Germacrene D
-
Identifiers
CAS number
23986-74-5Molecular formula
C15H24SMILES
C/C/1=C\CCC(=C)/C=C/[C@@H](CC1)C(C)C
Safety labels
Irritant
HealthRetention indicies (RI)
- DB5: 1484.71
- Carbowax: 1703.0
-
Odor profile
Herbal 70.24% Woody 67.78% Citrus 67.58% Spicy 66.36% Terpenic 55.66% Fresh 48.35% Mint 45.53% Lemon 44.94% Pine 39.01% Camphoreous 37.21% Scent© AI
-
Properties
XLogP3-AA
4.7pKa est.
8.64 (weak base)Molecular weight
204.35 g/molVapor pressure est.
- hPa @ 20°C
- hPa @ 25°C
Evaporation rate
SlowBoiling point est.
263°CFlash point est.
96.77 ˚C -
Synonyms
- (-)-Germacrene D
- Germacrene D
- 23986-74-5
- V2I9ATG34E
- (1E,6E,8S)-1-methyl-5-methylidene-8-propan-2-ylcyclodeca-1,6-diene
- (1E,6E,8S)-1-methyl-5-methylidene-8-(propan-2-yl)cyclodeca-1,6-diene
- (1E,5E)-germacra-1(10),4(15),5-triene
- (1E,6E,8S)-8-isopropyl-1-methyl-5-methylenecyclodeca-1,6-diene
- 1(10),4(14),5-Germacratriene
- (1E,6E,8S)-1-methyl-8-(1-methylethyl)-5-methylidenecyclodeca-1,6-diene
- 1-Methyl-5-methylene-8-(1-methylethyl)-1,6-cyclodecadiene
- Germacrene D (~90%) (Stabilized with Hydroquinone)
- UNII-V2I9ATG34E
- CHEBI:49044
- CHEBI:49045
- DTXSID101019972
- [S-(E,E)]-1-Methyl-5-methylene-8-(1-methylethyl)-1,6-cyclodecadiene; (-)-Germacra-1(10),4(15),5-triene; (-)-Germacrene D; Germacrene D; [s-(E,E)]-1-Methyl-5-methylene-8-(1-methylethyl)-1,6-cyclodecyldidiene;
- (-)-(S)-germacrene D
- (-)-(7S)-germacrene-D
- (1E,6E)-1-methyl-5-methylidene-8-(propan-2-yl)cyclodeca-1,6-diene
- DTXCID40909740
- GAIBLDCXCZKKJE-QRYCCKSOSA-N
- AKOS040733249
- MS-23113
- HY-125685
- CS-0093013
- Q27121450
-
Applications
Germacrene D (CAS 23986-74-5) is a sesquiterpene hydrocarbon widely occurring in plant essential oils; applications include its use as a fragrance ingredient imparting woody, herbal, warm-spicy facets to build base notes in perfumes, soaps, and personal care products; in flavors it commonly occurs as a natural component of spice oils, contributing background complexity while direct addition levels are typically limited; in research and analytics it serves as a GC/GC-MS reference standard for profiling, quantitation, and quality control of essential oils, as a chemotaxonomic marker, and as a quality indicator in botanicals; in agriculture and pest management it is investigated as a plant-derived insect repellent/insecticidal agent with potential for integrated pest management and stored-product protection; in pharmaceutical and chemical biology contexts it provides a scaffold for lead discovery and SAR and a model for studying terpenoid biosynthesis, with reported in vitro activities (antimicrobial, antioxidant, anti-inflammatory) that remain at preclinical research stages.
-
Solubility @25˚C
Solvent Solubility (g/L) ethanol 472.45 methanol 162.63 isopropanol 455.94 water 0.02 ethyl acetate 842.66 n-propanol 470.84 acetone 473.28 n-butanol 607.61 acetonitrile 231.94 DMF 198.51 toluene 1015.97 isobutanol 352.62 1,4-dioxane 1475.27 methyl acetate 393.73 THF 2473.44 2-butanone 632.89 n-pentanol 395.85 sec-butanol 479.08 n-hexane 489.59 ethylene glycol 12.58 NMP 203.53 cyclohexane 810.06 DMSO 260.45 n-butyl acetate 1513.99 n-octanol 322.01 chloroform 1222.36 n-propyl acetate 458.81 acetic acid 119.48 dichloromethane 1074.33 cyclohexanone 813.8 propylene glycol 50.09 isopropyl acetate 624.24 DMAc 243.98 2-ethoxyethanol 265.06 isopentanol 531.17 n-heptane 762.29 ethyl formate 223.94 1,2-dichloroethane 692.75 n-hexanol 1002.6 2-methoxyethanol 357.74 isobutyl acetate 365.98 tetrachloromethane 266.7 n-pentyl acetate 483.14 transcutol 1733.32 n-heptanol 321.51 ethylbenzene 423.83 MIBK 498.96 