Copaene
-
Identifiers
CAS number
3856-25-5Molecular formula
C15H24SMILES
CC1=CC[C@H]2[C@H]3[C@@H]1[C@@]2(CC[C@H]3C(C)C)C
Safety labels
Flammable
Irritant
HealthRetention indicies (RI)
- DB5: 1379.0
- Carbowax: 1489.14
-
Odor profile
Fragrance Woody 84.46% Herbal 56.45% Spicy 55.71% Green 40.81% Dry 39.64% Fresh 39.41% Balsamic 39.31% Vetiver 35.09% Amber 33.38% Oily 33.21% Flavor Woody 68.01% Wood 56.67% Herb 49.2% Herbal 44.62% Spice 42.77% Green 39.63% Pine 35.71% Terpene 32.77% Citrus 30.82% Turpentine 30.17% Odor impact est.
Medium -
Properties
XLogP3-AA
4.5pKa est.
9.82 (weak base)Molecular weight
204.35 g/molVapor pressure est.
- hPa @ 20°C
- hPa @ 25°C
Evaporation rate
SlowBoiling point est.
261°CFlash point
- 71.29 ˚C est.
-
Synonyms
- Copaene
- Aglaiene
- 3856-25-5
- (-)-copaene
- UNII-0V56HXQ8N5
- (-)-alpha-Copaene
- 0V56HXQ8N5
- COPAENE [MI]
- EINECS 223-364-4
- COPAENE, .ALPHA.-
- (1R,2S,6S,7S,8S)-1,3-Dimethyl-8-propan-2-yltricyclo[4.4.0.02,7]dec-3-ene
- ALPHA-COPAENE
- a-Copaene (>90%)
- a-copaene
- 8-Isopropyl-1,3-dimethyltricyclo(4.4.0.02,7)dec-3-ene
- .alpha.-Copaene
- TRICYCLO(4.4.0.02,7)DEC-3-ENE, 8-ISOPROPYL-1,3-DIMETHYL-
- (-)-a-Copaene
- (1R,2S,6S,7S,8S)-(-)-8-ISOPROPYL-1,3-DIMETHYLTRICYCLO(4.4.0.02,7)DEC-3-ENE
- (1R,2S,6S,7S,8S)-(-)-8-Isopropyl-1,3-dimethyltricyclo[4.4.0.02,7]dec-3-ene
- (1R,2S,6S,7S,8S)-1,3-Dimethyl-8-(1-methylethyl)tricyclo[4.4.0.02,7]dec-3-ene
- TRICYCLO(4.4.0.02,7)DEC-3-ENE, 1,3-DIMETHYL-8-(1-METHYLETHYL)-, (1R,2S,6S,7S,8S)-
- TRICYCLO(4.4.0.02,7)DEC-3-ENE, 8-ISOPROPYL-1,3-DIMETHYL-, (1R,2S,6S,7S,8S)-(-)-
- 8-isopropyl-1,3-dimethyltricyclo[4.4.0.02,7]dec-3-ene
- DTXSID30873067
- alpha-Copanene
- (1R,2S,6S,7S,8S)-1,3-Dimethyl-8-(1-methylethyl)tricyclo(4.4.0.02,7)dec-3-ene
- (1R,2S,6S,7S,8S)-1,3-dimethyl-8-propan-2-yltricyclo(4.4.0.02,7)dec-3-ene
- I+--Copanene
- (-)-I+--Copaene
- COPAENE, ALPHA-
- 1,3-dimethyl-8-propan-2-yltricyclo(4.4.0.02,7)dec-3-ene
- 1,3-dimethyl-8-propan-2-yltricyclo[4.4.0.02,7]dec-3-ene
- (-)-.ALPHA.-COPAENE
- Tricyclo(4.4.0.0(2,7))dec-3-ene, 1,3-dimethyl-8-(1-methylethyl)-, stereoisomer
- VLXDPFLIRFYIME-BTFPBAQTSA-N
- DTXCID601324318
- HY-122485
- CS-0085720
- 4FB740C8-9DD2-4B6A-A38A-AD843ADB56A5
- Q27237288
-
Applications
Copaene (CAS 3856-25-5) is a sesquiterpene commonly used as a fragrance component and fixative in perfumery to contribute resinous, balsamic notes; it also serves as an odor-active ingredient in cosmetics and household products and is sometimes evaluated as a flavor/aroma ingredient in fragrance formulations. In industrial manufacturing, it can function as a building block or intermediate in fragrance chemistry, enabling the development of related aroma materials. Its use is typically governed by formulation requirements and local regulatory considerations.
