwort) (Cuba) | 8008-93-3 | Artemisia absinthium L., fam. Asteraceae (Compositae) | 0.67% |
| Wormwood (Mugwort) 2 | 8008-93-3 | Artemisia absinthium L., fam. Asteraceae (Compositae) | 3.9% |
| Sage, dalmatian (Cuba) | 8022-56-8 | Salvia officinalis L., fam. Lamiaceae (Labiatae) | 0.96% |
| Sage, dalmatian (Italy) 7 | 8022-56-8 | Salvia officinalis L., fam. Lamiaceae (Labiatae) | 0.23% |
| Sage, dalmatian 7 | 8022-56-8 | Salvia officinalis L., fam. Lamiaceae (Labiatae) | 0.5% |
| Pennyroyal (Cuba) | 8013-99-8 | Mentha pulegium L., fam. Lamiaceae (Labiatae) | 1.04% |
| Thymus serpyllum (France) | Thymus serpyllum L., fam. Lamiaceae (Labiatae) | 2.5% | |
| Eucalyptus citriodora (Rwanda) | 8008-48-4 | Eucalyptus citriodora Hook. f., fam. Myrtaceae | 0.15% |
| Gingergrass (India) 2 | Cymbopogon martini Stapf., var. sofia, fam. Poaceae (Gramineae) | 1.5% | |
| Gingergrass (India) 4 | Cymbopogon martini Stapf., var. sofia, fam. Poaceae (Gramineae) | 1.65% | |
| Gingergrass (India) 6 | Cymbopogon martini Stapf., var. sofia, fam. Poaceae (Gramineae) | 0.1% | |
| Origanum majorana var. tenuifolium | Origanum majorana L. var. tenuifolium, fam. Lamiaceae (Labiatae) | 0.5% | |
| Oregano, turkish (Greece) | Origanum onites L., fam. Lamiaceae (Labiatae) | 0.4% | |
| Origanum dubium (Cyprus) | Origanum dubium Boiss., fam. Lamiaceae (Labiatae) | 0.2% | |
| Sage, dalmatian (Egypt) 2a | 8022-56-8 | Salvia officinalis L., fam. Lamiaceae (Labiatae) | 0.6% |
| Hyptis crenata (Brazil) | Hyptis crenata Pohl ex Benth, fam. Lamiaceae (Labiatae) | 2.0% | |
| Chamomile, german (India) 2a whole flower | 8002-66-2 | Chamomilla recutita (L.) Rausch.(Matricaria chamomilla L.), fam.Asteraceae | 0.2% |
| Chamomile, german (India) 2b leaf | 8002-66-2 | Chamomilla recutita (L.) Rausch.(Matricaria chamomilla L.), fam.Asteraceae | 0.3% |
| Chamomile, german (India) 2d root | 8002-66-2 | Chamomilla recutita (L.) Rausch.(Matricaria chamomilla L.), fam.Asteraceae | 0.1% |
| Nepeta persica (Iran) | Nepeta persica Boiss, fam. Lamiaceae (Labiatae) | 0.9% | |
| Salvia aramiensis (Turkey) | Salvia aramiensis Rech. fil., fam. Lamiaceae (Labiatae) | 1.3% | |
| Lemon (France-Corsica) 1b Fino | 84929-31-7 | Citrus limon (L.) Burm. f., cultivar Fino, fam. Rutaceae | 0.2% |
| Lemon (France-Corsica) 1d Berna | 84929-31-7 | Citrus limon (L.) Burm. f., cultivar Berna, fam. Rutaceae | 0.1% |
| Lemon (France-Corsica) 1f Santa Teresa | 84929-31-7 | Citrus limon (L.) Burm. f., cultivar Santa Teresa, fam. Rutaceae | 0.1% |
| Lemon (France-Corsica) 1e Corpaci | 84929-31-7 | Citrus limon (L.) Burm. f., cultivar Corpaci, fam. Rutaceae | 0.2% |
| Kanuka (New Zealand) 2 | Kunzea ericoides (A. Rich.) J. Thompson, fam. Myrtaceae | 0.16% | |
| Lemon (France-Corsica) 1g Lapithou | 84929-31-7 | Citrus limon (L.) Burm. f., cultivar Lapithou, fam. Rutaceae | 0.3% |