2-propoxyethanol 723.04 tert-butanol 660.12 MTBE 1259.96 2-butoxyethanol 329.39 propionic acid 128.74 o-xylene 389.94 formic acid 12.17 diethyl ether 1643.57 m-xylene 572.26 p-xylene 422.77 chlorobenzene 494.82 dimethyl carbonate 84.25 n-octane 165.16 formamide 24.25 cyclopentanone 678.84 2-pentanone 710.97 anisole 483.33 cyclopentyl methyl ether 1086.68 gamma-butyrolactone 452.42 1-methoxy-2-propanol 402.24 pyridine 987.76 3-pentanone 474.43 furfural 321.63 n-dodecane 84.92 diethylene glycol 178.49 diisopropyl ether 571.88 tert-amyl alcohol 526.94 acetylacetone 479.36 n-hexadecane 99.02 acetophenone 303.5 methyl propionate 359.5 isopentyl acetate 1171.11 trichloroethylene 889.37 n-nonanol 303.37 cyclohexanol 562.89 benzyl alcohol 217.34 2-ethylhexanol 846.32 isooctanol 273.57 dipropyl ether 1862.96 1,2-dichlorobenzene 340.23 ethyl lactate 99.25 propylene carbonate 320.57 n-methylformamide 71.11 2-pentanol 504.37 n-pentane 469.45 1-propoxy-2-propanol 826.02 1-methoxy-2-propyl acetate 823.55 2-(2-methoxypropoxy) propanol 388.68 mesitylene 342.39 ε-caprolactone 612.66 p-cymene 400.11 epichlorohydrin 812.65 1,1,1-trichloroethane 733.59 2-aminoethanol 56.33 morpholine-4-carbaldehyde 339.62 sulfolane 338.36 2,2,4-trimethylpentane 141.0 2-methyltetrahydrofuran 1927.06 n-hexyl acetate 650.13 isooctane 159.67 2-(2-butoxyethoxy)ethanol 530.13 sec-butyl acetate 397.69 tert-butyl acetate 657.6 decalin 222.77 glycerin 50.7 diglyme 957.21 acrylic acid 60.97 isopropyl myristate 313.27 n-butyric acid 439.38 acetyl acetate 335.59 di(2-ethylhexyl) phthalate 205.5 ethyl propionate 374.32 nitromethane 146.77 1,2-diethoxyethane 1626.09 benzonitrile 335.85 trioctyl phosphate 151.52 1-bromopropane 1086.73 gamma-valerolactone 626.33 n-decanol 230.59 triethyl phosphate 216.35 4-methyl-2-pentanol 318.9 propionitrile 324.55 vinylene carbonate 212.47 1,1,2-trichlorotrifluoroethane 215.23 DMS 247.81 cumene 253.18 2-octanol 232.08 2-hexanone 533.84 octyl acetate 348.16 limonene 708.15 1,2-dimethoxyethane 829.31 ethyl orthosilicate 260.37 tributyl phosphate 194.42 diacetone alcohol 414.57 N,N-dimethylaniline 303.45 acrylonitrile 198.55 aniline 470.35 1,3-propanediol 162.51 bromobenzene 663.2 dibromomethane 1001.16 1,1,2,2-tetrachloroethane 746.82 2-methyl-cyclohexyl acetate 511.69 tetrabutyl urea 244.92 diisobutyl methanol 455.26 2-phenylethanol 410.23 styrene 483.31 dioctyl adipate 343.29 dimethyl sulfate 80.89 ethyl butyrate 894.87 methyl lactate 80.23 butyl lactate 209.82 diethyl carbonate 399.05 propanediol butyl ether 226.36 triethyl orthoformate 560.47 p-tert-butyltoluene 417.4 methyl 4-tert-butylbenzoate 297.58 morpholine 1604.01 tert-butylamine 614.73 n-dodecanol 190.66 dimethoxymethane 443.75 ethylene carbonate 228.26 cyrene 193.84 2-ethoxyethyl acetate 556.07 2-ethylhexyl acetate 1042.43 1,2,4-trichlorobenzene 362.41 4-methylpyridine 912.87 dibutyl ether 969.2 2,6-dimethyl-4-heptanol 455.26 DEF 471.61 dimethyl isosorbide 697.22 tetrachloroethylene 446.85 eugenol 227.64 triacetin 332.96 span 80 377.69 1,4-butanediol 49.08 1,1-dichloroethane 762.75 2-methyl-1-pentanol 386.48 methyl formate 53.48 2-methyl-1-butanol 448.14 n-decane 165.07 butyronitrile 587.05 3,7-dimethyl-1-octanol 403.73 1-chlorooctane 393.09 1-chlorotetradecane 155.88 n-nonane 183.68 undecane 111.58 tert-butylcyclohexane 192.39 cyclooctane 333.87 cyclopentanol 364.84 tetrahydropyran 2565.61 tert-amyl methyl ether 795.02 2,5,8-trioxanonane 618.27 1-hexene 944.25 2-isopropoxyethanol 245.78 2,2,2-trifluoroethanol 20.02 methyl butyrate 438.08 Scent© AI
| Maximum acceptable concentrations in the finished product (%) | |||
|---|---|---|---|