-
Solubility @25˚C
Solvent Solubility (g/L) ethanol 91.1 methanol 46.73 isopropanol 106.99 water 0.18 ethyl acetate 244.18 n-propanol 115.38 acetone 222.58 n-butanol 152.53 acetonitrile 139.07 DMF 154.6 toluene 497.8 isobutanol 105.59 1,4-dioxane 572.82 methyl acetate 185.44 THF 1005.36 2-butanone 241.12 n-pentanol 72.44 sec-butanol 87.64 n-hexane 60.41 ethylene glycol 8.2 NMP 187.37 cyclohexane 199.63 DMSO 87.39 n-butyl acetate 405.36 n-octanol 114.69 chloroform 532.33 n-propyl acetate 141.09 acetic acid 51.38 dichloromethane 454.13 cyclohexanone 454.39 propylene glycol 16.87 isopropyl acetate 216.83 DMAc 143.07 2-ethoxyethanol 75.99 isopentanol 142.78 n-heptane 130.31 ethyl formate 115.57 1,2-dichloroethane 289.73 n-hexanol 237.67 2-methoxyethanol 120.71 isobutyl acetate 145.44 tetrachloromethane 135.65 n-pentyl acetate 198.75 transcutol 375.92 n-heptanol 122.87 ethylbenzene 177.82 MIBK 198.8 2-propoxyethanol 236.64 tert-butanol 134.07 MTBE 255.77 2-butoxyethanol 139.45 propionic acid 66.31 o-xylene 232.19 formic acid 8.56 diethyl ether 306.61 m-xylene 321.7 p-xylene 219.74 chlorobenzene 319.04 dimethyl carbonate 84.43 n-octane 43.78 formamide 19.34 cyclopentanone 511.45 2-pentanone 251.13 anisole 228.49 cyclopentyl methyl ether 426.12 gamma-butyrolactone 387.12 1-methoxy-2-propanol 133.12 pyridine 469.21 3-pentanone 198.22 furfural 256.9 n-dodecane 31.93 diethylene glycol 94.58 diisopropyl ether 148.23 tert-amyl alcohol 95.11 acetylacetone 261.6 n-hexadecane 37.78 acetophenone 180.14 methyl propionate 170.07 isopentyl acetate 372.29 trichloroethylene 441.53 n-nonanol 112.5 cyclohexanol 183.74 benzyl alcohol 121.12 2-ethylhexanol 194.23 isooctanol 105.96 dipropyl ether 342.59 1,2-dichlorobenzene 257.51 ethyl lactate 54.12 propylene carbonate 225.0 n-methylformamide 63.54 2-pentanol 107.14 n-pentane 78.79 1-propoxy-2-propanol 227.91 1-methoxy-2-propyl acetate 309.16 2-(2-methoxypropoxy) propanol 155.54 mesitylene 205.51 ε-caprolactone 338.79 p-cymene 201.68 epichlorohydrin 401.97 1,1,1-trichloroethane 320.22 2-aminoethanol 24.5 morpholine-4-carbaldehyde 245.67 sulfolane 249.32 2,2,4-trimethylpentane 38.64 2-methyltetrahydrofuran 560.5 n-hexyl acetate 256.82 isooctane 46.1 2-(2-butoxyethoxy)ethanol 192.86 sec-butyl acetate 134.56 tert-butyl acetate 234.94 decalin 70.15 glycerin 22.72 diglyme 347.63 acrylic acid 45.06 isopropyl myristate 136.8 n-butyric acid 151.85 acetyl acetate 169.79 di(2-ethylhexyl) phthalate 107.63 ethyl propionate 146.68 nitromethane 99.03 1,2-diethoxyethane 290.25 benzonitrile 223.52 trioctyl phosphate 85.72 1-bromopropane 295.44 gamma-valerolactone 438.67 n-decanol 87.5 triethyl phosphate 109.65 4-methyl-2-pentanol 95.71 propionitrile 182.29 vinylene carbonate 208.02 1,1,2-trichlorotrifluoroethane 125.54 DMS 166.19 cumene 122.86 2-octanol 83.99 2-hexanone 159.74 octyl acetate 148.37 limonene 247.59 1,2-dimethoxyethane 228.57 ethyl orthosilicate 118.54 tributyl phosphate 96.59 diacetone alcohol 153.52 N,N-dimethylaniline 