| Lemon (France-Corsica) 1h Menton | 84929-31-7 | Citrus limon (L.) Burm. f., cultivar Menton, fam. Rutaceae | 0.2% |
| Lemon (France-Corsica) 1i Panache | 84929-31-7 | Citrus limon (L.) Burm. f., cultivar Panache, fam. Rutaceae | 0.05% |
| Tejpat leaf | Cinnamomum tamala (Ham.) Nees et Eberm., fam. Lauraceae | 10.3% | |
| Styrax (Levant) | 8024-01-9 | Liquidamber orientalis Mill. var. orinetalis, fam. Hamamelidaceae | 0.6% |
| Turmeric (India) 5a rhizome | 8024-37-1 | Curcuma longa L., cv. Roma (C. domestica Val.), fam. Zingiberaceae | 3.4% |
| Turmeric (India) 5b leaf | 8024-37-1 | Curcuma longa L., cv. Roma (C. domestica Val.), fam. Zingiberaceae | 0.6% |
| Juniperus cedrus (Portugal-Madeira) | Juniperus cedrus Webb & Berth. (J. oxycedrus L), fam. Cupressaceae | 3.0% | |
| Sage, dalmatian (Serbia-Montenegro) 1a leaf | Salvia officinalis L., fam. Lamiaceae (Labiatae) | 0.5% | |
| Sage, dalmatian (Serbia-Montenegro) 1b flower | 8016-20-4 | Salvia officinalis L., fam. Lamiaceae (Labiatae) | 0.5% |
| Artemisia aucheri (Iran) 1 | Artemisia aucheri Boiss., fam. Asteraceae (Compositae) | 1.1% | |
| Artemisia sieberi (Iran) | Artemisia sieberi (Iran) | 0.05% | |
| Lantana camara (India) 1a leaf | 90046-17-6 | Lantana camara L., fam. Verbenaceae | 2.1% |
| Lantana camara (India) 1b flower | 90046-17-6 | Lantana camara L., fam. Verbenaceae | 2.5% |
| Lantana camara (Iran) | 90046-17-6 | Lantana camara L., fam. Verbenaceae | 1.1% |
| Nepeta fissa (Iran) | Nepeta fissa C.A.Mey (N.microphylla Stapf, N.trautvetteri Boiss),Lamiaceae | 12.3% | |
| Helichrysum litoreum (Italy) 1a flower | Helichrysum litoreum Guss., fam. Asteraceae (Compositae) | 2.3% | |
| Helichrysum litoreum (Italy) 1b stem | Helichrysum litoreum Guss., fam. Asteraceae (Compositae) | 0.2% | |
| Santolina insularis (Italy) 1a CO2-extract | Santolina insularis L., fam. Asteraceae (Compositae) | 2.1% | |
| Santolina insularis (Italy) 1b hydrodistilled | Santolina insularis L., fam. Asteraceae (Compositae) | 1.2% | |
| Savory, summer (Iran) 1 | 8016-68-0 | Satureja hortensis L., fam. Lamiaceae (Labiatae) | 0.4% |
| Licaria salicifolia | Licaria salicifolia (Sw.) Kosterm., fam. Lauraceae | 1.0% | |
| Helichrysum hypnoides (Madagascar) 2 | Helichrysum hypnoides (DC.) R.Vig. et Humbert, fam.Asteraceae (Compositae) | 0.3% | |
| Calamintha vardarensis | Calamintha vardarensis (Greuter et Burdet) Silic, fam.Lamiaceae (Labiatae) | 0.1% | |
| Rosemary (Portugal) 2 | 8000-25-7 | Rosmarinus officinalis L., fam. Lamiaceae (Labiatae) | 1.1% |
| Salvia pomifera | Salvia pomifera L. ssp. calycina (Sm.) Hayek, fam. Lamiaceae (Labiatae) | 0.6% | |
| Aframomum citratum (Cameroon) 2a leaf | Aframomum citratum (Pereira) K. Schum., fam. Zingiberaceae | 1.4% | |
| Plectranthus barbatus (Brazil) 2a leaf | Plectranthus barbatus Andr. (Coleus barbatus), fam. Lamiaceae (Labiatae) | 0.9% | |