|
Category 1
Products applied to the lips
|
No restriction |
Category 7A
Rinse-off products applied to the hair with some hand contact
|
No restriction |
|
Category 2
Products applied to the axillae
|
No restriction |
Category 7B
Leave-on products applied to the hair with some hand contact
|
No restriction |
|
Category 3
Products applied to the face/body using fingertips
|
No restriction |
Category 8
Products with significant anogenital exposure
|
No restriction |
|
Category 4
Products related to fine fragrance
|
No restriction |
Category 9
Products with body and hand exposure, primarily rinse off
|
No restriction |
|
Category 5A
Body lotion products applied to the body using the hands (palms), primarily leave on
|
No restriction |
Category 10A
Household care products with mostly hand contact
|
No restriction |
|
Category 5B
Face moisturizer products applied to the face using the hands (palms), primarily leave on
|
No restriction |
Category 10B
Household care products with mostly hand contact, including aerosol/spray products (with potential leave-on skin contact)
|
No restriction |
|
Category 5C
Hand cream products applied to the hands using the hands (palms), primarily leave on
|
No restriction |
Category 11A
Products with intended skin contact but minimal transfer of fragrance to skin from inert substrate without UV exposure
|
No restriction |
|
Category 5D
Baby Creams, baby Oils and baby talc
|
No restriction |
Category 11B
Products with intended skin contact but minimal transfer of fragrance to skin from inert substrate with potential UV exposure
|
No restriction |
|
Category 6
Products with oral and lip exposure
|
No restriction |
Category 12
Products not intended for direct skin contact, minimal or insignificant transfer to skin
|
No restriction |
| Name | CAS | Botanical | Proportion |
|---|---|---|---|
| Achillea wilhelmsii (Turkey) | Achillea wilhelmsii C. Koch (A. santolina Auct. Mult.), fam. Asteraceae | 0.2% | |
| Amomum pavieanum rhizome | Amomum pavieanum Pierre & Gagnep, fam. Zingiberaceae | 0.01% | |
| Anise seed 3 | 8007-70-3 | Pimpinella anisum L., fam. Apiaceae (Umbelliferae) | 0.12% |
| Anise herb | 8007-70-3 | Pimpinella anisum L., fam. Apiaceae (Umbelliferae) | 14.75% |
| Anise root | 8007-70-3 | Pimpinella anisum L., fam. Apiaceae (Umbelliferae) | 0.29% |
| Annual wormwood (USA, Oregon) | 84775-74-6 | Artemisia annua L., fam. Asteraceae (Compositae) | 0.7% |
| Artemisia vestita (India) | Artemisia vestita Wall. ex Dc., fam. Asteraceae (Compositae) | 1.56% | |
| Lemon balm 1 | 8014-71-9 | Melissa officinalis L., fam. Lamiaceae (Labiatae) | 0.05% |
| Lemon balm 2 | 8014-71-9 | Melissa officinalis L., fam. Lamiaceae (Labiatae) | 13.5% |
| Lemon balm 3 | 8014-71-9 | Melissa officinalis L., fam. Lamiaceae (Labiatae) | 2.37% |
| Basil 1 | 8015-73-4 | Ocimum basilicum L., fam. Lamiaceae (Labiatae) | 0.05% |
| Basil (Bulgaria) | 8015-73-4 | Ocimum basilicum L., fam. Lamiaceae (Labiatae) | 1.5% |
| Basil (Comoro Islands) 1 | 8015-73-4 | Ocimum basilicum L., fam. Lamiaceae (Labiatae) | 0.3% |
| Basil (Egypt) 1 (linalool-type) | 8015-73-4 | Ocimum basilicum L., fam. Lamiaceae (Labiatae) | 2.0% |
| Basil (Finland) | 8015-73-4 | Ocimum basilicum L., fam. Lamiaceae (Labiatae) | 1.1% |
| Basil (Fiji) 1 | 8015-73-4 | Ocimum basilicum L., fam. Lamiaceae (Labiatae) | 0.05% |
| Basil (Madagascar) 1 | 8015-73-4 | Ocimum basilicum L., fam. Lamiaceae (Labiatae) | 0.06% |
| Basil (Nigeria) 2 | 8015-73-4 | Ocimum basilicum L., fam. Lamiaceae (Labiatae) | 3.16% |
| Basil (Pakistan) | 8015-73-4 | Ocimum basilicum L., fam. Lamiaceae (Labiatae) | 0.15% |
