-
Định danh
Số CAS
123-35-3Công thức phân tử
C10H16SMILES
CC(=CCCC(=C)C=C)C
Nhãn an toàn
Dễ cháy
Kích ứng
Sức khỏe
Môi trườngChỉ số lưu (RI)
- DB5: 990.57
- Carbowax: 1161.14
-
Hồ sơ mùi hương
Hương thơm Thảo mộc 74.36% Gỗ 67.35% Cam chanh 66.48% Terpen 52.72% Tươi mát 51.44% Xanh 50.74% Hoa 46.8% Ngọt 46.76% Cay 46.15% Trái cây 43.69% Hương vị Citrus 57.38% Sweet 46.88% Woody 46.71% Balsam 46.02% Spicy 45.67% Balsamic 43.75% Wood 42.37% Herbal 41.44% Terpene 41.09% Spice 36.84% Cường độ mùi ước lượng
Mạnh -
Thuộc tính
XLogP3-AA
4.3pKa ước lượng
9.32 (kiềm yếu)Khối lượng phân tử
136.23 g/molÁp suất hơi ước lượng
- hPa @ 20°C
- hPa @ 25°C
Tốc độ bay hơi
Rất nhanhĐiểm tan chảy thực nghiệm
- < -10 °C
Điểm sôi
- 332.6 °F at 760 mmHg (USCG, 1999)
- 167 °C
- 166.00 to 167.00 °C. @ 760.00 mm Hg
Điểm chớp cháy
- 43.12 ˚C ước lượng
- 103 °F (USCG, 1999)
Độ tan thực nghiệm
- Soluble in alcohol, chloroform, ether, glacial acetic acid
- Soluble in ethanol and benzene
- Soluble in oxygenated and chlorinated solvents.
- In water, 5.60 mg/L at 25 °C
- In water, 4.09 mg/L at 25 °C
- 0.0056 mg/mL at 25 °C
- Insoluble in water; soluble in oils
- Soluble (in ethanol)
-
Các tên gọi
- MYRCENE
- 123-35-3
- beta-Myrcene
- 7-Methyl-3-methyleneocta-1,6-diene
- 7-Methyl-3-methylene-1,6-octadiene
- 1,6-Octadiene, 7-methyl-3-methylene-
- 7-methyl-3-methylideneocta-1,6-diene
- .beta.-Myrcene
- beta-geraniolene
- Myrcene (natural)
- FEMA No. 2762
- 2-Methyl-6-methylene-2,7-octadiene
- b-Myrcene
- 3-Methylene-7-methyl-1,6-octadiene
- .beta.-Geraniolene
- CCRIS 3725
- NSC 406264
- HSDB 1258
- beta -myrcene
- EINECS 204-622-5
- UNII-3M39CZS25B
- MFCD00008908
- NSC-406264
- BRN 1719990
- 3M39CZS25B
- DTXSID6025692
- CHEBI:17221
- AI3-00738
- b-Myrcene (>90%)
- 7-Methyl-3-methylene-octa-1,6-diene
- DTXCID205692
- Myrcene (stabilized with BHT)
- EC 204-622-5
- 4-01-00-01108 (Beilstein Handbook Reference)
- 7-Methyl-3-methyleneoctadiene-(1,6)
- beta-Myrcene 1000 microg/mL in Isopropanol
- b-Geraniolene
- Myrcene Natural
- beta -mircene
- Myrcene (Standard)
- Myrcene, .beta.-
- Myrcene - 75%
- MYRCENE [FHFI]
- MYRCENE [HSDB]
- Myrcene, technical grade
- ?-MYRCENE
- MYRCENE [FCC]
- beta-MYRCENE (IARC)
- Myrcene Natural ex Orange
- Myrcene analytical standard
- ?-Myrcene (>90%)
- Myrcene, analytical standard
- FEMA NUMBER 2762
- 1, 7-methyl-3-methylene-
- .BETA.-MYRCENE [MI]
- CHEMBL455491
- .BETA.-MYRCENE [IARC]
- FEMA 2762
- HY-N0803R
- Methyl-3-methylene-1,6-octadiene
- Methyl-6-methylene-2,7-octadiene
- Methylene-7-methyl-1,6-octadiene
- Octadiene, 7-methyl-3-methylene-
- HY-N0803
- WLN: 1Y1&U3YU1&1U1
- Tox21_300351
- BBL036906
- NSC406264
- STL477735
- AKOS015904015
- 3-Methylene-7-methyl-1, 6-octadiene
- FM59691
- LMPR0102010005
- 7-methyl-3-methylidene-octa-1,6-diene
- Mycrene 1000 microg/mL in Isopropanol
- Myrcene 1000 microg/mL in Isopropanol
- NCGC00091420-01
- NCGC00091420-02
- NCGC00254252-01
- CAS-123-35-3
- Myrcene, >=95%, stabilized, FCC, FG
- VS-13772
- M0235
- NS00005804
- 7-Methyl-3-methylene-1,6-octadiene (myrcene)
- C06074
- E80785
- EN300-187797
- A805060
- Myrcene, primary pharmaceutical reference standard
- Q424577
- 7-Methyl-3-methylene-1,6-octadiene (beta -myrcene)
- InChI=1/C10H16/c1-5-10(4)8-6-7-9(2)3/h5,7H,1,4,6,8H2,2-3H
- 204-622-5
- 29463-45-4
- 7-Methyl-3-methylene-1,6-octadiene;2-Methyl-6-methylene-2,7-octadiene;b-Geraniolene;3-Methylene-7-methyl-1,6-octadiene
- N6Q
-
Ứng dụng
Myrcene (CAS 123-35-3) là một monoterpene không no, là thành phần nổi bật của dầu hoa bia và được dùng làm nguyên liệu cho nhiều ứng dụng đặc trưng mùi. Trong ngành hương liệu và mỹ phẩm, nó được sử dụng như thành phần hương thơm và odorant, và có thể đóng vai trò như chất cố định hương trong một số công thức nước hoa. Trong ngành thực phẩm và đồ uống, nó có thể được xem như thành phần hương vị trong một số công thức; trong mỹ phẩm và chăm sóc cá nhân, nó thường được dùng như thành phần hương thơm. Trong các sản phẩm gia dụng và làm sạch, myrcene được đưa vào để bổ sung mùi hương. Trong lĩnh vực polymers/plastics, nó được xem như tiền chất hoặc monomer cho tổng hợp polymer terpen và cao su tổng hợp; ngoài ra nó cũng được sử dụng trong coatings/inks như một thành phần hương và chất nền cho các dẫn xuất của nó.
gpt-5-nano
-
Độ tan @25˚C
Dung môi Độ tan (g/L) ethanol 374.78 methanol 222.47 isopropanol 253.24 water 0.08 ethyl acetate 552.51 n-propanol 314.87 acetone 228.39 n-butanol 464.01 acetonitrile 174.41 DMF 144.72 toluene 494.82 isobutanol 207.73 1,4-dioxane 954.8 methyl acetate 246.57 THF 1345.83 2-butanone 365.82 n-pentanol 324.73 sec-butanol 356.97 n-hexane 725.04 ethylene glycol 20.05 NMP 213.89 cyclohexane 712.44 DMSO 158.41 n-butyl acetate 1020.85 n-octanol 265.32 chloroform 836.45 n-propyl acetate 326.65 acetic acid 115.05 dichloromethane 607.81 cyclohexanone 461.3 propylene glycol 54.8 isopropyl acetate 393.29 DMAc 230.47 2-ethoxyethanol 276.95 isopentanol 394.73 n-heptane 940.55 ethyl formate 138.74 1,2-dichloroethane 409.19 n-hexanol 842.79 2-methoxyethanol 305.74 isobutyl acetate 244.97 tetrachloromethane 213.3 n-pentyl acetate 322.24 transcutol 1364.9 n-heptanol 280.2 ethylbenzene 294.16 MIBK 288.63 2-propoxyethanol 642.06 tert-butanol 409.73 MTBE 858.74 2-butoxyethanol 288.95 propionic acid 113.41 o-xylene 263.69 formic acid 21.0 diethyl ether 1347.52 m-xylene 294.03 p-xylene 271.14 chlorobenzene 292.6 dimethyl carbonate 58.37 n-octane 172.14 formamide 32.26 cyclopentanone 337.33 2-pentanone 416.63 anisole 374.5 cyclopentyl methyl ether 753.06 gamma-butyrolactone 260.22 1-methoxy-2-propanol 288.98 pyridine 561.55 3-pentanone 324.39 furfural 244.91 n-dodecane 72.52 diethylene glycol 183.8 diisopropyl ether 482.68 tert-amyl alcohol 461.18 acetylacetone 264.05 n-hexadecane 82.86 acetophenone 219.07 methyl propionate 241.54 isopentyl acetate 762.4 trichloroethylene 534.61 n-nonanol 266.13 cyclohexanol 376.87 benzyl alcohol 150.67 2-ethylhexanol 732.76 isooctanol 222.82 dipropyl ether 1622.97 1,2-dichlorobenzene 240.85 ethyl lactate 89.24 propylene carbonate 198.91 n-methylformamide 63.38 2-pentanol 391.58 n-pentane 522.3 1-propoxy-2-propanol 683.1 1-methoxy-2-propyl acetate 583.95 2-(2-methoxypropoxy) propanol 344.53 mesitylene 198.75 ε-caprolactone 405.71 p-cymene 288.68 epichlorohydrin 457.65 1,1,1-trichloroethane 488.17 2-aminoethanol 71.06 morpholine-4-carbaldehyde 310.61 sulfolane 236.88 2,2,4-trimethylpentane 177.7 2-methyltetrahydrofuran 1157.92 n-hexyl acetate 441.85 isooctane 144.26 2-(2-butoxyethoxy)ethanol 435.93 sec-butyl acetate 318.44 tert-butyl acetate 451.58 decalin 243.08 glycerin 58.22 diglyme 789.15 acrylic acid 65.65 isopropyl myristate 230.58 n-butyric acid 306.32 acetyl acetate 249.48 di(2-ethylhexyl) phthalate 151.93 ethyl propionate 303.88 nitromethane 119.85 1,2-diethoxyethane 1192.83 benzonitrile 203.26 trioctyl phosphate 109.39 1-bromopropane 703.37 gamma-valerolactone 375.3 n-decanol 197.05 triethyl phosphate 218.68 4-methyl-2-pentanol 245.66 propionitrile 248.11 vinylene carbonate 140.67 1,1,2-trichlorotrifluoroethane 200.52 DMS 178.13 cumene 188.14 2-octanol 187.8 2-hexanone 404.62 octyl acetate 253.97 limonene 543.86 1,2-dimethoxyethane 710.15 ethyl orthosilicate 272.78 tributyl phosphate 153.57 diacetone alcohol 281.04 N,N-dimethylaniline 254.96 acrylonitrile 150.28 aniline 285.04 1,3-propanediol 138.99 bromobenzene 358.32 dibromomethane 598.65 1,1,2,2-tetrachloroethane 524.66 2-methyl-cyclohexyl acetate 455.12 tetrabutyl urea 185.25 diisobutyl methanol 373.73 2-phenylethanol 318.85 styrene 323.62 dioctyl adipate 259.28 dimethyl sulfate 59.94 ethyl butyrate 731.75 methyl lactate 74.15 butyl lactate 154.97 diethyl carbonate 344.81 propanediol butyl ether 169.17 triethyl orthoformate 549.22 p-tert-butyltoluene 286.5 methyl 4-tert-butylbenzoate 232.81 morpholine 1010.34 tert-butylamine 431.58 n-dodecanol 158.24 dimethoxymethane 262.53 ethylene carbonate 153.83 cyrene 158.11 2-ethoxyethyl acetate 355.34 2-ethylhexyl acetate 763.01 1,2,4-trichlorobenzene 272.96 4-methylpyridine 515.51 dibutyl ether 821.85 2,6-dimethyl-4-heptanol 373.73 DEF 390.61 dimethyl isosorbide 536.03 tetrachloroethylene 346.59 eugenol 182.49 triacetin 255.45 span 80 336.46 1,4-butanediol 46.52 1,1-dichloroethane 425.93 2-methyl-1-pentanol 331.84 methyl formate 38.15 2-methyl-1-butanol 351.23 n-decane 155.84 butyronitrile 396.6 3,7-dimethyl-1-octanol 332.06 1-chlorooctane 319.65 1-chlorotetradecane 122.89 n-nonane 178.64 undecane 98.74 tert-butylcyclohexane 220.23 cyclooctane 328.48 cyclopentanol 235.49 tetrahydropyran 1446.13 tert-amyl methyl ether 747.5 2,5,8-trioxanonane 526.33 1-hexene 1049.52 2-isopropoxyethanol 235.77 2,2,2-trifluoroethanol 23.27 methyl butyrate 342.13 Scent© AI