| Plectranthus barbatus (Brazil) 2b stem | Plectranthus barbatus Andr. (Coleus barbatus), fam. Lamiaceae (Labiatae) | 6.2% | |
| Spike lavender (Iran) 1a fresh | 8016-78-2 | Lavandula latifolia Medikus (L. spica D.C.), fam. Lamiaceae (Labiatae) | 0.1% |
| Spike lavender (Iran) 1b dry | 8016-78-2 | Lavandula latifolia Medikus (L. spica D.C.), fam. Lamiaceae (Labiatae) | 0.1% |
| Teucrium botrys (Serbia/Montenegro) | Teucrium botrys L., fam. Lamiaceae (Labiatae) | 4.4% | |
| Germander, common (Serbia/Montenegro) | Teucrium chamaedrys L., fam. Lamiaceae (Labiatae) | 5.5% | |
| Teucrium flavum (Serbia/Montenegro) | Teucrium flavum L., fam. Lamiaceae (Labiatae) | 0.8% | |
| Teucrium montanum (Serbia/Montenegro) | Teucrium montanum L., fam. Lamiaceae (Labiatae) | 2.6% | |
| Teucrium polium (Serbia/Montenegro) | Teucrium polium L., fam. Lamiaceae (Labiatae) | 0.8% | |
| Psidium myrsinoides (Brazil) | Psidium myrsinoides O. Berg, fam. Myrtaceae | 19.7% | |
| Piper mikanianum (Brazil) | Piper mikanianum (Kunth) Steudel, fasm. Piperaceae | 0.1% | |
| Croton jimenezii (Costa Rica) | Croton jimenezii Standl. et Valerio, fam. Euphorbiaceae | 0.6% | |
| Conyza bonariensis (Brazil) | Conyza bonariensis (L.) Cronquist, fam. Asteraceae (Compositae) | 2.0% | |
| Desmos goezeanus leaf (Australia) | Desmos goezeanus (F. Muell.) L.W. Jessup, fam. Annonaceae | 0.6% | |
| Desmos wardianus leaf (Australia) | Desmos wardianus (F.M. Bailey) L.W. Jessup, fam. Annonaceae | 2.9% | |
| Myrceugenia alpigena (Brazil) | Myrceugenia alpigena (DC.) Landrum, fam. Myrtaceae | 1.5% | |
| Myrceugenia miersiana (Brazil) | Myrceugenia miersiana (Gardner) D. Legrand et Kausel, fam. Myrtaceae | 8.8% | |
| Myrceugenia myrcioides (Brazil) | Myrceugenia myrcioides (Cambess.) O. Berg, fam. Myrtaceae | 5.6% | |
| Eugenia moraviana (Brazil) | Eugenia moraviana O. Berg, fam. Myrtaceae | 0.9% | |
| Eugenia klappenbachiana (Brazil) | Eugenia klappenbachiana Mattos et D. Legrand, fam. Myrtaceae | 3.3% | |
| Eugenia repanda (Brazil) | Eugenia repanda O. Berg, fam. Myrtaceae | 0.7% | |
| Elionurus elegans aerial parts | Elionurus elegans Kunth (African Pasture Grass), fam. Poaceae (Gramineae) | 4.9% | |
| Elionurus elegans roots | Elionurus elegans Kunth (African Pasture Grass), fam. Poaceae (Gramineae) | 4.6% | |
| Teucrium stocksianum (United Arab Emirates) | Teucrium stocksianum Boiss., fam. Lamiaceae (Labiatae) | 1.35% | |
| Satureja boissieri (Iran) | Satureja boissieri Hausskn. ex Boiss., fam. Lamiaceae (Labiatae) | 0.5% | |
| Philodendron imbe root (Brazil) | Plidodendron imbe Schott, fam. Araceae | 10.3% | |
| Pepper, black (India) 7b cv. Ottaplackal | 8006-82-4 | Piper nigrum L., cultivar Ottaplackal, fam. Piperaceae | 1.5% |
| Pepper, black (India) 7c cv. Kuthiravally | Piper nigrum L., cultivar Kuthiravally, fam. Piperaceae | 1.15% | |