| Basil (Vietnam) | 8015-73-4 | Ocimum basilicum L., fam. Lamiaceae (Labiatae) | 0.15% |
| Basil (Yugoslavia) | 8015-73-4 | Ocimum basilicum L., fam. Lamiaceae (Labiatae) | 4.5% |
| Basil (Comoro Islands) 2 | 8015-73-4 | Ocimum basilicum L., fam. Lamiaceae (Labiatae) | 0.05% |
| Bergamot (Italy) 1 | 8007-75-8 | Citrus bergamia Risso et Poiteau, fam. Rutaceae | 0.01% |
| Blackcurrant bud, absolute | 68606-81-5 | Ribes nigrum L., fam. Grossulariaceae | 2.61% |
| Calamintha nepeta (Belgium) | Calamintha nepeta (L.) Savi (Melissa nepeta L.), fam. Lamiaceae (Labiatae) | 0.3% | |
| Calamintha sylvatica (Belgium) | Calamintha sylvatica Bromf., fam. Lamiaceae (Labiatae) | 4.0% | |
| Caraway seed 1 | 8000-42-8 | Carum carvi L., fam. Apiaceae (Umbelliferae) | 0.05% |
| Caraway herb | 8000-42-8 | Carum carvi L., fam. Apiaceae (Umbelliferae) | 81.0% |
| Caraway root | 8000-42-8 | Carum carvi L., fam. Apiaceae (Umbelliferae) | 10.05% |
| Cedrela odorata | Cedrela odorata L., fam. Meliaceae | 2.6% | |
| Roman chamomile (India) | 8015-92-7 | Anthemis nobilis L., fam. Asteraceae (Compositae) | 0.11% |
| Clary sage 1 | 8016-63-5 | Salvia sclarea L., fam. Lamiaceae (Labiatae) | 5.9% |
| Clinopodium vulgare (Belgium) | Clinopodium vulgare L. (Satureja vulgaris (L.) Fritsch), fam. Lamiaceae | 55.9% | |
| Coleonema pulchellum | Coleonema pulchellum Williams (C. pulchrum Hook.), fam. Rutaceae | 4.9% | |
| Dragonhead | Dracocephalum moldavica L., fam. Lamiaceae (Labiatae) | 0.7% | |
| Eugenia javanica | Eugenia javanica Lamk., fam. Myrtaceae | 0.1% | |
| Ginger (India) 1 | 8007-08-7 | Zingiber officinale Roscoe, fam. Zingiberaceae | 0.5% |
| Ginger (Nigeria) 2 | 8007-08-7 | Zingiber officinale Roscoe, fam. Zingiberaceae | 1.05% |
| Ginger (Nigeria) 1 | 8007-08-7 | Zingiber officinale Roscoe, fam. Zingiberaceae | 1.59% |
| Hedeoma mandoniana | Hedeoma mandoniana Wedd, fam. Lamiaceae (Labiatae) | 1.07% | |
| Honeysuckle headspace | Lonicera caprifoleum L., fam. Caprifoliaceae | 5.8% | |
| Hyptis pectinata | Hyptis pectinata (L.) Poit., fam. Lamiaceae (Labiatae) | 31.4% | |
| Hyssop (France) 1 | 8006-83-5 | Hyssopus officinalis L., fam. Lamiaceae (Labiatae) | 1.5% |
| Hyssop (USA) | 8006-83-5 | Hyssopus officinalis L., fam. Lamiaceae (Labiatae) | 0.4% |
| Juniper berry 3 | 8012-91-7 | Juniperus communis L., fam. Cupressaceae | 2.7% |
| Juniper berry 5 | 8012-91-7 | Juniperus communis L., fam. Cupressaceae | 7.0% |
| Juniper branch | 8012-91-7 | Juniperus communis L., fam. Cupressaceae | 0.7% |
| Larix conifer bark | Larix decidua Mill., fam. Pinaceae | 1.69% | |
| Larix conifer needle | Larix decidua Mill., fam. Pinaceae | 9.99% | |
| Larix conifer wood | Larix decidua Mill., fam. Pinaceae | 12.43% | |
| Peppermint (USA) 5 | 8006-90-4 | Mentha piperita L. cultivar Michigan, fam. Lamiaceae (Labiatae) | 1.27% |
| Peppermint (Bulgaria) 1 | 8006-90-4 | Mentha piperita L., fam. Lamiaceae (Labiatae) | 0.84% |
| Artemisia maritima (Himalaya) | Artemisia maritima L., fam. Asteracae (Compositae) | 2.22% | |
| Artemisia gmelini (Himalaya) | Artemisia gmelinii Web. ex Stechm., fam. Asteracae (Compositae) | 2.53% | |
| Artemisia roxburghiana (Himalaya) | Artemisia roxburghiana Wall. ex Bies, var. hypolenca, fam. Asteraceae | 1.0% | |
| Annual wormwood (France) | 84775-74-6 | Artemisia annua L., fam. Asteraceae (Compositae) | 3.18% |
| Rosemary (Morocco) 1 | 8000-25-7 | Rosmarinus officinalis L., fam. Lamiaceae (Labiatae) | 0.05% |
| Rosemary (France) 1 | 8000-25-7 | Rosmarinus officinalis L., fam. Lamiaceae (Labiatae) | 0.01% |
| Juniper leaf 2 | 8012-91-7 | Juniperus communis L., fam. Cupressaceae | 1.83% |