| Nồng độ tối đa được chấp nhận trong sản phẩm hoàn thiện (%) | |||
|---|---|---|---|
|
Danh mục 1
Sản phẩm sử dụng cho môi
|
Không hạn chế |
Danh mục 7A
Sản phẩm rửa xả thoa lên tóc có tiếp xúc với tay
|
Không hạn chế |
|
Danh mục 2
Sản phẩm sử dụng cho vùng nách
|
Không hạn chế |
Danh mục 7B
Sản phẩm lưu lại trên tóc có tiếp xúc với tay
|
Không hạn chế |
|
Danh mục 3
Sản phẩm thoa lên mặt/cơ thể bằng đầu ngón tay
|
Không hạn chế |
Danh mục 8
Sản phẩm có tiếp xúc đáng kể với vùng hậu môn - sinh dục
|
Không hạn chế |
|
Danh mục 4
Sản phẩm liên quan đến nước hoa
|
Không hạn chế |
Danh mục 9
Sản phẩm tiếp xúc với cơ thể và tay, chủ yếu rửa xả
|
Không hạn chế |
|
Danh mục 5A
Sản phẩm dưỡng thể thoa lên cơ thể bằng tay (lòng bàn tay), chủ yếu lưu lại trên da
|
Không hạn chế |
Danh mục 10A
Sản phẩm chăm sóc nhà cửa chủ yếu tiếp xúc với tay
|
Không hạn chế |
|
Danh mục 5B
Sản phẩm dưỡng ẩm cho mặt thoa lên mặt bằng tay (lòng bàn tay), chủ yếu lưu lại trên da
|
Không hạn chế |
Danh mục 10B
Sản phẩm chăm sóc nhà cửa chủ yếu tiếp xúc với tay, bao gồm dạng xịt/phun (có khả năng lưu lại trên da)
|
Không hạn chế |
|
Danh mục 5C
Kem dưỡng da tay thoa lên tay bằng tay (lòng bàn tay), chủ yếu lưu lại trên da
|
Không hạn chế |
Danh mục 11A
Sản phẩm dự kiến tiếp xúc với da nhưng hầu như không truyền hương lên da từ chất nền trơ, không tiếp xúc với tia UV
|
Không hạn chế |
|
Danh mục 5D
Kem dưỡng, dầu dưỡng và phấn rôm cho em bé
|
Không hạn chế |
Danh mục 11B
Sản phẩm dự kiến tiếp xúc với da nhưng hầu như không truyền hương lên da từ chất nền trơ, có khả năng tiếp xúc với tia UV
|
Không hạn chế |
|
Danh mục 6
Sản phẩm tiếp xúc với miệng và môi
|
Không hạn chế |
Danh mục 12
Sản phẩm không nhằm tiếp xúc trực tiếp với da, chỉ truyền rất ít hoặc không đáng kể sang da
|
Không hạn chế |
| Tên | CAS | Thực vật | Tỷ lệ |
|---|---|---|---|
| Abies alba conifer 1 | 8021-27-0 | Abies alba Mill., fam. Pinaceae | 1.86% |
| Abies alba conifer 2 | 8021-27-0 | Abies alba Mill., fam. Pinaceae | 1.03% |
| Fir balsam 1 | 8021-28-1 | Abies balsamea (L.) Mill., fam. Pinaceae | 2.27% |
| Abies cephalonica | Abies cephalonica Loud., fam. Pinaceae | 1.4% | |
| Abies holophylla (China) 1 | Abies holophylla Maxim., fam. Pinaceae | 1.86% | |
| Abies nordmannia conifer | Abies nordmannia (Steven) Spach, fam. Pinaceae | 2.31% | |
| Abies semenovii | Abies semenovii L., fam. Pinaceae | 0.8% | |
| Abies sibirica 3 | Abies sibirica Ledeb., fam. Pinaceae | 0.86% | |
| Ageratum conyzoides (Vietnam) | 85480-32-6 | Ageratum conyzoides L., fam. Asteraceae (Compositae) | 0.9% |
| Alpinia chinensis (China) | Alpinia chinensis Rosc., fam. Zingiberaceae | 0.01% | |
| Alpinia japonica | Alpinia japonica Miq., fam. Zingiberaceae | 1.0% | |
| Amomum pavieanum rhizome | Amomum pavieanum Pierre & Gagnep, fam. Zingiberaceae | 0.1% | |
| Amomum villosum (China) 1f fruit | Amomum villosum Lour., fam. Zingiberaceae | 2.6% | |
| Amomum villosum (China) 1c | Amomum villosum Lour., fam. Zingiberaceae | 2.9% | |
| Amomum villosum (China) 1a | Amomum villosum Lour. var. xanthioides, fam. Zingiberaceae | 5.2% | |
| Shanqiu | Anaphalis margaritacea (L.) Benth.et Hook.(Shanqiu),fam.Asteraceae (Comp.) | 0.28% | |
| Angelica root (Finland) 1 | 8015-64-3 | Angelica archangelica L., fam. Apiaceae (Umbelliferae) | 0.6% |
| Angelica (norvegica) tap root | 8015-64-3 | Angelica archangelica L. var. norvegica, fam. Apiaceae (Umbelliferae) | 3.76% |
| Angelica (norvegica) lateral root | 8015-64-3 | Angelica archangelica L. var. norvegica, fam. Apiaceae (Umbelliferae) | 3.62% |
| Angelica (sativa) tap root | 8015-64-3 | Angelica archangelica L. var. sativa, fam. Apiaceae (Umbelliferae) | 4.3% |
| Angelica (sativa) lateral root | 8015-64-3 | Angelica archangelica L. var. sativa, fam. Apiaceae (Umbelliferae) | 3.26% |
| Star anise (China, Yunnan) 5 | 8007-70-3 | Illicium verum Hooker fil., fam. Magnoliaceae (Illiciaceae) | 0.12% |
| Anise seed 1 | 8007-70-3 | Pimpinella anisum L., fam. Apiaceae (Umbelliferae) | 0.02% |
| Chamomile, wild (Morocco) | Ormenis mixta, fam. Asteraceae (Compositae) | 1.0% | |
| Armoise flower | 8008-93-3 | Artemisia vulgaris L., fam. Asteraceae (Compositae) | 13.67% |
| Annual wormwood (USA, Oregon) | 84775-74-6 | Artemisia annua L., fam. Asteraceae (Compositae) | 4.6% |
| Artemisia nilagirica (vulgaris) (India) 2 | Artemisia nilagirica (C.B. Clarks) Pamp. (A. vulgaris Hook f.), Asteraceae | 0.01% | |
| Annual wormwood 2 | 84775-74-6 | Artemisia annua L., fam. Asteraceae (Compositae) | 3.45% |
| Artemisia vestita (India) | Artemisia vestita Wall. ex Dc., fam. Asteraceae (Compositae) | 0.27% | |
| Asafoetida (Pakistan) 1a | 9000-04-8 | Ferula assafoetida L., fam. Apiaceae (Umbelliferae) | 2.25% |
| Atractylis | Atractylodes lancea (Thunb.) DC. (A. ovata Thunb.; A. chinensis (Bunge)DC) | 1.0% | |
| Lemon balm 2 | 8014-71-9 | Melissa officinalis L., fam. Lamiaceae (Labiatae) | 0.1% |
| Basil 1 | 8015-73-4 | Ocimum basilicum L., fam. Lamiaceae (Labiatae) | 0.1% |
| Basil (Fiji) 2 | 8015-73-4 | Ocimum basilicum L., fam. Lamiaceae (Labiatae) | 0.05% |
| Basil (Fiji) 1 | 8015-73-4 | Ocimum basilicum L., fam. Lamiaceae (Labiatae) | 0.05% |
| Basil (Italy) 1a CO2-extract | 8015-73-4 | Ocimum basilicum L., fam. Lamiaceae (Labiatae) | 1.0% |
| Basil (Nigeria) 1 | 8015-73-4 | Ocimum basilicum L., fam. Lamiaceae (Labiatae) | 0.11% |
| Basil (India), herb | 8015-73-4 | Ocimum basilicum L., fam. Lamiaceae (Labiatae) | 0.13% |
| Basil (India), flower | 8015-73-4 | Ocimum basilicum L., fam. Lamiaceae (Labiatae) | 0.11% |
| Basil (India), whole plant | 8015-73-4 | Ocimum basilicum L., fam. Lamiaceae (Labiatae) | 0.14% |
| Basil (Italy) 1b dry leaves | 8015-73-4 | Ocimum basilicum L., fam. Lamiaceae (Labiatae) | 0.2% |
| Basil (Italy) 1c frozen leaves | 8015-73-4 | Ocimum basilicum L., fam. Lamiaceae (Labiatae) | 1.1% |
| Basil (Italy) 1d oleoresin dry leaves | 8015-73-4 | Ocimum basilicum L., fam. Lamiaceae (Labiatae) | 0.2% |
| Basil (Comoro Islands) 2 | 8015-73-4 | Ocimum basilicum L., fam. Lamiaceae (Labiatae) | 0.1% |
| Basil (European) 2 | 8015-73-4 | Ocimum basilicum L., fam. Lamiaceae (Labiatae) | 0.5% |
| Basil (European) 1 | 8015-73-4 | Ocimum basilicum L., fam. Lamiaceae (Labiatae) | 0.2% |
| Bay, West Indian 1 | 8015-73-4 | Pimenta racemosa var. racemosa (P. Miller) J.W. Moore, fam. Myrtaceae | 5.7% |
| Bay, West Indian 2 | 8015-73-4 | Pimenta racemosa var. racemosa (P. Miller) J.W. Moore, fam. Myrtaceae | 13.9% |
| Bergamot (Argentina) 1 | 8007-75-8 | Citrus bergamia Risso et Poiteau, fam. Rutaceae | 0.8% |
| Bergamot (Argentina) 2 | 8007-75-8 | Citrus bergamia Risso et Poiteau, fam. Rutaceae | 0.92% |
| Mentha gentilis var. lanata | Mentha gentilis (L.) var. lanata (Rydb.) Fujita et Fujita, fam. Lamiaceae | 0.3% | |
| Mentha longifolia (Italy) | 90063-99-3 | Mentha longifolia (L.) Hudson, fam. Lamiaceae (Labiatae) | 0.76% |
| Mentha longifolia (The Netherlands) | 90063-99-3 | Mentha longifolia (L.) Hudson, fam. Lamiaceae (Labiatae) | 0.13% |
| Mentha longifolia (France) Chemotype 1 | 90063-99-3 | Mentha longifolia (L.) Hudson, fam. Lamiaceae (Labiatae) | 0.7% |
| Mentha longifolia (France) Chemotype 2 | 90063-99-3 | Mentha longifolia (L.) Hudson, fam. Lamiaceae (Labiatae) | 0.8% |
| Mentha longifolia ssp. longifolia (Greece) | 90063-99-3 | Mentha longifolia (L.) ssp. longifolia, fam. Lamiaceae (Labiatae) | 0.9% |
| Mentha longifolia ssp. petiolata (Greece) 1 | 90063-99-3 | Mentha longifolia (L.) ssp. petiolata (Chemotype I), fam. Lamiaceae | 0.9% |
| Mentha longifolia ssp. petiolata (Greece) 2 | 90063-99-3 | Mentha longifolia (L.) ssp. petiolata (Chemotype II), fam. Lamiaceae | 2.35% |
| Mentha longifolia var. crispa (Italy) | 90063-99-3 | Mentha longifolia (L.) var. crispa Ten., fam. Lamiaceae (Labiatae) | 0.91% |
| Mentha requienii 1 | Mentha requienii Bentham, fam. Lamiaceae (Labiatae) | 0.25% | |
| Mentha requienii 2 | Mentha requienii Bentham, fam. Lamiaceae (Labiatae) | 0.6% | |