| Pepper, black (India) 7d cv. Cheriakaniakadan | 8006-82-4 | Piper nigrum L., cultivar Cheriakaniakadan, fam. Piperceae | 0.35% |
| Eugenia catharinensis leaf (Brazil) | Eugenia catharinensis D. Legrand, fam. Myrtaceae | 1.9% | |
| Neolitsea dealbata leaf (Australia) | Neolitsea dealbata (R. Br.) Merr., fam. Lauraceae | 0.4% | |
| Chaerophyllum macrospermum (Iran) | Chaerophyllum macrospermum (Spreng.) Fisch. et C.A. Mey, fam. Apiaceae | 0.2% | |
| Pichana (Broom) (Argentina) | Baccharis spartioides (Hook. et Arn.) Remy, fam. Asteraceae (Compositae) | 2.0% | |
| Aniba riparia (Brazil) 1b branch | Aniba riparia (Nees) Mez, fam. Lauraceae | 0.05% | |
| Aniba riparia (Brazil) 1c bark wood | Aniba riparia (Nees) Mez, fam. Lauraceae | 1.5% | |
| Aniba riparia (Brazil) 1d trunk wood | Aniba riparia (Nees) Mez, fam. Lauraceae | 1.5% | |
| Salvia aucheri (Turkey) 1a var. aucheri | Salvia aucheri Benth. var. aucheri, fam. Lamiaceae (Labiatae) | 2.4% | |
| Salvia aucheri (Turkey) 1b var. canenscens | Salvia aucheri Benth. var. canenscens, fam. Lamiaceae (Labiatae) | 0.7% | |
| Thymus x oblongifolius (Lithuania) | Thymus x oblongifolius Opiz, fam. Lamiaceae (Labiatae) | 7.5% | |
| Artemisia variabilis (Italy) | Artemisia variabilis Ten., fam. Asteraceae (Compositae) | 0.05% | |
| Artemisia campestris, ssp. glutinosa (Italy) | Artemisia campestris L. ssp. glutinosa (Ten.) Briq. et Cavill., Asteraceae | 0.1% | |
| Cinnamomum virens leaf (Australia) | Cinnamomum virens R.T. Baker, fam. Lauraceae | 0.6% | |
| Cinnamomum laubatii leaf (Australia) | Cinnamomum laubatii F. Muel., fam. Lauraceae | 0.4% | |
| Cinnamomum propinquum leaf (Australia) | Cinnamomum propinquum F.M. Bailey, fam. Lauraceae | 2.9% | |
| Nepeta argolica (Greece) 2 | Nepeta argolica Bory et Chaub. ssp. argolica, fam. Lamiaceae (Labiatae) | 0.2% | |
| Hedyosmum bonplandianum (Costa Rica) | Hedyosmum bonplandianum Kunth, fam. Chloranthaceae | 0.3% | |
| Hedyosmum costaricensis (Costa Rica) | Hedyosmum costaricensis C.E. Wood, fam. Chloranthaceae | 0.4% | |
| Lemon leaf (petitgrain) (Italy) 6 hybrid 'Milam' | Citrus jambhiri Lush x Citrus sinensis L., fam. Rutaceae | 0.8% | |
| Espeletia weddellii leaf | Espeletia weddellii Sch. Bip. ex Wedd., fam. Asteraceae (Compositae) | 0.6% | |
| Pinus canariensis (Spain-Tenerife) | Pinus canariensis Sweet ex Sprengel, fam. Pinaceae | 0.1% | |
| Homalomena aromatica rhizome (India) | Homalomena aromatica Schott. (Calla aromatica), fam. Araceae | 0.2% | |
| Satureja boliviana (Argentina) | Satureja boliviana Briq. (Micromeria boliviana Benth.), fam. Lamiaceae | 1.8% | |
| Satureja parvifolia (Argentina) | Satureja parvifolia (Phil.) Epl., fam. Lamiaceae (Labiatae) | 0.2% | |
| Argyranthemum adauctum ssp. adauctum | Argyranthemum adauctum ssp.adauctum Humphries, fam.Asteraceae (Compositae) | 12.4% |