| Tansy (Canada) 2a flowers | 8016-87-3 | Tanacetum vulgare L., fam. Asteraceae (Compositae) | 1.05% |
| Geranium (India) 8 | 8000-46-2 | Pelargonium graveolens L'Herit. ex Aiton, fam. Geraniaceae | 0.5% |
| Guava leaf 2 | 91770-12-6 | Psidium guajava L., fam. Myrtaceae | 0.55% |
| Angelica root (Finland) 4 | 8015-64-3 | Angelica archangelica L. var. archangelica, fam. Apiaceae (Umbelliferae) | 0.75% |
| Angelica root (Finland) 3 | 8015-64-3 | Angelica archangelica L. var. sativa, fam. Apiaceae (Umbelliferae) | 3.1% |
| Pepper, black (India) 1 | 8006-82-4 | Piper nigrum L., fam. Piperaceae | 0.1% |
| Pelargonium citronellum | Pelargonium citronellum J.J.A. v.d. Walt, fam. Geraniaceae | 1.0% | |
| Wormwood (Mugwort) (U.S.A.) 2 | 8008-93-3 | Artemisia absinthium L., fam. Asteraceae (Compositae) | 1.72% |
| Wormwood (Mugwort) (U.S.A.) 4 | 8008-93-3 | Artemisia absinthium L., var. 'Powis Castle', fam. Asteraceae (Compositae) | 3.48% |
| Wormwood (Mugwort) (U.S.A.) 5 | 8008-93-3 | Artemisia absinthium L., var. 'Powis Castle', fam. Asteraceae (Compositae) | 1.87% |
| Artemisia arborescens (U.S.A.) | Artemisia arborescens L., fam. Asteraceae (Compositae) | 6.11% | |
| Eromenthe (USA) 1 | Mentha spicata L., var. eromenthe, fam. Lamiaceae (Labiatae) | 6.0% | |
| Chamomile, german (Germany) 1 | 8002-66-2 | Chamomilla recutita (L.) Rausch.(Matricaria chamomilla L.), fam.Asteraceae | 1.48% |
| Eromenthe (USA) 2 | Mentha spicata L., var. eromenthe, fam. Lamiaceae (Labiatae) | 5.38% | |
| Yuzu (Japan) 3 | Citrus junos Sieb. ex Tanaka, fam. Rutaceae | 0.2% | |
| Shima-mikan peel 1b | Citrus kinokuni Hort. ex Tanaka, fam. Rutaceae | 0.03% | |
| Juniper leaf (Finland), headspace | 8012-91-7 | Juniperus communis L., fam. Cupressaceae | 0.05% |
| Juniper leaf (France) | 8012-91-7 | Juniperus communis L., fam. Cupressaceae | 0.01% |
| Geranium (Egypt) 4 | 8000-46-2 | Pelargonium graveolens L'Herit. ex Aiton, fam. Geraniaceae | 1.24% |
| Jasmine sambac headspace | Jasminum sambac (L.) Aiton, fam. Oleaceae | 1.0% | |
| Parsley leaf (Germany), 1b (smooth leaf) | 8000-68-8 | Petroselinum crispum (Miller) A.W. Hill (P. sativum Hoffm.), fam. Apiaceae | 1.45% |
| Parsley leaf (Germany), 1a (curly leaf) | 8000-68-8 | Petroselinum crispum (Miller) A.W. Hill (P. sativum Hoffm.), fam. Apiaceae | 0.65% |
| Vassoura (Uruguay) | Baccharis dracunculifolia DC., fam. Asteraceae (Compositae) | 1.38% | |
| Bitter orange leaf (Petitgrain) (Spain) 2 | 8014-17-3 | Citrus aurantium L., ssp. amara Engl., fam. Rutaceae | 0.04% |
| Artemisia argentea (Madeira) | Artemisia argentea L'Her., fam. Asteraceae (Compositae) | 3.2% | |
| Blumea brevipes | Blumea brevipes (Oliv. & Hiern) Willd., fam. Asteraceae (Compositae) | 15.4% | |
| Heteromorpha trifoliata | Heteromorpha trifoliata (Wendl.) Eckl. & Zey., fam.Apiaceae (Umbelliferae) | 17.9% | |
| Peppermint (Italy) 7 | 8006-90-4 | Mentha piperita L., fam. Lamiaceae (Labiatae) | 2.5% |
| Peppermint (France) 5 | 8006-90-4 | Mentha piperita L., fam. Lamiaceae (Labiatae) | 2.4% |
| Peppermint (Morocco) 1 | 8006-90-4 | Mentha piperita L., fam. Lamiaceae (Labiatae) | 0.04% |
| Peppermint (Brazil) | 8006-90-4 | Mentha piperita L., fam. Lamiaceae (Labiatae) | 0.65% |
| Peppermint (Chile) | 8006-90-4 | Mentha piperita L., fam. Lamiaceae (Labiatae) | 0.08% |
| Peppermint (USA) 8 | 8006-90-4 | Mentha piperita L., fam. Lamiaceae (Labiatae) | 1.2% |
| Peppermint (Canada) 2 | 8006-90-4 | Mentha piperita L., fam. Lamiaceae (Labiatae) | 1.92% |
| Peppermint (Argentina) | 8006-90-4 | Mentha piperita L., fam. Lamiaceae (Labiatae) | 1.4% |
| Peppermint (Australia) | 8006-90-4 | Mentha piperita L., fam. Lamiaceae (Labiatae) | 2.16% |