| Mentha rotundifolia (Greece) 1 | Mentha x rotundifolia (L.) Hudson (Chemotype I), fam. Lamiaceae (Labiatae) | 0.95% | |
| Mentha rotundifolia (Japan) | Mentha rotundifolia (L.) Hudson, fam. Lamiaceae (Labiatae) | 0.1% | |
| Mentha spicata (Greece) Chemotype I | Mentha spicata L. (Chemotype I), fam. Lamiaceae (Labiatae) | 5.2% | |
| Mentha spicata (Greece) Chemotype II | Mentha spicata L. (Chemotype II), fam. Lamiaceae (Labiatae) | 2.6% | |
| Mentha spicata (Greece) Chemotype IIIa | Mentha spicata L. (Chemotype IIIa), fam. Lamiaceae (Labiatae) | 0.65% | |
| Mentha spicata (Greece) Chemotype IIIb | Mentha spicata L. (Chemotype IIIb), fam. Lamiaceae (Labiatae) | 0.7% | |
| Mentha spicata (Greece) Chemotype IV | Mentha spicata L. (Chemotype IV), fam Lamiaceae (Labiatae) | 0.04% | |
| Mentha suaveolens (Chemotype 1) | Mentha suaveolens Ehrh. (Chemotype 1), fam. Lamiaceae (Labiatae) | 0.58% | |
| Mentha suaveolens (Chemotype 2) | Mentha suaveolens Ehrh. (Chemotype 2), fam. Lamiaceae (Labiatae) | 0.17% | |
| Mentha suaveolens (Greece) | Mentha suaveolens Ehrh., fam Lamiacae (Labiatae) | 0.35% | |
| Mentha viridis (Italy) | Mentha viridis (L.) lavanduliodora Sacco, fam Lamiaceae (Labiatae) | 0.84% | |
| Mentha x dumetorum (Greece) | Mentha x dumetorum, fam Lamiaceae (Labiatae) | 0.8% | |
| Mentha x gentilis | Mentha x gentilis L. (arvensis x spicata), fam. Lamiaceae (Labiatae) | 0.3% | |
| Mentha x gentilis nm. hirtella | Mentha x gentilis (L.) nm hirtella Markl., fam Lamiaceae (Labiatae) | 0.6% | |
| Mentha x spicata (Greece) | Mentha x spicata L., fam. Lamiaceae (Labiatae) | 1.15% | |
| Mentha x villosa (Belgium) | Mentha x villosa H. nm. alopecuroides (M. x alopecuroides; M. x velutina) | 0.45% | |
| Mentha x villosa (Greece) 1 | Mentha x villosa Hudson, fam. Lamiaceae (Labiatae) | 0.5% | |
| Mentha x villosa (Greece) 2 | Mentha x villosa Hudson, fam. Lamiaceae (Labiatae) | 0.35% | |
| Mentha x villoso-nervata (Greece) 1 | Mentha x villoso-nervata Opiz (M.longifolia L. x M.spicata L.) (Chemot.I) | 0.5% | |
| Mentha x villoso-nervata (Greece) 2 | Mentha x villoso-nervata Opiz (M.longifolia L. x M.spicata L.) (Chemot.II) | 1.88% | |
| Mentha rotundifolia (Greece) 2 | Mentha rotundifolia (L.) Hudson (Chemotype II), fam. Lamiaceae (Labiatae) | 0.01% | |
| Micromeria teneriffae | Micromeria teneriffae Benth. (M. terebinthaceae Webb et Berth.), Lamiaceae | 1.7% | |
| Satsuma mandarin peel 1 | Citrus unshiu Marcovitch, fam. Rutaceae | 1.0% | |
| Minthostachys glabrescens | Minthostachys glabrescens Epling, fam. Lamiaceae (Labiatae) | 0.5% | |
| Minthostachys andina | Minthostachys andina (Brett) Epling, fam. Lamiaceae (Labiatae) | 0.06% | |
| Monarda fistulosa, var. menthaefolia 2 | Monarda fistulosa L. var. menthaefolia, fam. Lamiaceae (Labiatae) | 1.3% | |
| Monodora myristica fruit (Cameroon) | Monodora myristica (Gaertn.) Dunal, fam. Annonaceae | 7.9% | |
| Mullilam | Zanthoxylum rhetsa D.C. syn. Z. limonella (Dennst.) Alston, fam. Rutaceae | 1.0% | |
| Myrrh gum (headspace) | 8016-37-3 | Commiphora myrrha (Nees) Engler, fam. Burseraceae | 0.45% |
| Myrtle leaf (Morocco) 1 | 8008-46-6 | Myrtus communis L., fam. Myrtaceae | 0.2% |
| Myrtle leaf, cultivated (Spain) | 8008-46-6 | Myrtus communis L., fam. Myrtaceae | 0.17% |
| Myrtle leaf, wildgrowing (Spain) | 8008-46-6 | Myrtus communis L., fam. Myrtaceae | 0.16% |
| Myrtle berry (Italy) | 8008-46-6 | Myrtus communis L., fam. Myrtaceae | 0.2% |
| Narcissus tazetta absolute 2 | 8023-75-4 | Narcissus tazetta L., fam. Amaryllidaceae | 0.1% |
| Narcissus tazetta absolute 3 | 8023-75-4 | Narcissus tazetta L., fam. Amaryllidaceae | 1.0% |
| Nepeta nuda (Belgium) | Nepeta nuda L., fam. Lamiaceae (Labiatae) | 0.15% | |
| Neroli bigarade (bitter orange flower) Spain 2 | 8016-38-4 | Citrus aurantium L., ssp. amara Engl., fam. Rutaceae | 1.7% |
| Nigella sativa seed | Nigella sativa L., fam. Ranunculaceae | 0.5% | |
| Nutmeg (India) 1 | 8008-45-5 | Myristica fragrans Houtt., fam. Myristicaceae | 2.95% |
| Hop (Cascade cultivar) (USA) | 8007-04-3 | Humulus lupulus L., cultivar Cascade, fam. Cannabaceae | 65.97% |
| Hop (Galena cultivar) (USA) | 8007-04-3 | Humulus lupulus L., cultivar Galena, fam. Cannabaceae | 60.35% |
| Hop (Styrian cultivar) (USA) | 8007-04-3 | Humulus lupulus L., cultivar Styrian, fam. Cannabaceae | 33.25% |
| Hop (Willamette cultivar) (USA) | 8007-04-3 | Humulus lupulus L., cultivar Willamette, fam. Cannabaceae | 53.39% |
| Hop (Neomexicanus cultivar) (USA) | 8007-04-3 | Humulus lupulus L., var. neomeaxicanus Nels. & Cockerell, fam. Cannabaceae | 62.18% |
| Fingered Citron | Citrus medica L., cultivar sarcodactylis (Noot.) Swingle, fam. Rutaceae | 1.67% | |
| Calamintha nepeta (Greece) 2 | Calamintha nepeta (L.) Savi ssp. glandulosa (Req.) P.W.Ball, fam.Lamiaceae | 2.95% | |
| Schinus molle berry | 68917-52-2 | Schinus molle L., fam. Anarcadiaceae | 0.01% |
| Schinus molle leaf | 68917-52-2 | Schinus molle L., fam. Anarcadiaceae | 0.01% |
| Vitex limonifolia leaf | Vitex limonifolia Wall., fam. Verbenaceae | 0.01% | |
| Eucalyptus viminalis (Uruguay) | Eucalyptus viminalis Labill., fam. Myrtaceae | 0.9% | |
| Eucalyptus paniculata (Uruguay) | Eucalyptus paniculata Sm., fam. Myrtaceae | 1.2% | |
| Eucalyptus sideroxylon (Uruguay) | Eucalyptus sideroxylon Sm., fam. Myrtaceae | 2.0% | |
| Eucalyptus maculata (Uruguay) | Eucalyptus maculata Hook., fam. Myrtaceae | 0.5% | |
| Eucalyptus amplifolia (Uruguay) | Eucalyptus amplifolia Naud., fam. Myrtaceae | 0.5% | |
| Cajuput (Vietnam) 2 | 8008-98-8 | Melaleuca cajuputi Powell, var. cajuputi, fam. Myrtaceae | 0.9% |
| Lemon (Argentina) 1 | 84929-31-7 | Citrus limon (L.) Burm. f., fam. Rutaceae | 1.63% |
| Mapo tangelo | Citrus ssp. Mapo tangelo, fam. Rutaceae | 1.76% | |
| Mandarin (Italy) 3 | 8008-31-9 | Citrus deliciosa Tenore (C. reticulata Blanco, cv.mandarin), fam. Rutaceae | 1.7% |
| Grapefruit (Italy) 1 | 8016-20-4 | Citrus paradisi Macfayden, fam. Rutaceae | 1.98% |
| Lemon (USA) | 84929-31-7 | Citrus limon (L.) Burm. f., fam. Rutaceae | 1.5% |
| Orange, sweet (USA-Florida) 5 | 8028-48-6 | Citrus sinensis (L.) Osbeck, cultivar Valencia late, fam. Rutaceae | 1.7% |
| Orange, sweet (USA-Florida) 6 | 8028-48-6 | Citrus sinensis (L.) Osbeck, cultivar Valencia late, fam. Rutaceae | 1.5% |
| Nutmeg (West Indies) 1 | 8008-45-5 | Myristica fragrans Houtt., fam. Myristicaceae | 2.95% |
| Buchu leaf | 84649-93-4 | Agathosma betulina (Berg.) Pillans (Barosma betulina Bertl.), fam. Rutacea | 1.0% |
| Thymus riatarum | Thymus riatarum Humbert et Maire, fam. Lamiaceae (Labiatae) | 1.8% | |
| Santolina chamaecyparisus (France) 2 | 84961-58-0 | Santolina chamaecyparisus L., fam. Asteraceae (Compositae) | 15.0% |
| Eucalyptus brassiana | Eucalyptus brassiana S.T. Blake, fam. Myrtaceae | 0.13% | |
| Port Orford Cedarwood | Chamaecyparis lawsoniana (A. Murray) Parl., fam. Cupressaceae | 0.8% | |
| Chamaecyparis pisifera | Chameacyparis pisifera (Sieb. et Zucc.) Endl. var. filifera, Cupressaceae | 3.0% | |
| Calamintha nepeta (Turkey) 1 | Calamintha nepeta (L.) Savi ssp. glandulosa (Req.) P.W.Ball, fam.Lamiaceae | 0.7% | |
| Ziziphora clinopodioides (Turkey) 1 | Ziziphora clinopodioides Lam., fam. Lamiaceae (Labiatae) | 0.4% | |
| Rosemary (Argentina) 1 | 8000-25-7 | Rosmarinus officinalis L., fam. Lamiaceae (Labiatae) | 17.9% |
| Rosemary (Argentina) 2 | 8000-25-7 | Rosmarinus officinalis L., fam. Lamiaceae (Labiatae) | 20.4% |
| Guava leaf 1 | 91770-12-6 | Psidium guajava L., fam. Myrtaceae | 0.4% |
| Acinos suaveolens (Turkey) | Acinos suaveolens (Sibt. et Smith) G. Don f., fam. Lamiaceae (Labiatae) | 0.27% | |
| Micromyrtus striata | Micromyrtus striata J.W. Green (M. ciliata (Sm) Druce), fam. Myrtaceae | 0.1% | |
| Populus deltoides | Populus deltoides Bartr. (P. deltoides Marsh.), fam. Salicaceae | 0.1% | |
| Ziziphora clinopodioides (Turkey) 2 | Ziziphora clinopodioides Lam., fam. Lamiaceae (Labiatae) | 0.82% | |
| Lemon (USA-California) | 84929-31-7 | Citrus limon (L.) Burm. f., fam. Rutaceae | 1.58% |
| Lemon (Italy-Sicily) 8 | 84929-31-7 | Citrus limon (L.) Burm. f., fam. Rutaceae | 1.61% |
| Seafennel (Portugal) 1a hydrodistilled | 89997-98-8 | Crithmum maritimum L., fam. Apiaceae (Umbelliferae) | 1.4% |
| Seafennel (Portugal) 1b vacuum extracted | 89997-98-8 | Crithmum maritimum L., fam. Apiaceae (Umbelliferae) | 1.2% |