148.15 acrylonitrile 151.35 aniline 239.02 1,3-propanediol 62.46 bromobenzene 411.24 dibromomethane 370.46 1,1,2,2-tetrachloroethane 299.04 2-methyl-cyclohexyl acetate 215.06 tetrabutyl urea 117.89 diisobutyl methanol 139.51 2-phenylethanol 220.1 styrene 197.2 dioctyl adipate 148.46 dimethyl sulfate 81.87 ethyl butyrate 260.45 methyl lactate 54.48 butyl lactate 107.59 diethyl carbonate 155.27 propanediol butyl ether 96.76 triethyl orthoformate 195.69 p-tert-butyltoluene 201.59 methyl 4-tert-butylbenzoate 186.66 morpholine 477.18 tert-butylamine 120.58 n-dodecanol 71.27 dimethoxymethane 239.68 ethylene carbonate 195.82 cyrene 120.91 2-ethoxyethyl acetate 229.56 2-ethylhexyl acetate 329.6 1,2,4-trichlorobenzene 271.83 4-methylpyridine 444.61 dibutyl ether 215.71 2,6-dimethyl-4-heptanol 139.51 DEF 187.12 dimethyl isosorbide 315.6 tetrachloroethylene 205.42 eugenol 144.09 triacetin 180.97 span 80 144.72 1,4-butanediol 21.05 1,1-dichloroethane 285.06 2-methyl-1-pentanol 79.73 methyl formate 60.3 2-methyl-1-butanol 114.09 n-decane 55.28 butyronitrile 214.03 3,7-dimethyl-1-octanol 125.88 1-chlorooctane 131.92 1-chlorotetradecane 59.96 n-nonane 53.49 undecane 40.71 tert-butylcyclohexane 60.03 cyclooctane 91.44 cyclopentanol 167.29 tetrahydropyran 715.35 tert-amyl methyl ether 164.2 2,5,8-trioxanonane 237.68 1-hexene 130.02 2-isopropoxyethanol 79.25 2,2,2-trifluoroethanol 23.54 methyl butyrate 159.63 Scent© AI
| Maximum acceptable concentrations in the finished product (%) | |||
|---|---|---|---|
|
Category 1
Products applied to the lips
|
No restriction |
Category 7A
Rinse-off products applied to the hair with some hand contact
|
No restriction |
|
Category 2
Products applied to the axillae
|
No restriction |
Category 7B
Leave-on products applied to the hair with some hand contact
|
No restriction |
|
Category 3
Products applied to the face/body using fingertips
|
No restriction |
Category 8
Products with significant anogenital exposure
|
No restriction |
|
Category 4
Products related to fine fragrance
|
No restriction |
Category 9
Products with body and hand exposure, primarily rinse off
|
No restriction |
|
Category 5A
Body lotion products applied to the body using the hands (palms), primarily leave on
|
No restriction |
Category 10A
Household care products with mostly hand contact
|
No restriction |
|
Category 5B
Face moisturizer products applied to the face using the hands (palms), primarily leave on
|
No restriction |
Category 10B
Household care products with mostly hand contact, including aerosol/spray products (with potential leave-on skin contact)
|
No restriction |
|
Category 5C
Hand cream products applied to the hands using the hands (palms), primarily leave on
|
No restriction |
Category 11A
Products with intended skin contact but minimal transfer of fragrance to skin from inert substrate without UV exposure
|
No restriction |
|
Category 5D
Baby Creams, baby Oils and baby talc
|
No restriction |
Category 11B