| Peppermint (Bulgaria) 2 | 8006-90-4 | Mentha piperita L., fam. Lamiaceae (Labiatae) | 2.35% |
| Peppermint (Canada) 3 | 8006-90-4 | Mentha piperita L., fam. Lamiaceae (Labiatae) | 1.5% |
| Peppermint (China) | 8006-90-4 | Mentha piperita L., fam. Lamiaceae (Labiatae) | 0.45% |
| Peppermint (France) 6 | 8006-90-4 | Mentha piperita L., fam. Lamiaceae (Labiatae) | 2.9% |
| Peppermint (Hungary) | 8006-90-4 | Mentha piperita L., fam. Lamiaceae (Labiatae) | 1.81% |
| Baccharis salicifolia (Argentina) | Baccharis salicifolia Pers., fam Asteraceae (Compositae) | 8.8% | |
| Artemisia austriaca (Turkey) | Artemisia austriaca Jacq., fam. Asteraceae (Compositae) | 0.1% | |
| Artemisia spicigera (Turkey) | Artemisia spicigera C. Koch., fam. Asteraceae (Compositae) | 0.3% | |
| Pelargonium reniforme | Pelargonium reniforme Curt., fam. Geraniaceae | 0.8% | |
| Cabore (Brazil) | Micrastur ruficolis, fam. Leguminosae (so-called: officially unknown) | 13.4% | |
| Hoslundia opposita | Hoslundia opposita Vahl., fam. Lamiaceae (Labiatae) | 15.1% | |
| Hyptis lanceolata | Hyptis lanciolata Poit., fam. Lamiaceae (Labiatae) | 19.1% | |
| Basil (Cameroon) | 8015-73-4 | Ocimum basilicum L., fam. Lamiaceae (Labiatae) | 2.2% |
| Plectranthus glandulosus (Cameroon) 1 | Plectranthus glandulosus Hook f., fam. Lamiaceae (Labiatae) | 6.0% | |
| Thyme (Cameroon) | 8007-46-3 | Thymus vulgaris L., fam. Lamiaceae (Labiatae) | 0.6% |
| Piper capense (Cameroon) 1a | Piper capense L., fam. Piperaceae | 1.0% | |
| Piper capense (Cameroon) 1b | Piper capense L., fam. Piperaceae | 5.2% | |
| Piper guineense (Cameroon) 1a | Piper guineense Schum. et Thom., fam. Piperaceae | 0.8% | |
| Piper guineense (Cameroon) 1b | Piper guineense Schum. et Thom., fam. Piperaceae | 3.0% | |
| Bixa orellana (Cameroon) | Bixa orellana L., fam. Bixaceae | 3.2% | |
| Grapefruit (Italy) 4b | 8016-20-4 | Citrus paradisi Macfayden, fam. Rutaceae | 0.1% |
| Grapefruit (Italy) 4c | 8016-20-4 | Citrus paradisi MacFayden, fam. Rutaceae | 0.07% |
| Ocimum gratissimum (Bangladesh) 1a | Ocimum gratissimum L., fam. Lamiaceae (Labiatae) | 0.05% | |
| Ocimum gratissimum (Bangladesh) 1b | Ocimum gratissimum L., var. clocimum, fam. Lamiaceae (Labiatae) | 2.9% | |
| Clementine (Uruguay) 1a | Citrus clementina Hort. ex Tan., cultivar Nules, fam. Rutaceae | 0.03% | |
| Clementine (Uruguay) 1b | Citrus clementina Hort. ex Tan., cultivar Comune, fam. Rutaceae | 0.02% | |
| Oregano, greek 3 | 84012-24-8 | Origanum vulgare L. ssp. hirtum (Link) Ietsw., fam. Lamiaceae (Labiatae) | 0.3% |
| Rosemary (Algeria) 1 | 8000-25-7 | Rosmarinus officinalis L., fam. Lamiaceae (Labiatae) | 0.3% |
| Mentha spicata (Cuba) Chemotype | Mentha spicata L., fam. Lamiaceae (Labiatae) | 0.9% | |
| Mentha arvensis ssp. austriaca 2 | Mentha arvensis L. ssp. austriaca, fam. Lamiaceae (Labiatae) | 5.0% | |
| Mentha arvensis ssp. agrestis | Mentha arvensis L. ssp agrestis (Sole) Briq. | 2.8% | |
| Origanum husnuca-baserii (Turkey) | Origanum husnucan-baserii H. Duman, Z. Aytac et A. Duran, fam. Lamiaceae | 2.74% | |
| Yarrow (Cuba) | 84082-83-7 | Achillea millefolium L., fam. Asteraceae (Compositae) | 0.8% |
| Ocimum tenuiflorum (Cuba) | Ocimum tenuiflorum L., fam. Lamiaceae (Labiatae) | 0.1% | |
| Geranium (India) 11 | 8000-46-2 | Pelargonium species, fam. Geraniaceae | 0.2% |
| Camphor (Cuba) | 8008-51-3 | Cinnamomum camphora (L.) Nees et Ebermaier, fam. Lauraceae | 1.5% |
| Lippia alba (Brazil) 2 | Lippia alba (Mill.) N.E. Brown, fam. Verbenaceae | 3.5% | |
| Calamintha nepeta (Italy) | Calamintha nepeta (L.) Savi ssp. nepeta, fam. Lamiaceae (Labiatae) | 1.1% | |