| Seafennel (Portugal) 1 | 89997-98-8 | Crithmum maritimum L., fam. Apiaceae (Umbelliferae) | 1.1% |
| Pummelo (Shaddock) (Vietnam) flower | 84696-38-8 | Citrus maxima (J. Burman) Merrill. (C. grandis (L.) Osbeck), fam. Rutaceae | 3.9% |
| Satureja grandiflora (France) | Satureja grandiflora (L.) Scheele (Calamintha g. (L.) Moench), Lamiaceae | 0.1% | |
| Cypress cones (Greece) | 8013-86-3 | Cupressus sempervirens L. (C. fastigiata DC), fam. Cupressaceae | 2.4% |
| Satureja cuneifolia (Turkey) | Satureja cuneifolia Ten. (S. pisidica Wettst.), fam. Lamiaceae (Labiatae) | 2.49% | |
| Spilanthes acmella | Spilanthes acmella Murr., fam. Asteraceae (Compositae) | 2.2% | |
| Etrog, leaf | Citrus medica L., cultivar ethrog Engl., fam. Rutaceae | 0.95% | |
| Savory, summer (Italy) 3 | 8016-68-0 | Satureja hortensis L., fam. Lamiaceae (Labiatae) | 2.83% |
| Savory, summer (Finland) | 8016-68-0 | Satureja hortensis L., fam. Lamiaceae (Labiatae) | 1.4% |
| Savory, winter (Croatia) 1 | 90106-57-3 | Satureja montana L., fam. Lamiaceae (Labiatae) | 0.58% |
| Savory, summer (Scotland) | 8016-68-0 | Satureja hortensis L., fam. Lamiaceae (Labiatae) | 2.33% |
| Savory, summer (Italy) 4 | 8016-68-0 | Satureja hortensis L., fam. Lamiaceae (Labiatae) | 1.95% |
| Savory, winter (Italy) 2 | 90106-57-3 | Saturaja montana L., fam. Lamiaceae (Labiatae) | 1.13% |
| Annual wormwood (Mongolia) | 84775-74-6 | Artemisia annua L., fam. Asteraceae (Compositae) | 0.1% |
| Caraway seed (The Netherlands) 2 | 8000-42-8 | Carum carvi L., fam. Apiaceae (Umbelliferae) | 0.39% |
| Caraway seed (Yugoslavia) | 8000-42-8 | Carum carvi L., fam. Apiaceae (Umbelliferae) | 0.18% |
| Grapefruit (Brazil) | 8016-20-4 | Citrus paradisi Macfayden, fam. Rutaceae | 2.23% |
| Grapefruit (Argentina) | 8016-20-4 | Citrus paradisi Macfayden, fam. Rutaceae | 1.88% |
| Grapefruit (Japan) 1 | 8016-20-4 | Citrus paradisi Macfayden, fam. Rutaceae | 1.98% |
| Sage, dalmatian (Canada) | 8022-56-8 | Salvia officinalis L., fam. Lamiaceae (Labiatae) | 1.1% |
| Sage, dalmatian (Dalmatia) 1 | 8022-56-8 | Salvia officinalis L., fam. Lamiaceae (Labiatae) | 1.1% |
| Sage, dalmatian (Italy) 1 | 8022-56-8 | Salvia officinalis L., fam. Lamiaceae (Labiatae) | 1.0% |
| Sage, dalmatian (Finland) | 8022-56-8 | Salvia officinalis L., fam. Lamiaceae (Labiatae) | 0.7% |
| Orange, bitter (Cuba) | 72968-50-4 | Citrus aurantium L., ssp. amara Engl., fam. Rutaceae | 1.7% |
| Orange, bitter (Brazil) | 72968-50-4 | Citrus aurantium L., ssp. amara Engl., fam. Rutaceae | 3.1% |
| Orange, bitter (China) | 72968-50-4 | Citrus aurantium L., ssp. amara Engl., fam. Rutaceae | 1.91% |
| Orange, bitter 2 | 72968-50-4 | Citrus aurantium L., ssp. amara Engl., fam. Rutaceae | 1.92% |
| Orange, bitter 1 | 72968-50-4 | Citrus aurantium L., ssp. amara Engl., fam. Rutaceae | 2.44% |
| Rose (Bulgaria) 2 | 8007-01-0 | Rosa damascena Mill., fam. Rosaceae | 0.09% |
| Lime (Persian) 3 | 90063-52-8 | Citrus latifolia Tanaka, fam. Rutaceae | 2.35% |
| Rose (Egypt) 1 | 8007-01-0 | Rosa damascena Mill., fam. Rosaceae | 0.15% |
| Rose (Turkey) 3 | 8007-01-0 | Rosa damascena Mill., fam. Rosaceae | 0.02% |
| Rose (Kazanlik) | 8007-01-0 | Rosa damascena Mill., fam. Rosaceae | 0.02% |
| Fir needle balsam (Canada) 1 | 8021-28-1 | Abies balsamea (L.) Mill., fam. Pinaceae | 2.3% |
| Pinus sylvestris 1 | 8023-99-2 | Pinus sylvestris L. (Scotch pine), fam. Pinaceae | 1.2% |
| Pinus sylvestris 2 | 8023-99-2 | Pinus sylvestris L. (Scotch pine), fam. Pinaceae | 1.0% |
| Pinus sylvestris 3 | 8023-99-2 | Pinus sylvestris L. (Scotch pine), fam. Pinaceae | 3.1% |
| Pinus sylvestris 4 | 8023-99-2 | Pinus sylvestris L. (Scotch pine), fam. Pinaceae | 3.6% |
| Pinus sylvestris 6 | 8023-99-2 | Pinus sylvestris L. (Scotch pine), fam. Pinaceae | 2.5% |
| Coriander fruit (USA) | 8008-52-4 | Coriandrum sativum L., fam. Apiaceae (Umbelliferae) | 1.95% |
| Coriander fruit 3 | 8008-52-4 | Coriandrum sativum L., fam. Apiaceae (Umbelliferae) | 0.52% |
| Cilantro (Coriander leaf) 2 | 8008-52-4 | Coriandrum sativum L., fam. Apiaceae (Umbelliferae) | 0.2% |
| Mandarin (Argentina) 2 | 8008-31-9 | Citrus deliciosa Tenore (C. reticulata Blanco, cv.mandarin), fam. Rutaceae | 1.79% |
| Mandarin (Brazil) | 8008-31-9 | Citrus deliciosa Tenore (C. reticulata Blanco, cv.mandarin), fam. Rutaceae | 2.07% |
| Mandarin (Italy) 5 | 8008-31-9 | Citrus deliciosa Tenore (C. reticulata Blanco, cv.mandarin), fam. Rutaceae | 1.73% |
| Mandarin 2 | 8008-31-9 | Citrus deliciosa Tenore (C. reticulata Blanco, cv.mandarin), fam. Rutaceae | 1.98% |
| Orange, sweet (Portugal) | 8028-48-6 | Citrus sinensis (L.) Osbeck, fam. Rutaceae | 1.33% |
| Orange, sweet (Argentina) | 8028-48-6 | Citrus sinensis (L.) Osbeck, fam. Rutaceae | 1.71% |
| Orange, sweet (Italy) 1 | 8028-48-6 | Citrus sinensis (L.) Osbeck, fam. Rutaceae | 1.72% |
| Orange, sweet (China) 1, Wenzhou | 8028-48-6 | Citrus sinensis (L.) Osbeck, Wenzhou honey orange, fam. Rutaceae | 1.79% |
| Orange, sweet (China) 2 | 8028-48-6 | Citrus sinensis (L.) Osbeck, fam. Rutaceae | 0.96% |
| Cedarleaf 5 | 8000-27-9 | Thuja occidentalis L., fam. Taxodiaceae | 0.93% |
| Nutmeg (Indonesia) 1 | 8008-45-5 | Myristica fragrans Houtt., fam. Myristicaceae | 4.0% |
| Nutmeg (Sri Lanka) 2 | 8008-45-5 | Myristica fragrans Houtt., fam. Myristicaceae | 2.1% |
| Nutmeg (Indonesia) 4 | 8008-45-5 | Myristica fragrans Houtt., fam. Myristicaceae | 2.25% |
| Nutmeg (Indonesia) 2 | 8008-45-5 | Myristica fragrans Houtt., fam. Myristicaceae | 2.4% |
| Nutmeg (Sri Lanka) 4 | 8008-45-5 | Myristica fragrans Houtt., fam. Myristicaceae | 2.05% |
| Bitter orange leaf 2 (Petitgrain) | 8014-17-3 | Citrus aurantium L., ssp. amara Engl., fam. Rutaceae | 1.96% |
| Mandarin leaf (Petitgrain mandarin.) (Japan) | Citrus reticulata Blanco (C. deliciosa Tenore), fam. Rutaceae | 2.2% | |
| Nutmeg (West Indies) 3 | 8008-45-5 | Myristica fragrans Houtt., fam. Myristicaceae | 2.2% |
| Orange, bitter (Italy) | 72968-50-4 | Citrus aurantium L., ssp. amara Engl., fam. Rutaceae | 1.77% |
| Lavandin (Italy) 1 (Grosso) | 8022-15-9 | Lavandula x hybrida Rev. (L. x intermedia Emeric ex Loiseleur), Lamiaceae | 0.95% |
| Peppermint (Italy) 8 | 8006-90-4 | Mentha piperita L., fam. Lamiaceae (Labiatae) | 0.2% |
| Fennel, bitter (Italy) 2 | 8006-84-6 | Foeniculum vulgare Miller, var. vulgare DC, fam. Apiaceae (Umbelliferae) | 0.17% |
| Fennel, sweet (Italy) 2 | 8006-84-6 | Foeniculum vulgare Miller, var. dulce DC, fam. Apiaceae (Umbelliferae) | 0.17% |
| Santolina neapolitana (Italy) | Santolina neapolitana Jordan et Fourr., fam. Asteraceae (Compositae) | 0.8% | |
| Tamarind 2 | Tamarindus indica L., fam. Leguminosae | 0.05% | |
| Niaouli (Madagascar) 3 | Melaleuca quinquenervia (Cav.) S.T. Blake, fam. Myrtaceae | 0.33% | |
| Hyssop (Bulgaria) | 8006-83-5 | Hyssopus officinalis L. ssp officinalis, fam. Lamiaceae (Labiatae) | 3.0% |
| Bergamot (Italy, Calabria) 1 | 8007-75-8 | Citrus bergamia Risso et Poiteau, fam. Rutaceae | 2.94% |
| Bergamot (Italy, Calabria) 2 | 8007-75-8 | Citrus bergamia Risso et Poiteau, fam. Rutaceae | 0.78% |
| Ajowan 1 | Trachyspermum copticum (L.) Link., fam. Apiaceae (Umbelliferae) | 0.31% | |
| Cinnamon leaf (Sri Lanka) | 8007-80-5 | Cinnamomum zeylanicum Blume (C. verum L. Presl), fam. Lauraceae | 0.01% |
| Caraway seed 2 | 8000-42-8 | Carum carvi L., fam. Apiaceae (Umbelliferae) | 0.46% |
| Citronella ceylon 3 | 8000-29-1 | Cymbopogon nardus (L.) Rendle, fam. Poaceae (Gramineae) | 0.87% |
| Dill seed 2 | 8006-75-5 | Anethum graveolens L., fam. Apiaceae (Umbelliferae) | 0.96% |
| Eucalyptus globulus 1 | 8016-26-0 | Eucalyptus globulus Labill., fam. Myrtaceae | 0.02% |
| Eucalyptus globulus (Burundi) | 8016-26-0 | Eucalyptus globulus Labill., fam. Myrtaceae | 0.3% |
| Eucalyptus maidenii (Burundi) | Eucalyptus maidenii F. Muell., fam. Myrtaceae | 0.7% | |
| Fennel, bitter (Hungary) | 8006-84-6 | Foeniculum vulgare Miller, var. vulgare DC, fam. Apiaceae (Umbelliferae) | 1.8% |
| Fennel, bitter (Spain) 1 | 8006-84-6 | Foeniculum vulgare Miller, var. vulgare DC, fam. Apiaceae (Umbelliferae) | 3.13% |
| Fennel, sweet 2 | 8006-84-6 | Foeniculum vulgare Miller, var. dulce DC, fam. Apiaceae (Umbelliferae) | 0.87% |
| Geranium 1 | 8000-46-2 | Pelargonium graveolens L'Herit. ex Aiton, fam. Geraniaceae | 0.3% |
| Juniper berry 2 | 8012-91-7 | Juniperus communis L., fam. Cupressaceae | 2.67% |