Products with intended skin contact but minimal transfer of fragrance to skin from inert substrate with potential UV exposure
|
No restriction |
|
Category 6
Products with oral and lip exposure
|
No restriction |
Category 12
Products not intended for direct skin contact, minimal or insignificant transfer to skin
|
No restriction |
| Name | CAS | Botanical | Proportion |
|---|---|---|---|
| Abies semenovii | Abies semenovii L., fam. Pinaceae | 0.01% | |
| Amomum muricarpum | Amomum muricarpum Elm, fam. Zingiberaceae | 2.0% | |
| Amomum pavieanum rhizome | Amomum pavieanum Pierre & Gagnep, fam. Zingiberaceae | 0.1% | |
| Amomum villosum (China) 1f fruit | Amomum villosum Lour., fam. Zingiberaceae | 0.01% | |
| Star anise (China) 1 | 8007-70-3 | Illicium verum Hooker fil., fam. Magnoliaceae (Illiciaceae) | 0.05% |
| Star anise (China, Yunnan) 5 | 8007-70-3 | Illicium verum Hooker fil., fam. Magnoliaceae (Illiciaceae) | 0.04% |
| Star anise (Vietnam) 1 | 8007-70-3 | Illicium verum Hooker fil., fam. Magnoliaceae (Illiciaceae) | 0.08% |
| Armoise flower | 8008-93-3 | Artemisia vulgaris L., fam. Asteraceae (Compositae) | 0.05% |
| Ayou | Aydendron barbeyana Mez. (Nectandra globosa Mez.), fam. Lauraceae | 2.2% | |
| Lemon balm (Spain) | 8014-71-9 | Melissa officinalis L., fam. Lamiaceae (Labiatae) | 0.05% |
| Lemon balm 2 | 8014-71-9 | Melissa officinalis L., fam. Lamiaceae (Labiatae) | 0.5% |
| Balsamite/Costmary | Chrysanthemum balsamita L., fam. Asteraceae (Compositae) | 0.15% | |
| Basil (Nigeria) 2 | 8015-73-4 | Ocimum basilicum L., fam. Lamiaceae (Labiatae) | 0.14% |
| Blackcurrant bud, absolute | 68606-81-5 | Ribes nigrum L., fam. Grossulariaceae | 0.08% |
| Blackcurrant bud 1 | 68606-81-5 | Ribes nigrum L., fam. Grossulariaceae | 0.06% |
| Caraway herb | 8000-42-8 | Carum carvi L., fam. Apiaceae (Umbelliferae) | 0.45% |
| Carrot seed (France) 1 | 8015-88-1 | Daucus carota L., fam. Apiaceae (Umbelliferae) | 0.01% |
| Cedrela odorata | Cedrela odorata L., fam. Meliaceae | 15.6% | |
| Chamomile, german (Bulgaria) | 8002-66-2 | Chamomilla recutita (L.) Rausch.(Matricaria chamomilla L.), fam.Asteraceae | 0.24% |
| Citronella java (China) | 8000-29-1 | Cymbopogon winterianus Jowitt., fam. Poaceae (Gramineae) | 0.13% |
| Citronella java (Argentina) 2 | 8000-29-1 | Cymbopogon winterianus Jowitt., fam. Poaceae (Gramineae) | 0.12% |
| Citronella java (S. America) | 8000-29-1 | Cymbopogon winterianus Jowitt., fam. Poaceae (Gramineae) | 0.09% |
| Citronella java 3 | 8000-29-1 | Cymbopogon winterianus Jowitt., fam. Poaceae (Gramineae) | 0.08% |
| Citronella ceylon 5 | 8000-29-1 | Cymbopogon nardus (L.) Rendle, fam. Poaceae (Gramineae) | 0.04% |
| Clementine (Italy) 1 | Citrus clementina Hort. ex Tan., (C. deliciosa Ten. var. Clementina) | 0.04% | |
| Clinopodium vulgare (Belgium) | Clinopodium vulgare L. (Satureja vulgaris (L.) Fritsch), fam. Lamiaceae | 0.3% | |
| Clove bud 3 | 8000-34-8 | Eugenia caryophyllus (Spreng.) Bullock & Harrison (E.caryophyllata Thunb.) | 0.52% |