| Heterotheca latifolia (Argentina) 1a flower | Heterotheca latifolia Buck., fam. Asteraceae (Compositae) | 4.0% | |
| Heterotheca latifolia (Argentina) 1b leaf | Heterotheca latifolia Buck., fam. Asteraceae (Compositae) | 9.3% | |
| Commiphora africana (Benin) | Commiphora africana (A. Rich.) Engl. (Heudelotia africana),fam. Burseracea | 0.5% | |
| Eucalyptus citriodora (Bangladesh) | 8000-48-4 | Eucalyptus citriodora Hook. f., fam. Myrtaceae | 0.04% |
| Yuzu (Japan) 4 | Citrus junos Sieb. ex Tanaka, fam. Rutaceae | 0.2% | |
| Teucrium flavum (Greece) 1b leaf | Teucrium flavum L. ssp. hellenicum Rech. fil., fam. Lamiaceae (Labiatae) | 21.9% | |
| Teucrium flavum (Greece) 1a flower | Teucrium flavum L. ssp. hellenicum Rech. fil., fam. Lamiaceae (Labiatae) | 22.3% | |
| Lemongrass (Bangladesh) | 8007-02-1 | Cymbopogon citratus (DC) Stapf (C. flexuosus), fam. Poaceae (Gramineae) | 0.1% |
| Premna serratifolia flower bud | Premna serratifolia L. (P.obtusifolia Br.R., P.taitensis Sch.),Verbenaceae | 0.6% | |
| Piper auritum (Cuba) | Piper auritum H.B.K., fam. Piperaceae | 3.1% | |
| Basil (Egypt) 4 (linalool-type) | 8015-73-4 | Ocimum basilicum L., fam. Lamiaceae (Labiatae) | 2.8% |
| Pistacia lentiscus (Spain) 2 whole plant | 90082-83-0 | Pistacia lentiscus L., fam. Anarcadiaceae | 2.2% |
| Lemon (Italy-Sicily) 12a Femminello | 84929-31-7 | Citrus limon (L.) Burm. f., cultivar Femminello, fam. Rutaceae | 0.01% |
| Lemon (Italy-Sicily) 12b Lo Porto | 84929-31-7 | Citrus limon (L.) Burm. f., cultivar Lo Porto, fam. Rutaceae | 0.01% |
| Lemon (Italy-Sicily) 12c Monachello | 84929-31-7 | Citrus limon (L.) Burm. f., cultivar Monachello, fam. Rutaceae | 0.01% |
| Aegopodium podagraria | Aegodopodium podagraria L., fam. Apiaceae (Umbelliferae) | 11.0% | |
| Lemon balm (Italy) | 8014-71-9 | Melissa officinalis L., fam. Lamiaceae (Labiatae) | 0.1% |
| Hyssop (Yugoslavia) 1c form ruber | 8006-83-5 | Hyssopus officinalis L., f. ruber Mill., fam. Lamiaceae (Labiatae) | 2.6% |
| Afrocarpus mannii 1a leaf | Afrocarpus mannii Hook f., fam. Podocarpaceae | 12.6% | |
| Afrocarpus mannii 1b bark | Afrocarpus mannii Hook f., fam. Podocarpaceae | 11.0% | |
| Carapa guianensis | Carapa guianensis Aubl., fam. Meliaceae | 12.0% | |
| Carrot umbel (Poland) | 8015-88-1 | Daucus carota L. ssp. carota, fam. Apiaceae (Umbelliferae) | 2.51% |
| Teucrium carolipaui (Spain) | Teucrium carolipaui Pau, fam. Lamiaceae (Labiatae) | 0.3% | |
| Eupatorium cannabinum | Eupatorium cannabinum L. ssp. cannabinum, fam. Astercaceae (Compositae) | 33.5% | |
| Solidago gigantea | Solidago gigantea Ait., fam. Asteraceae (Compositae) | 22.55% | |
| Catharanthus roseus leaf | Catharanthus roseus (L.) G. Don, fam. Apocynaceae | 0.1% | |
| Ruilopezia atropurpurea | Ruilopezia atropurperea (A.C. Sm.) Cuatr., fam. Asteraceae (Compositae) | 1.1% | |
| Tanacetum balsamita | Tanacetum balsamita L., fam. Asteraceae (Compositae) | 3.3% | |
| Hypericum olympicum (Yugoslavia) | Hypericum olympicum L., fam. Guttiferae (Hyperiaceae) | 4.3% | |
| Salvia argentea (Greece) | Salvia argentea L., fam. Lamiaceae (Labiatae) | 0.05% | |
| Hymenocrater incanus (Iran) | Hymenocrater incanus Bunge, fam. Lamiaceae (Labiatae) | 4.5% | |
| Melia dubia (India) | Melia dubia Cav., fam. Meliaceae | 2.8% | |
| Pinus pinaster (Greece) needle | 8000-26-8 | Pinus pinaster Ait., fam. Pinaceae | 19.2% |
| Helichrysum bracteiferum (Madagascar) 2 | Helichrysum bracteiferum (DC) H. Humbert, fam. Asteraceae (Compositae) | 1.5% | |
| Calamintha sylvatica (Yugoslavia) | Calamintha sylvatica Bromf., ssp. sylvatica, fam. Lamiaceae (Labiatae) | 0.7% | |