| Origanum solymicum (Turkey) | Origanum solymicum P.H. Davis, fam. Lamiaceae (Labiatae) | 0.74% | |
| Lavender (France) 1 | 8000-28-0 | Lavandula angustifolia Mill. (L. officinalis Chaix), fam. Lamiaceae | 0.29% |
| Lemon (Italy-Sicily) 1 | 84929-31-7 | Citrus limon (L.) Burm. f., fam. Rutaceae | 1.39% |
| Mandarin 1 | 8008-31-9 | Citrus deliciosa Tenore (C. reticulata Blanco, cv.mandarin), fam. Rutaceae | 1.62% |
| Cornmint (Mentha arvensis) (Brazil) 1 | 68917-18-0 | Mentha arvensis (L.) var. piperascens Malinv., fam. Lamiaceae (Labiatae) | 1.43% |
| Cornmint (Mentha arvensis) (Japan) 1 | 68917-18-0 | Mentha arvensis (L.) var. piperascens Malinv., fam. Lamiaceae (Labiatae) | 0.85% |
| Cornmint (Mentha arvensis) (China) 1 | 68917-18-0 | Mentha arvensis (L.) var. piperascens Malinv., fam. Lamiaceae (Labiatae) | 2.1% |
| Parsley seed 2 | 8000-68-8 | Petroselinum crispum (Miller) A.W. Hill (P. sativum Hoffm.), fam. Apiaceae | 0.11% |
| Peppermint (USA) 4 | 8006-90-4 | Mentha piperita L. cultivar Kennewick, fam. Lamiaceae (Labiatae) | 0.41% |
| Peppermint (USA) 5 | 8006-90-4 | Mentha piperita L. cultivar Michigan, fam. Lamiaceae (Labiatae) | 0.33% |
| Peppermint (Bulgaria) 1 | 8006-90-4 | Mentha piperita L., fam. Lamiaceae (Labiatae) | 0.41% |
| Abies sibirica 1 | Abies sibirica Ledeb., fam. Pinaceae | 0.11% | |
| Rosemary (Spain) 1 | 8000-25-7 | Rosmarinus officinalis L., fam. Lamiaceae (Labiatae) | 1.71% |
| Rosemary (Spain) 2 | 8000-25-7 | Rosmarinus officinalis L., fam. Lamiaceae (Labiatae) | 2.48% |
| Sage, dalmatian 1 | 8022-56-8 | Salvia officinalis L., fam. Lamiaceae (Labiatae) | 1.14% |
| Sage, spanish (Spain) 2 | 8016-65-7 | Salvia lavandulaefolia Vahl., fam. Lamiaceae (Labiatae) | 1.34% |
| Clary sage (France) 1 | 8016-63-5 | Salvia sclarea L., fam. Lamiaceae (Labiatae) | 0.2% |
| Sassafras 2 | 8006-80-2 | Sassafras albidum (Nutt.) Nees, fam. Lauraceae | 0.03% |
| Star anise (China) 2 | 8007-70-3 | Illicium verum Hooker fil., fam. Magnoliaceae (Illiciaceae) | 0.08% |
| Thyme 2 | 8007-46-3 | Thymus vulgaris L., fam. Lamiaceae (Labiatae) | 0.79% |
| Fennel, pepper (France) | Foeniculum vulgare Miller, ssp. piperitum, fam. Apiaceae (Umbelliferae) | 0.85% | |
| Artemisia roxburghiana (Himalaya) | Artemisia roxburghiana Wall. ex Bies, var. hypolenca, fam. Asteraceae | 0.01% | |
| Sage, dalmatian (Bulgaria) | 8022-56-8 | Salvia officinalis L., fam. Lamiaceae (Labiatae) | 0.9% |
| Satureja boliviana (Peru) 1 | Satureja boliviana Briq. (Micromeria boliviana Benth.), fam. Lamiaceae | 0.05% | |
| Myrtle leaf (Yugoslavia) 1 | 8008-46-6 | Myrtus communis L., fam. Myrtaceae | 0.27% |
| Myrtle leaf (Lebanon) | 8008-46-6 | Myrtus communis L., fam. Myrtaceae | 0.29% |
| Myrtle leaf (France) 1 | 8008-46-6 | Myrtus communis L., fam. Myrtaceae | 0.3% |
| Citronella java (Brazil) 1 | 8000-29-1 | Cymbopogon winterianus Jowitt., fam. Poaceae (Gramineae) | 0.5% |
| Genet headspace 2 | 8023-80-1 | Spartium junceum L., fam. Leguminosae (Papilionaceae) | 2.4% |
| Michelia balansae flower headspace (China) | Michelia balansae (A. DC.) Dandy, fam. Magnoliaceae | 0.1% | |
| Illicium simonsii fruit (China) | Illicium simonsii Maxim., fam. Magnoliaceae (Illiciaceae) | 9.89% | |
| Cinnamomum camphora (China) 1b | Cinnamomum camphora (L.) Nees et Ebermaier, fam. Lauraceae | 0.93% | |
| Cinnamomum camphora (China) 1c | Cinnamomum camphora (L.) Nees et Ebermaier, fam. Lauraceae | 0.1% | |
| Cinnamomum parthenoxylum (China) 1a | Cinnamomum parthenoxylum (Jack) Nees, fam. Lauraceae | 1.23% | |
| Cinnamomum parthenoxylum (China) 1b | Cinnamomum parthenoxylum (Jack) Nees, fam. Lauraceae | 0.24% | |
| Cinnamomum parthenoxylum (China) 1c | Cinnamomum parthenoxylum (Jack) Nees, fam. Lauraceae | 1.28% | |
| Cinnamomum parthenoxylum (China) 1d | Cinnamomum parthenoxylum (Jack) Nees, fam. Lauraceae | 0.35% | |
| Cinnamomum parthenoxylum (China) 1e | Cinnamomum parthenoxylum (Jack) Nees, fam. Lauraceae | 0.98% | |
| Cinnamomum parthenoxylum (China) 1f | Cinnamomum parthenoxylum (Jack) Nees, fam. Lauraceae | 1.28% | |
| Cinnamomum parthenoxylum (China) 1g | Cinnamomum parthenoxylum (Jack) Nees, fam. Lauraceae | 0.1% | |
| Cinnamomum platyphyllum (China) | Cinnamomum platyphyllum (Diels) Allen, fam. Lauraceae | 0.05% | |
| Cajuput (China) | 8008-98-8 | Melaleuca cajuputi Powell, var. cajuputi, fam. Myrtaceae | 0.62% |
| Pimento (Allspice) (Cuba) 1 (berry) | 8006-77-7 | Pimenta dioica (L.) Merr. (P. officinalis Lindl.), fam. Myrtaceae | 0.2% |
| Pimento (Allspice) (Jamaica) 3 | 8006-77-7 | Pimenta dioica (L.) Merr. (P. officinalis Lindl.), fam. Myrtaceae | 0.12% |
| Sage, spanish (Italy) | 8016-65-7 | Salvia lavandulaefolia Vahl., fam. Lamiaceae (Labiatae) | 0.56% |
| Sage, dalmatian (Argentina) | 8022-56-8 | Salvia officinalis L., fam. Lamiaceae (Labiatae) | 1.2% |
| Eucalyptus globulus (Algeria) 1 | 8016-26-0 | Eucalyptus globulus Labill., fam. Myrtaceae | 0.01% |
| Eucalyptus globulus (Portugal) 1 | 8016-26-0 | Eucalyptus globulus Labill., fam. Myrtaceae | 0.3% |
| Neocinnamomum delavayi | Neocinnamomum delavayi (L. Lec.) Liou, fam. Lauraceae | 2.5% | |
| Acronychia oligophlebia (China) | Acronychia oligophlebia Merr., fam. Rutaceae | 2.86% | |
| Clausena dunniana (China) 1 | Clausena dunniana Levl., fam. Rutaceae | 0.1% | |
| Clausena dunniana (China) 2 | Clausena dunniana Levl., fam. Rutaceae | 23.4% | |
| Jasmine rose flower headspace (China) 1 | Gardenia jasminoides Ellis, fam. Rubiaceae | 0.07% | |
| Mentha haplocalyx (China) | Mentha haplocalyx Briq., fam. Lamiaceae (Labiatae) | 0.31% | |
| Amomum tsao-ko (China) 2 | Amomum tsao-ko Crevost et Lemiare, fam. Zingiberaceae | 0.26% | |
| Hedychium coronarium flower headspace (China) | Hedychium coronarium Koenig, fam. Zingiberaceae | 1.42% | |
| Dendrobium chrysatoxum flower (China) | Dendrobium chrysatoxum Lindl., fam. Orchidaceae | 0.14% | |
| Zanthoxylum avicennae (China) | Zanthoxylum avicennae (Lam.) DC., fam. Rutaceae | 2.6% | |
| Zanthoxylum piasezkii (China) | Zanthoxylum piasezkii Maxim., fam. Rutaceae | 2.6% | |
| Zanthoxylum bungeanum (China) | Zanthoxylum bungeanum Maxim., fam. Rutaceae | 0.56% | |
| Zanthoxylum rhetsoides (China) | Zanthoxylum rhetsoides Drake, fam. Rutaceae | 9.75% | |
| Aglaia odorata flower (China) | Aglaia odorata Lour., fam. Meliaceae | 0.1% | |
| Artemisia moorcroftiana | Artemisia moorcroftiana, fam. Asteraceae (Compositae) | 0.34% | |
| Lemon (Vietnam) | 84929-31-7 | Citrus limon (L.) Burm. f., fam. Rutaceae | 1.6% |
| Zanthoxylum nitidum (Vietnam) | Zanthoxylum nitidum DC., fam Rutaceae | 2.57% | |
| Murraya glaba (Vietnam) | Murraya glaba Guill., fam. Rutaceae | 3.43% | |
| Ajowan (India) 1a steamdistilled | Trachyspermum copticum (L.) Link., fam. Apiaceae (Umbelliferae) | 0.26% | |
| Ajowan (India) 1b CO2-extract | Trachyspermum copticum (L.) Link., fam. Apiaceae (Umbelliferae) | 0.24% | |
| Costus | 8023-88-9 | Saussurea lappa Clarke, fam. Zingiberaceae | 0.5% |
| Lepechinia floribunda | Lepechinia floribunda (Benth.) Epl. (Salvia morada), fam. Lamiaceae | 0.2% | |
| Terminalia bentzoe | Terminalia bentzoe (L.) L.f.ssp.rodriguesensis Wickens, fam. Combretaceae | 0.22% | |
| Psidium luridum | Psidium luridum (Spreng.) Burr., fam. Myrtaceae | 1.07% | |
| Psidium incanum | Psidium incanum (Berg.) Burr., fam. Myrtaceae | 0.44% | |
| Coreopsis barteri leaf (Cameroon) | Coreopsis barteri Oliv. & Hiern, fam. Asteraceae (Compositae) | 0.4% | |
| Coreopsis grandiflora leaf (Cameroon) | Coreopsis grandiflora Hogg ex Sweet, fam. Asteraceae (Compositae) | 11.7% | |
| Heterotheca inuloides leaf (Mexico) | Heterotheca inuloides Cass., fam. Asteraceae (Compositae) | 6.61% | |
| Naoshichi (Japan) | Citrus taguma-sudachi Hort. ex Tanaka, fam. Rutaceae | 1.8% | |
| Lime (Persian) (Japan) | Citrus latifolia Tanaka, fam. Rutaceae | 1.3% | |
| Lippia multiflora leaf (Central African Repl.) | Lippia multiflora s.l. Moldenke, fam. Verbenaceae | 11.3% | |
| Pepper, black (India) 2 | 8006-82-4 | Piper nigrum L., fam. Piperaceae | 6.3% |
| Pepper, green (India) | 8006-82-4 | Piper nigrum L., fam. Piperaceae | 6.1% |
| Minthostachys spicata | Minthostachys spicata (Benth.) Epl., fam Lamiaceae (Labiatae) | 0.3% | |
| Artemisia umbelliformis (Italy) | Artemisia umbelliformis Lam., fam. Asteraceae (Compositae) | 0.01% | |
| Artemisia campestris (Italy) 1 | Artemisia campestris L. ssp. borealis (Pallas), H.M. Hall et Clements | 0.01% | |