| Clove bud 2 | 8000-34-8 | Eugenia caryophyllus (Spreng.) Bullock & Harrison (E.caryophyllata Thunb.) | 0.2% |
| Ginger (Australia) 1 | 8007-08-7 | Zingiber officinale Roscoe, fam. Zingiberaceae | 0.21% |
| Coleonema pulchellum | Coleonema pulchellum Williams (C. pulchrum Hook.), fam. Rutaceae | 0.05% | |
| Cymbopogon distans 4 (Himalaya) | Cymbopogon distans (Steud.) Wats. (Chemotype 4), fam. Poaceae (Gramineae) | 0.6% | |
| Cymbopogon jwarancusa (India) | Cymbopogon jwarancusa (Jones) Schult., fam. Poaceae (Gramineae) | 0.3% | |
| Eucalyptus cloeziana leaf (Chemotype 1) | Eucalyptus cloeziana F. Muell., fam. Myrtaeceae | 0.02% | |
| Ginger (India) 3 | 8007-08-7 | Zingiber officinale Roscoe, fam. Zingiberaceae | 0.4% |
| Eugenia javanica | Eugenia javanica Lamk., fam. Myrtaceae | 0.6% | |
| Ginger (Nigeria) 2 | 8007-08-7 | Zingiber officinale Roscoe, fam. Zingiberaceae | 0.27% |
| Ginger (Nigeria) 1 | 8007-08-7 | Zingiber officinale Roscoe, fam. Zingiberaceae | 0.35% |
| Spike lavender (Spain) 3 | 8016-78-2 | Lavandula latifolia Medikus (L. spica D.C.), fam. Lamiaceae (Labiatae) | 0.2% |
| Helichrysum italicum (Yugoslavia) | 8023-95-8 | Helichrysum italicum (Roth) G. Don (H. angustifolium D.C.), fam.Asteraceae | 1.6% |
| Hortensis leaf | Euodia hortensis forma hortensis, fam. Saxifragaceae (Hydrangea) | 0.1% | |
| Hortensis flower | Euodia hortensis forma hortensis, fam. Saxifragaceae (Hydrangea) | 8.0% | |
| Juniper berry 1 | 8012-91-7 | Juniperus communis L., fam. Cupressaceae | 0.01% |
| Juniper berry 3 | 8012-91-7 | Juniperus communis L., fam. Cupressaceae | 0.45% |
| Juniper berry 5 | 8012-91-7 | Juniperus communis L., fam. Cupressaceae | 0.2% |
| Juniper branch | 8012-91-7 | Juniperus communis L., fam. Cupressaceae | 0.3% |
| Dracocephalum kotschyi | Dracocephalum kotschyi Boiss., fam. Lamiaceae (Labiatae) | 0.3% | |
| Lovage root (France) | 8016-31-7 | Levisticum officinale Koch, fam. Apiaceae (Umbelliferae) | 0.32% |
| Lovage root (China) 1 | 8016-31-7 | Levisticum officinale Koch, fam. Apiaceae (Umbelliferae) | 0.19% |
| Lovage root (China) 2 | 8016-31-7 | Levisticum officinale Koch, fam. Apiaceae (Umbelliferae) | 0.24% |
| Mandarin (Italy) 1 | 8008-31-9 | Citrus deliciosa Tenore (C. reticulata Blanco, cv.mandarin), fam. Rutaceae | 0.02% |
| Tamarind 2 | Tamarindus indica L., fam. Leguminosae | 0.6% | |
| Cinnamon leaf (Sri Lanka) | 8007-80-5 | Cinnamomum zeylanicum Blume (C. verum L. Presl), fam. Lauraceae | 0.68% |
| Eucalyptus globulus (Burundi) | 8016-26-0 | Eucalyptus globulus Labill., fam. Myrtaceae | 0.2% |
| Eucalyptus maidenii (Burundi) | Eucalyptus maidenii F. Muell., fam. Myrtaceae | 0.1% | |
| Juniper berry 2 | 8012-91-7 | Juniperus communis L., fam. Cupressaceae | 0.1% |
| Sage, dalmatian 1 | 8022-56-8 | Salvia officinalis L., fam. Lamiaceae (Labiatae) | 0.14% |
| Lemon verbena (Morocco) 1 | Aloysia triphylla (L'Herit.) Britton (Lippia citriodora (Lam.) O. Kuntze) | 0.6% | |