| Baccharis uncinella (Brazil) | Baccharis uncinella DC., fam. Asteraceae (Compositae) | 1.8% | |
| Geranium (India) 15a cv. Kunti | 8000-46-2 | Pelargonium graveolens L'Herit. ex Aiton, cv. Kunti, fam. Geraniaceae | 0.1% |
| Geranium (India) 15b cv. Kunti variant | 8000-46-2 | Pelargonium graveolens L'Herit. ex Aiton, cv.Kunti variant, fam. Geraniace | 0.2% |
| Erichtites hieracifolia (Bolivia) | Erichtites hieracifolia (L.) Raf. ex DC, fam. Asteraceae (Compositae) | 2.0% | |
| Lippia alba (Uruguay) cultivar | Lippia alba (Mill.) N.E. Brown, fam. Verbenaceae | 6.0% | |
| Teucrium fruticans (Italy) 1a flowering phase | Teucrium fruticans L., fam. Lamiaceae (Labiatae) | 17.7% | |
| Teucrium fruticans (Italy) 1b fruiting phase | Teucrium fruticans L., fam. Lamiaceae (LAbiatae) | 24.4% | |
| Pinus nigra ssp. laricio (Corsica) 1a | Pinus nigra ssp. laricio (Poir.) Maire, fam. Pinaceae | 8.6% | |
| Pinus nigra ssp. laricio (Corsica) 1b | Pinus nigra ssp. laricio (Poir.) Maire, fam. Pinaceae | 17.8% | |
| Wartara (India) 3 seed | Zanthoxylum armatum DC. (Z. alatum Roxb.), fam Rutaceae | 0.05% | |
| Thymus lotocephallus (Portugal) flower | Thymus lotocephallus G. Lopez & R. Morales, fam. Lamiaceae (Labiatae) | 0.4% | |
| Lime (Mexican, West Indian, Key) (France) peel | 8008-26-2 | Citrus aurantifolia (Christm.) Swingle, cultivar Mexican, fam. Rutaceae | 0.1% |
| Lime (Mexican, West Indian, Key) (France) 1 leaf | 8008-26-2 | Citrus aurantifolia (Christm.) Swingle, cultivar Mexican, fam. Rutaceae | 0.3% |
| Yarrow (India) | 84082-83-7 | Achillea millefolium L., fam. Asteraceae (Compositae) | 11.5% |
| Pummelo (Shaddock) (Vietnam) peel | 84696-38-8 | Citrus maxima (J. Burman) Merrill. (C. grandis (L.) Osbeck), fam. Rutaceae | 0.2% |
| Orange, sweet (Vietnam) 2 | 8028-48-6 | Citrus sinensis (L.) Osbeck, fam. Rutaceae | 0.02% |
| Tangerine (Vietnam) | 8008-31-9 | Citrus reticulata Blanco, cultivar Tangerine, fam. Rutaceae | 0.02% |
| Lime (Mexican, West Indian, Key) (Vietnam) | 8008-26-2 | Citrus aurantifolia (Christm.) Swingle, fam. Rutaceae | 0.5% |
| Clary sage (Italy) 2a inflorescense | 8016-63-5 | Salvia sclarea L., fam. Lamiaceae (Labiatae) | 10.56% |
| Clary sage (Italy) 2b leaf | 8016-63-5 | Salvia sclarea L., fam. Lamiaceae (Labiatae) | 68.85% |
| Pistacia lentiscus (Italy) 1a CO2-extract | 90082-83-0 | Pistacia lentiscus L., fam. Anacardiaceae | 12.05% |
| Pistacia lentiscus (Italy) 1b CO2-extract | 90082-83-0 | Pistacia lentiscus L., fam. Anacardiaceae | 7.35% |
| Pistacia lentiscus (Italy) 2a CO2 extract berry | 90082-83-0 | Pistacia lentiscus L., fam. Anacardiaceae | 1.07% |
| Pistacia lentiscus (Italy) 2b hydrodist. berry | 90082-83-0 | Pistacia lentiscus L., fam. Anacardiaceae | 0.99% |
| Pistacia lentiscus (Italy) 3a CO2 extract leaf | 90082-83-0 | Pistacia lentiscus L., fam. Anacardiaceae | 12.05% |
| Pistacia lentiscus (Italy) 3b hydrodist. leaf | 90082-83-0 | Pistacia lentiscus L., fam. Anacardiaceae | 3.91% |
| Thymus transcaspicus (Iran) | Thymus transcaspicus Klokov, fam. Lamiaceae (Labiatae) | 0.02% | |
| Ageratum conyzoides (Nigeria) | 85480-32-6 | Ageratum conyzoides L., fam. Asteraceae (Compositae) | 1.28% |
| Cymbopogon olivieri (Iran) | Cymbopogon olivieri (Boiss.) Bor, fam. Poaceae (Gramineae) | 0.3% | |
| Nepeta argolica (Greece) 1a chemotype 1 | Nepeta argolica Bory & Chaub. ssp. argolica, fam. Lamiaceae (Labiatae) | 0.88% | |
| Geranium (India) 12a Genotype 1 'Algerian' | 8000-46-2 | Pelargonium species, fam. Geraniaceae | 0.2% |
| Geranium (India) 12b Genotype 2 'Bourbon' | 8000-46-2 | Pelargonium species, fam. Geraniaceae | 0.3% |