| Artemisia genipi (Italy) | Artemisia genipi Weber, fam. Asteraceae (Compositae) | 0.01% | |
| Artemisia petrosa (Italy) | Artemisia petrosa Baumg. ssp. eriantha Ten., fam. Asteraceae (Compositae) | 0.01% | |
| Artemisia vallesiaca (Italy) | Artemisia vallesiaca All., fam. Asteraceae (Compositae) | 0.01% | |
| Wormwood (Mugwort) (Italy) 2 | 8008-93-3 | Artemisia absinthium L., fam. Asteraceae (Compositae) | 0.01% |
| Artemisia chamaemelifolia (Italy) | Artemisia chamaemelifolia Vill., fam. Asteraceae (Compositae) | 0.01% | |
| Artemisia glacialis (Italy) | Artemisia glacialis L., fam. Asteraceae (Compositae) | 0.01% | |
| Artemisia campestris (Italy) 2 | Artemisia campestris L. ssp. campestris, fam. Asteraceae (Compositae) | 0.3% | |
| Artemisia alba (Italy) | 84775-75-7 | Artemisia alba Turra, fam. Asteraceae (Compositae) | 0.01% |
| Artemisia abrotanum (Italy) | Artemisia abrotanum L., fam. Asteraceae (Compositae) | 0.01% | |
| Annual wormwood (Italy) | Artemisia annua L., fam. Asteraceae (Compositae) | 1.4% | |
| Artemisia verlotiorum (Italy) | Artemisia verlotiorum Lamotte, fam. Asteraceae (Compositae) | 3.8% | |
| Armoise (Italy) | 8008-93-3 | Artemisia vulgaris L., fam. Asteraceae (Compositae) | 0.1% |
| Alpinia speciosa leaf (Egypt) | Alipinia speciosa (J.C. Wendl.) K. Schum., fam. Zingiberaceae | 1.5% | |
| Alpinia speciosa rhizome (Egypt) | Alpinia speciosa (J.C. Wendl.) K.Schum., fam. Zingiberaceae | 1.0% | |
| Alpinia speciosa stem (Egypt) | Alpinia speciosa (J.C. Wendl.) K.Schum., fam. Zingiberaceae | 1.8% | |
| Salvia syriaca (Turkey) | Salvia syriaca L., fam. Lamiaceae (Labiatea) | 0.15% | |
| Oregano, greek (India) | 84012-24-8 | Origanum vulgare L., fam. Lamiaceae (Labiatae) | 18.09% |
| Bouea macrophylla fruit (Malaysia) | Bouea macrophylla Grif. (B. gandaria Blume x Miq., fam. Anacardiaceae | 0.32% | |
| Coriander fruit (Cuba) | 8008-32-4 | Coriandrum sativum L., fam. Apiaceae (Umbelliferae) | 0.65% |
| Mentha longifolia (Lithuania) | 90063-99-3 | Mentha longifolia (L.) Hudson, fam. Lamiaceae (Labiatae) | 10.02% |
| Citron (Vietnam) peel 1a | Citrus medica L., cultivar sarcodactylis (Noot.) Swingle, fam. Rutaceae | 1.2% | |
| Citron (Vietnam) peel 1b | Citrus medica L., cultivar sarcodactylis (Noot.) Swingle, fam. Rutaceae | 1.5% | |
| Persea podadenia leaf | Persea podadenia Blake, subgenus Eriodaphne, fam. Lauraceae | 10.0% | |
| Satureja spicigera (Turkey) | Satureja spicigera (C. Koch) Boiss., fam. Lamiaceae (Labiatae) | 1.5% | |
| Scleria striatinux rhizome (Cameroon) | Scleria striatinux De Wild., fam. Cyperaceae | 0.2% | |
| Niaouli (Benin) 1a | Melaleuca quinquenervia (Cav.) S.T. Blake, fam. Myrtaceae | 0.35% | |
| Niaouli (Benin) 1b | Melaleuca quinquenervia (Cav.) S.T. Blake, fam. Myrtaceae | 0.17% | |
| Schinus molle leaf (Uruguay) | Schinus molle L., fam. Anacardiaceae | 5.46% | |
| Schinus lentiscifolius leaf (Uruguay) | Schinus lentiscifolius (L.) March, fam. Anacardiaceae | 1.58% | |
| Thymus pulegioides (Italy) | Thymus pulegioides L., fam. Lamiaceae (Labiatae) | 0.7% | |
| Bitter orange leaf (Petitgrain) (Italy) 1 | 8014-17-3 | Citrus aurantium L., ssp. amara Engl., fam. Rutaceae | 0.9% |
| Mandarin leaf (Petitgrain mandarin.) (Italy) | Citrus reticulata Blanco (C. deliciosa Tenore), fam. Rutaceae | 0.7% | |
| Lemon leaf (petitgrain) (Italy) 4 | 84929-31-7 | Citrus limon (L.) Burm. f., fam. Rutaceae | 1.2% |
| Orange leaf, sweet (Italy) 1 | Citrus sinensis (L.) Osbeck, fam. Rutaceae | 3.25% | |
| Orange leaf, sweet (Italy) 2a Valencia Late | Citrus sinensis (L.) Osbeck, cultivar Valencia late, fam. Rutaceae | 3.49% | |
| Orange leaf, sweet (Italy) 2b Biondo Comune | Citrus sinensis (L.) Osbeck, cultivar Biondo Comune, fam. Rutaceae | 4.4% | |
| Orange leaf, sweet (Italy) 2c Moro | Citrus sinensis (L.) Osbeck, cultivar Moro, fam. Rutaceae | 3.72% | |
| Caraway seed (Israel) | 800O-42-8 | Carum carvi L., fam. Apiaceae (Umbelliferae) | 0.35% |
| Caraway seed (France) | 8000-42-8 | Carum carvi L., fam. Apiaceae (Umbelliferae) | 0.3% |
| Thymus serpyllum (Canada) ssp. chamaedrys | Thymus serpyllum L., ssp. chamaedrys (Fries) Vollm., fam. Lamiaceae | 0.8% | |
| Thymus serpyllum (Finland) | Thymus serpyllum L. x vulgaris L., fam. Lamiaceae (Labiatae) | 39.1% | |
| Keora (India) 4 | Pandanus odoratissimus L. (P. fascicularis Lam.), fam. Pandanaceae | 0.12% | |
| Keora (India) 2 | Pandanus odoratissimus L. (P. fascicularis Lam.), fam. Pandanaceae | 0.25% | |
| Citronella ceylon (Zimbabwe) | Cymbopogon nardus (L.) Rendle, fam. Poaceae (Gramineae) | 1.45% | |
| Celery seed 3a | 8015-90-5 | Apium graveolens L., fam. Apiaceae (Umbelliferae) | 0.91% |
| Celery seed (China) 3a | 8015-90-5 | Apium graveolens L., fam. Apiaceae (Umbelliferae) | 4.38% |
| Celery seed (China) 3b | 8015-90-5 | Apium graveolens L., fam. Apiaceae (Umbelliferae) | 0.97% |
| Lemongrass (India) 4 | 8007-02-1 | Cymbopogon citratus (DC) Stapf (C. flexuosus), fam. Poaceae (Gramineae) | 0.01% |
| Lemongrass (Bhuta) | 8007-02-1 | Cymbopogon citratus (DC) Stapf (C. flexuosus), fam. Poaceae (Gramineae) | 10.3% |
| Lemongrass (India) 5 | 8007-02-1 | Cymbopogon citratus (DC) Stapf (C. flexuosus), fam. Poaceae (Gramineae) | 0.1% |
| Jammu lemongrass (India) 2 | Cymbopogon pendulus L., fam. Poaceae (Gramineae) | 0.13% | |
| Lemongrass (Cameroon) | 8007-02-1 | Cymbopogon citratus (DC) Stapf (C. flexuosus), fam. Poaceae (Gramineae) | 12.8% |
| Tagetes (Cameroon) 1a leaf | 8016-84-0 | Tagetes minuta L. (Marigold), fam. Asteraceae (Compositae) | 0.01% |
| Tagetes (Cameroon) 1b flower | 8016-84-0 | Tagetes minuta L. (Marigold), fam. Asteraceae (Compositae) | 0.01% |
| Lemongrass (Ghana) | 8016-84-0 | Cymbopogon citratus (DC) Stapf (C. flexuosus), fam. Poaceae (Gramineae) | 7.3% |
| Lemongrass (Egypt) | 8016-84-0 | Cymbopogon citratus (DC) Stapf (C. flexuosus), fam. Poaceae (Gramineae) | 1.46% |
| Helichrysum italicum 1a | 8023-95-8 | Helichrysum italicum (Roth) G. Don ssp. italicum, fam. Asteraceae | 0.17% |
| Helichrysum italicum 1b | 8023-95-8 | Helichrysum italicum ssp. microphyllum (Willd.) Nyman, fam. Asteraceae | 0.17% |
| Helichrysum italicum (Croatia) 1b | 8023-95-8 | Helichrysum italicum (Roth) G. Don, fam. Asteraceae (Compositae) | 0.11% |
| Helichrysum italicum (Croatia) 1a | 8023-95-8 | Helichrysum italicum (Roth) G. Don, fam. Asteraceae (Compositae) | 0.1% |
| Monodora brevipes seed (Cameroon) | Monodora brevipes Benth., fam. Annonaceae | 5.8% | |
| Annona senegalensis fruit (Cameroon) | Annona senegalensis Pers., fam. Annonaceae | 11.3% | |
| Ylang Ylang fruit (Cameroon) | 8006-81-3 | Cananga odorata (Lamk.) Hook. f. et Thomson, fam. Annonaceae | 24.7% |
| Aframomum citratum (Cameroon) 1 seed | Aframomum citratum (Pereira) K. Schum., fam. Zingiberaceae | 1.5% | |
| Juniper berry (Greece) | 8012-91-7 | Juniperus communis L., fam. Cupressaceae | 13.0% |
| Cinnamomum "Re G—ng" (Vietnam) 1a leaf | Cinnamomum species "Re G—ng", fam. Lauraceae | 0.01% | |
| Cinnamomum "Re G—ng" (Vietnam) 1d root | Cinnamomum species "Re G—ng", fam. Lauraceae | 0.2% | |
| Fitweed seed | Eryngium foetidum L., fam. Apiaceae (Umbelliferae) | 1.11% | |
| Solanum stuckertii flower | Solanum stuckertii Bitter, fam. Solanaceae | 8.05% | |
| Solanum incisum flower | Solanum incisum Griseb., fam. Solanaceae | 4.75% | |
| Ambrosia microcephala | Ambrosia microcephala DC., fam. Asteraceae (Compositae) | 0.3% | |
| Rosmarinus eriocalyx (Algeria) 1 | Rosmarinus eriocalyx Jordan & Fourr., fam. Lamiaceae (Labiatae) | 0.5% | |
| Rosemary (Spain) 8 | 8000-25-7 | Rosmarinus officinalis L., fam. Lamiaceae (Labiatae) | 0.5% |
| Rosemary (Italy) 9 | 8000-25-7 | Rosmarinus officinalis L., fam. Lamiaceae (Labiatae) | 0.6% |
| Pimento (Allspice) (Mexico) 2a | 8006-77-7 | Pimenta dioica (L.) Merr. (P. officinalis Lindl.), fam. Myrtaceae | 17.7% |
| Pimento (Allspice) (Mexico) 2b | 8006-77-7 | Pimenta dioica (L.) Merr. (P. officinalis Lindl.), fam. Myrtaceae | 16.5% |
| Pimento (Allspice) (Mexico) 2c | 8006-77-7 | Pimenta dioica (L.) Merr. (P. officinalis Lindl.), fam. Myrtaceae | 6.0% |
| Clary sage (Italy) 1 | 8016-63-5 | Salvia sclarea L., fam. Lamiaceae (Labiatae) | 1.01% |
| Parsley herb (Cuba) | 8000-68-8 | Petroselinum crispum (Miller) A.W. Hill (P. sativum Hoffm.), fam. Apiaceae | 0.84% |
| Lime (Mexican, West Indian, Key) 5 | 8008-26-2 | Citrus aurantifolia (Christm.) Swingle, fam. Rutaceae | 1.3% |
| Myrtle leaf (France) 2 | 8008-46-6 | Myrtus communis L., fam. Myrtaceae | 0.2% |
| Angelica (norvegica) root | 8015-64-3 | Angelica archangelica L. ssp. archangelica var. norvegica, fam. Apiaceae | 2.9% |
| Angelica root (Brazil) 1a hydrodistilled | 8015-64-3 | Angelica archangelica L., fam. Apiaceae (Umbelliferae) | 11.3% |
| Armoise (France) | 8008-93-3 | Artemisia vulgaris L., fam. Asteraceae (Compositae) | 0.5% |
| Eucalyptus globulus (France) | 8016-26-0 | Eucalyptus globulus Labill., fam. Myrtaceae | 0.5% |
| Juniper leaf (France) | 8012-91-7 | Juniperus communis L., fam. Cupressaceae | 9.6% |
| Lavender (France) 7 | 8000-28-0 | Lavandula angustifolia Mill. (L. officinalis Chaix), fam. Lamiaceae | 0.7% |
| Myrtle leaf (France) 3 | 8008-46-6 | Myrtus communis L., fam. Myrtaceae | 0.5% |
| Oregano, greek (France) 1 | 84012-24-8 | Origanum vulgare L., fam. Lamiaceae (Labiatae) | 1.2% |
| Zanthoxylum zanthoxyloides fruit (Benin) | Zanthoxylum zanthoxyloides Lam. (F. zanthoxyloides Lam.) fam. Rutaceae | 2.3% | |
| Abies alba needle (Serbia) | 8021-27-0 | Abies alba Mill., fam. Pinaceae | 1.1% |
| Abies cephalonica needle (Greece) | Abies cephalonica Loud., fam. Pinaceae | 1.7% | |
| Abies borisii-regis needle (Greece) | Abies borisii-regis Mattf., fam. Pinaceae | 1.2% | |
| Lime (Mexican, West Indian, Key) (India) unripe | 8008-26-2 | Citrus aurantifolia (Christm.) Swingle, fam. Rutaceae | 0.6% |
| Lime (Mexican, West Indian, Key) (India) ripe | 8008-26-2 | Citrus aurantifolia (Christm.) Swingle, fam. Rutaceae | 1.6% |
| Cupressus macrocarpa leaf (Argentina) | Cupressus macrocarpa Hartw., fam. Cupressaceae | 3.7% | |
| Artemisia scoparia (India) 2 | Artemisia scoparia Waldst. et Kit., fam. Asteraceae (Compositae) | 4.0% | |
| Myrtle leaf (Yugoslavia) 2 | 8008-46-6 | Myrtus communis L., fam. Myrtaceae | 0.8% |
| Ocimum gratissimum (Benin) 2 | Ocimum gratissimum L., fam. Lamiaceae (Labiatae) | 5.0% | |
| Curcuma aromatica (India) 2a leaf | Curcuma aromatica Salisb., fam. Zingiberaceae | 0.05% | |
| Curcuma aromatica (India) 2b rhizome | Curcuma aromatica Salisb., fam. Zingiberaceae | 0.2% | |
| Teucrium heterophyllum (Canary Islands) | Teucrium heterophyllum L'Her. (T. canariensis), fam. Lamiaceae (Labiatae) | 0.3% | |
| Tagetes (Zimbabwe) | 8016-84-0 | Tagetes minuta L. (Marigold), fam. Asteraceae (Compositae) | 0.3% |
| Chamomile, german (India) 1 | 8002-66-2 | Chamomilla recutita (L.) Rausch.(Matricaria chamomilla L.), fam.Asteraceae | 0.05% |
| Rosmarinus eriocalyx (Algeria) 2 | Rosmarinus eriocalyx Jordan & Fourr., fam. Lamiaceae (Labiatae) | 1.0% | |
| Rosemary (Algeria) 2 | 8000-25-7 | Rosmarinus officinalis L., fam. Lamiaceae (Labiatae) | 0.01% |
| Wormwood (Mugwort) Spain 2a leaf | 8008-93-3 | Artemisia absinthium L., fam. Asteraceae (Compositae) | 0.5% |
| Wormwood (Mugwort) Spain 2b flowering top | 8008-93-3 | Artemisia absinthium L., fam. Asteraceae (Compositae) | 0.7% |
| Guava fruit (Cuba) | 91770-12-6 | Psidium guajava L., fam. Myrtaceae | 0.1% |
| Pummelo (Shaddock) (India) peel | 84696-38-8 | Citrus maxima (J. Burman) Merrill. (C. grandis (L.) Osbeck), fam. Rutaceae | 2.9% |
| Ravensara aromatica (Finland) | Ravensara aromatica Sonn., fam. Lauraceae | 1.4% | |
| Tagetes patula (India) | Tagetes patula L., fam. Asteraceae (Compositae) | 0.2% | |
| Manuka (New Zealand) 2 | Leptospermum scoparium J.R. et G. Forst., fam. Myrtaceae | 0.4% | |
| Curcuma mangga (Malaysia) | Curcuma mangga Val., fam Zingiberaceae | 81.4% | |
| Curcuma xanthorrhiza (Malaysia) | Curcuma xanthorrhiza Roxb., fam. Zingiberaceae | 0.2% | |
| Curcuma aeruginosa (Malaysia) 2 | Curcuma aeruginosa Roxb., fam. Zingiberaceae | 0.5% | |
| Turmeric (Malaysia) | 8024-37-1 | Curcuma longa L. (C. domestica Val.), fam. Zingiberaceae | 0.2% |
| Eugenia uniflora leaf (Brazil) 2 | Eugenia uniflora L. (E. michelii Lam., E. pitanga (Berg), fam. Myrtaceae | 0.3% | |
| Coleus aromaticus (India) 2 | Coleus aromaticus Benth. (wild oregano), fam. Lamiaceae (Labiatae) | 1.25% | |
| Prangos latiloba (Iran) | Prangos latiloba Korov, fam. Apiaceae (Umbelliferae) | 9.5% | |
| Mandarin (Spain) 2 | 8008-31-9 | Citrus deliciosa Tenore (C. reticulata Blanco, cv.mandarin), fam. Rutaceae | 1.55% |
| Mandarin (Uruguay) 3 | 8008-31-9 | Citrus deliciosa Tenore cv. Nova (C. reticulata Blanco), fam. Rutaceae | 1.95% |
| Mandarin (Japan) 1 | 8008-31-9 | Citrus deliciosa Tenore (C. reticulata Blanco, cv.mandarin), fam. Rutaceae | 1.8% |
| Marjoram, spanish (Spain) 4a | 8016-33-9 | Thymus mastichina L., fam. Lamiaceae (Labiatae) | 1.85% |
| Marjoram, spanish (Spain) 4b | 8016-33-9 | Thymus mastichina L., fam. Lamiaceae (Labiatae) | 0.08% |
| Tansy, moroccan (Morocco) 1 | Tanacetum annuum L., fam. Asteraceae (Compositae) | 4.4% | |
| Tansy, moroccan (Morocco) 2 | Tanacetum annuum L., fam. Asteraceae (Compositae) | 6.0% | |
| Sage, dalmatian (Albany) 3 | 8022-56-8 | Salvia officinalis L., fam. Lamiaceae (Labiatae) | 1.0% |
| Piper plurinervosum | Piper plurinervosum Yuncker, fam. Piperaceae | 0.4% | |
| Rollinia mucosa fruit | Rollinia mucosa (Jacq.) Baill, fam. Annonaceae | 3.0% | |
| Eucalyptus camaldulensis (Nigeria) 1 | Eucalyptus camaldulensis Dehn., var. catharine, fam. Myrtaceae | 0.6% | |
| Mentha longifolia (Iran) 1 | 90063-99-3 | Mentha longifolia (L.) Hudson, fam. Lamiaceae (Labiatae) | 1.9% |
| Manuka (New Zealand) 1 | Leptospermum scoparium J.R. et F. Forst., fam. Myrtaceae | 0.24% | |
| Manuka (Australia) 1b | Leptospermum scoparium J.R. et F. Forst, var. eximium, fam. Myrtaceae | 0.3% | |
| Eucalyptus globulus (Ethiopia) | 8016-26-0 | Eucalyptus globulus Labill., fam. Myrtaceae | 1.6% |
| Sage, spanish 1 | 8016-65-7 | Salvia lavandulaefolia Vahl., fam. Lamiaceae (Labiatae) | 1.8% |
| Eucalyptus globulus 4 | 8016-26-0 | Eucalyptus globulus Labill., fam. Myrtaceae | 0.2% |
| Eucalyptus globulus 3 | 8016-26-0 | Eucalyptus globulus Labill., fam. Myrtaceae | 0.43% |
| Eucalyptus globulus (Zambia) | 8016-26-0 | Eucalyptus globulus Labill., fam. Myrtaceae | 0.7% |
| Licaria salicifolia | Licaria salicifolia (Sw.) Kosterm., fam. Lauraceae | 1.0% | |
| Mentha longifolia (Iran) 2 | 90063-99-3 | Mentha longifolia (L.) Hudson, fam. Lamiaceae (Labiatae) | 0.1% |
| Helichrysum hypnoides (Madagascar) 2 | Helichrysum hypnoides (DC.) R.Vig. et Humbert, fam.Asteraceae (Compositae) | 1.2% | |
| Calamintha vardarensis | Calamintha vardarensis (Greuter et Burdet) Silic, fam.Lamiaceae (Labiatae) | 0.2% | |
| Siparuna guianensis stem wood | Siparuna guianensis Aublet, fam. Monimiaceae | 1.1% | |
| Rosemary (Portugal) 2 | 8000-25-7 | Rosmarinus officinalis L., fam. Lamiaceae (Labiatae) | 25.0% |
| Salvia pomifera | Salvia pomifera L. ssp. calycina (Sm.) Hayek, fam. Lamiaceae (Labiatae) | 5.7% | |
| Aframomum citratum (Cameroon) 2a leaf | Aframomum citratum (Pereira) K. Schum., fam. Zingiberaceae | 0.1% | |
| Aframomum citratum (Cameroon) 2b seed | Aframomum citratum (Pereira) K. Schum., fam. Zingiberaceae | 1.5% | |
| Plectranthus barbatus (Brazil) 2a leaf | Plectranthus barbatus Andr. (Coleus barbatus), fam. Lamiaceae (Labiatae) | 12.3% | |
| Spike lavender (Iran) 1a fresh | 8016-78-2 | Lavandula latifolia Medikus (L. spica D.C.), fam. Lamiaceae (Labiatae) | 1.3% |
| Spike lavender (Iran) 1b dry | 8016-78-2 | Lavandula latifolia Medikus (L. spica D.C.), fam. Lamiaceae (Labiatae) | 1.4% |
| Oregano, spanish (Israel) 4 | 8007-11-2 | Coridothymus capitatus Rchb. (Thymus capitatus Hoffm. et Link.), Lamiaceae | 0.8% |
| Mentha longifolia (Iran) 3a flower | 90063-99-3 | Mentha longifolia (L.) Hudson var. asiatica (Boriss.) Rech.f.fam.Lamiaceae | 1.45% |
| Mentha longifolia (Iran) 3b leaf | 90063-99-3 | Mentha longifolia (L.) Hudson var. asiatica (Boriss.) Rech.f.fam.Lamiaceae | 1.07% |
| Echinophora cinerea | Echinophora cinerea (Boiss.) Hedge et Lamond, fam. Apiaceae (Umbelliferae) | 2.6% | |
| Thymus pubescens (Iran) 1 | Thymus pubescens Boiss. et Kotschy ex Celak, fam. Lamiaceae (Labiatae) | 0.4% | |
| Cordia nitida fruit | Cordia nitida Vahl., fam. Borraginaceae | 0.5% | |
| Savory, winter (Bulgaria) | 90106-57-3 | Satureja montana L. ssp. kitaibelii Wierzb., fam. Lamiaceae (Labiatae) | 1.8% |
| Satureja pilosa (Bulgaria) | Satureja pilosa var. pilosa Velen, fam. Lamiaceae (Labiatae) | 2.3% | |
| Artemisia aucheri (Iran) 2 | Artemisia aucheri Boiss., fam. Asteraceae (Compositae) | 3.2% | |
| Salvadora persica root | Salvadora persica L., fam. Salvadoraceae | 0.5% | |
| Cinnamomum aureofulvum leaf | Cinnamomum aureofulvum Gamb., fam. Lauraceae | 0.05% | |
| Cinnamomum aureofulvum bark | Cinnamomum aureofulvum Gamb., fam. Lauraceae | 0.2% | |
| Acinos suaveolens (Greece) 2 | Acinos suaveolens (Sibt. et Smith) G. Don f., fam. Lamiaceae (Labiatae) | 0.5% | |
| Zataria multiflora (Iran) 3 | Zataria multiflora Boiss., fam. Lamiaceae (Labiatae) | 1.6% | |
| Mentha longifolia (Iran) 3 | 90063-99-3 | Mentha longifolia (L.) Hudson, fam. Lamiaceae (Labiatae) | 1.6% |
| Calamintha nepeta (Montenegro) | Calamintha nepeta (L.) Savi ssp. glandulosa (Req.) P.W.Ball, fam.Lamiaceae | 0.4% | |
| Lepechinia salviaefolia (Venezuela) | Lepechinia salviaefolia (Kunth) Epl., fam. Lamiaceae (Labiatae) | 0.9% | |
| Thymus richardii | Thymus richardii Pers. ssp. nitidus (Guss.) Jalas, fam. Lamiaceae (Labiat) | 0.05% | |
| Calamintha nepeta (Greece) 3 | Calamintha nepeta (L.) Savi ssp. glandulosa (Req.) P.W.Ball,fam. Lamiaceae | 0.3% | |
| Baccharis coridifolia | Baccharis coridifolia De Candole, fam. Asteraceae (Compositae) | 0.1% | |
| Protium heptaphyllum 2a leaf | Protium heptaphyllum (Aubl.) March., fam. Burseraceae | 18.6% | |
| Protium heptaphyllum 2b fruit | Protium heptaphyllum (Aubl.) March., fam. Burseraceae | 3.9% | |
| Protium heptaphyllum 2c resin | Protium heptaphyllum (Aubl.) March., fam. Burseraceae | 0.3% | |
| Hypericum dogonbadanicum | Hypericum dogonbadanicum Assadi, fam. Guttiferae (Hypericeae) | 0.4% | |
| Myrrhinium atropurpureum leaf (Brazil) | Myrrhinium atropurpureum Schot, fam. Myrtaceae | 2.1% | |
| Hyptis suaveolens (Mali) | Hyptis suaveolens (L.) Poit., fam. Lamiaceae (Labiatae) | 0.35% | |
| Hyptis spicigera (Mali) | Hyptis spicigera Lam., fam. Lamiaceae (Labiatae) | 0.25% | |
| Guava leaf 4 | Psidium guajava L., fam. Myrtaceae | 0.01% | |
| Plectranthus glandulosus (Cameroon) 2 | Plectranthus glandulosus Hook f., fam. Lamiaceae (Labiatae) | 2.2% | |
| Cinnamon leaf (India) 4 | 8007-80-5 | Cinnamomum zeylanicum Blume (C. verum L. Presl), fam. Lauraceae | 0.09% |
| Cinnamon fruit (India) 2 | 8007-80-5 | Cinnamomum zeylanicum Blume (C. verum L. Presl), fam. Lauraceae | 1.6% |
| Cinnamon leaf (Cameroon) | 8007-80-5 | Cinnamomum zeylanicum Blume (C. verum L. Presl), fam. Lauraceae | 0.1% |
| Cinnamon leaf (Seychelles) | 8007-80-5 | Cinnamomum zeylanicum Blume (C. verum L. Presl), fam. Lauraceae | 0.35% |
| Caraway seed 4a CO2-extract | 8000-42-8 | Carum carvi L., fam. Apiaceae (Umbelliferae) | 0.6% |
| Caraway seed 4b hydrodistilled | 8000-42-8 | Carum carvi L., fam. Apiaceae (Umbelliferae) | 0.4% |
| Marjoram, sweet (Iran) | 8015-01-8 | Majorana hortensis Moench, Origanum majorana L., fam. Lamiaceae (Labiatae) | 2.9% |
| Echinophora cinerea (Iran) | Echinophora cinerea (Boiss.) Hedge et Lamond, fam. Apiaceae (Umbelliferae) | 1.2% | |
| Pepper, black (China) 2 root | 8006-82-4 | Piper nigrum L., fam. Lamiaceae | 0.19% |
| Rosemary (Italy) 14b Lunigiana flower | 8000-25-7 | Rosmarinus officinalis L., fam. Lamiaceae (Labiatae) | 1.6% |
| Rosemary (Italy) 14c Lunigiana stem | 8000-25-7 | Rosmarinus officinalis L., fam. Lamiaceae (Labiatae) | 0.6% |
| Minthostachys mollis (Argentina) | Minthostachys mollis (Kunth.) Grisebach, fam. Lamiaceae (Labiatae) | 0.35% | |
| Eucalyptus citriodora (Congo) | 8008-48-4 | Eucalyptys citriodora Hook. f., fam. Myrtaceae | 0.6% |
| Eucalyptus camaldulensis (Congo) | Eucalyptus camaldulensis Dehn., fam. Myrtaceae | 0.2% | |
| Turmeric (Reunion Island) 1a rhizome | 8024-37-1 | Curcuma longa L. (C. domestica Val.), fam. Zingiberaceae | 0.3% |
| Turmeric (Reunion Island) 1b leaf | 8024-37-1 | Curcuma longa L. (C. domestica Val.), fam. Zingiberaceae | 1.4% |
| Turmeric (Reunion Island) 1c flower | 8024-37-1 | Curcuma longa L. (C. domestica Val.), fam. Zingiberaceae | 2.1% |
| Baga fruit | Annona glabra L., fam. Annonaceae | 47.0% | |
| Soursop, wild fruit | Annona montana Macf., fam. Annonaceae | 0.2% | |
| Eugenia uruguauensis (Brazil) | Eugenia uruguayensis Camb., fam. Myrtaceae | 0.3% | |
| Eugenia umbelliflora (Brazil) | Eugenia umbelliflora O. Berg, fam. Myrtaceae | 0.5% | |
| Myrtle leaf (Croatia) | 8008-46-6 | Myrtus communis L., fam. Myrtaceae | 0.3% |
| Celery seed (India) 5 | 8015-90-5 | Apium graveolens L., fam. Apiaceae (Umbelliferae) | 1.35% |
| Angelica root (Brazil) 1b CO2 extract | 8015-64-3 | Angelica archangelica L., fam. Apiaceae (Umbelliferae) | 7.4% |
| Galbanum stem (Iran) | 9000-24-2 | Ferula galbaniflua Boiss. et Buhse, fam. Apiaceae (Umbelliferae) | 0.6% |
| Galbanum root (Iran) | 9000-24-2 | Ferula galbaniflua Boiss. et Buhse, fam. Apiaceae (Umbelliferae) | 3.7% |
| Ajowan (Iran) aerial part | Trachyspermum copticum (L.) Link., fam. Apiaceae (Umbelliferae) | 1.0% | |
| Ajowan (Iran) seed | Trachyspermum copticum (L.) Link., fam. Apiaceae (Umbelliferae) | 0.7% | |
| Heracleum persicum (Iran) 1a leaf a | Heracleum persicum L., fam. Apiaceae (Umbelliferae) | 1.0% | |
| Heracleum persicum (Iran) 1b leaf b | Heracleum persicum L., fam. Apiaceae (Umbelliferae) | 0.5% | |
| Heracleum persicum (Iran) 1c flower | Heracleum persicum L., fam. Apiaceae (Umbelliferae) | 13.5% | |
| Annual wormwood (India) 2 | 84775-74-6 | Artemisia annua L., fam. Asteraceae (Compositae) | 0.1% |
| Sage, dalmatian (Italy) 9 | 8022-56-8 | Salvia officinalis L., fam. Lamiaceae (Labiatae) | 0.9% |
| Rosemary (Italy) 15 | 8000-25-7 | Rosmarinus officinalis L., fam. Lamiaceae (Labiatae) | 1.2% |
| Oregano, greek (Italy) 4 | 84012-24-8 | Origanum vulgare L., fam. Lamiaceae (Labiatae) | 0.9% |
| Laurel leaf (Italy) 3 | 8006-78-8 | Laurus nobilis L., fam. Lauraceae | 0.6% |
| Coriander fruit (Italy) 4 | 8000-25-7 | Coriandrum sativum L., fam. Apiaceae (Umbelliferae) | 0.9% |
| Thyme (Italy) 10 | 8007-46-3 | Thymus vulgaris L., fam. Lamiaceae (Labiatae) | 0.1% |
| Peppermint (Italy) 11 | 8006-90-4 | Mentha piperita L., fam. Lamiaceae (Labiatae) | 0.6% |
| Lavandin (Italy) 2 | 8022-15-9 | Lavandula x hybrida Rev. (L. x intermedia Emeric ex Loiseleur), Lamiaceae | 0.7% |
| Salvia aucheri (Turkey) 2a leaf | Salvia aucheri Benth. var. canescens Boiss. et Heldr., fam. Lamiaceae | 0.8% | |
| Salvia tomentosa (Turkey) leaf | Salvia tomentosa Mill., fam. Lamiaceae (Labiatae) | 0.8% | |
| Ducrosia anethifolia (Iran) | Ducrosia anethifolia (DC.) Boiss., fam. Apiaceae (Umbelliferae) | 1.9% | |
| Salvia brachyodon (Yugoslavia) | Salvia brachyodon Vandas, fam. Lamiaceae (Labiatae) | 1.5% | |
| Ajuga chamaepitys (Iran) | Ajuga chamaepitys (L.) Schreb., fam. Lauraceae | 1.4% | |
| Pentaceras australe leaf | Pentaceras australe (F. Muell.) Benth., fam. Rutaceae | 0.1% | |
| Thymus persicus (Iran) 1a before flowering | Thymus persicus (Ronniger ex Rech.f.) Jalas, fam. Lamiaceae (Labiatae) | 1.2% | |
| Thymus persicus (Iran) 1b flowering stage | Thymus persicus (Ronniger ex Rech.f.) Jalas, fam. Lamiaceae (Labiatae) | 0.9% | |
| Teucrium melissoides (Iran) | Teucrium melissoides Boiss. et Hauskn. ex Boiss., fam.Lamiaceae (Labiatae) | 1.3% | |
| Lime (Persian) (India) peel | 90063-52-8 | Citrus latifolia Tanaka, fam. Rutaceae | 1.3% |
| Lime (Mexican, West Indian, Key) (India) peel | 8008-26-2 | Citrus aurantifolia (Christm.) Swingle, fam. Rutaceae | 1.5% |
| Lime (hybrid Mexican x Persian) (India) peel | Citrus latifolia Tanaka x Citrus aurantifolia Swingle, fam. Rutaceae | 1.2% | |
| Lime (Mexican, West Indian, Key) (India) leaf | 8008-26-2 | Citrus aurantifolia (Christm.) Swingle, fam. Rutaceae | 1.0% |
| Lime (Persian) (India) leaf | 90063-52-8 | Citrus latifolia Tanaka, fam. Rutaceae | 1.2% |
| Lime (hybrid Mexican x Persian) (India) leaf | Citrus latifolia Tanaka x Citrus aurantifolia Swingle, fam. Rutaceae | 1.0% | |
| Sideritis raeseri (Greece) | Sideritis raeseri Boiss.et Heldr.ssp.attica (Heldr.) Pap.et Kok, Lamiaceae | 1.7% | |
| Seafennel (Turkey) 2 | 89997-98-8 | Crithmum maritimum L., fam. Apiaceae (Umbelliferae) | 1.6% |
| Peppermint (Bulgaria) 4a hydrodistilled | 8006-90-4 | Mentha piperita L. cultivar 'Kliment-63', fam. Lamiaceae (Labiatae) | 0.4% |
| Peppermint (Bulgaria) 4b extracted | 8006-90-4 | Mentha piperita L. cultivar 'Kliment-63', fam. Lamiaceae (Labiatae) | 0.2% |