| Artemisia roxburghiana (Himalaya) | Artemisia roxburghiana Wall. ex Bies, var. hypolenca, fam. Asteraceae | 0.01% | |
| Juniper leaf 2 | 8012-91-7 | Juniperus communis L., fam. Cupressaceae | 0.32% |
| Tansy (Canada) 2a flowers | 8016-87-3 | Tanacetum vulgare L., fam. Asteraceae (Compositae) | 0.1% |
| Tansy (Canada) 2b stems & sheets | 8016-87-3 | Tanacetum vulgare L., fam. Asteraceae (Compositae) | 0.02% |
| Helichrysum bracteiferum (Madagascar) 1 | Helichrysum bracteiferum (DC) H. Humbert, fam. Asteraceae (Compositae) | 0.45% | |
| Helichrysum hypnoides (Madagascar) 1 | Helichrysum hypnoides (DC.) R.Vig. et Humbert, fam.Asteraceae (Compositae) | 1.0% | |
| Cypress (Algeria) | 8013-86-3 | Cupressus sempervirens L. (C. fastigiata DC), fam. Cupressaceae | 0.03% |
| Guava leaf 2 | 91770-12-6 | Psidium guajava L., fam. Myrtaceae | 0.88% |
| Angelica root (Finland) 4 | 8015-64-3 | Angelica archangelica L. var. archangelica, fam. Apiaceae (Umbelliferae) | 0.35% |
| Angelica root (Finland) 3 | 8015-64-3 | Angelica archangelica L. var. sativa, fam. Apiaceae (Umbelliferae) | 0.9% |
| Pepper, black (India) 1 | 8006-82-4 | Piper nigrum L., fam. Piperaceae | 0.6% |
| Pelargonium citronellum | Pelargonium citronellum J.J.A. v.d. Walt, fam. Geraniaceae | 0.05% | |
| Artemisia arborescens (U.S.A.) | Artemisia arborescens L., fam. Asteraceae (Compositae) | 0.65% | |
| Hyptis suaveolens (India) 2 | Hyptis suaveolens (L.) Poit., fam. Lamiaceae (Labiatae) | 0.05% | |
| Cassia, branch & leaf | 8007-80-5 | Cinnamomum cassia Blume, fam. Lauraceae | 0.01% |
| Cassia, bark | 8007-80-5 | Cinnamomum cassia Blume, fam. Lauraceae | 0.8% |
| Cassia, bark (China) 1 | 8007-80-5 | Cinnamomum cassia Blume, fam. Lauraceae | 0.01% |
| Cassia, bark (China) 2 | 8007-80-5 | Cinnamomum cassia Blume, fam. Lauraceae | 0.01% |
| Lilac, White, Picked Flower Headspace 2 | Syringa vulgaris L., fam. Oleaceae | 0.06% | |
| Lilac, Purple, Picked Flower Headspace 3 | Syringa vulgaris L., fam. Oleaceae | 0.06% | |
| Yuzu (Japan) 3 | Citrus junos Sieb. ex Tanaka, fam. Rutaceae | 0.01% | |
| Juniper leaf (France) | 8012-91-7 | Juniperus communis L., fam. Cupressaceae | 0.01% |
| Geranium (China, Yunnan) 5 | 8000-46-2 | Pelargonium graveolens L'Herit. ex Aiton, fam. Geraniaceae | 0.2% |
| Geranium (China, Beijing) | 8000-46-2 | Pelargonium graveolens L'Herit. ex Aiton, fam. Geraniaceae | 0.38% |
| Geranium (China, Chengdu) | 8000-46-2 | Pelargonium graveolens L'Herit. ex Aiton, fam. Geraniaceae | 0.49% |
| Cinnamon leaf 2 | 8007-80-5 | Cinnamomum zeylanicum Blume (C. verum L. Presl), fam. Lauraceae | 0.4% |
| Pepper, white (China) | 8006-82-4 | Piper nigrum L., fam. Piperaceae | 0.79% |
| Parsley leaf (Germany), 1b (smooth leaf) | 8000-68-8 | Petroselinum crispum (Miller) A.W. Hill (P. sativum Hoffm.), fam. Apiaceae | 0.2% |
| Parsley leaf (Germany), 1a (curly leaf) | 8000-68-8 | Petroselinum crispum (Miller) A.W. Hill (P. sativum Hoffm.), fam. Apiaceae | 0.1% |
| Cinnamon bark 4 | 8007-80-5 | Cinnamomum zeylanicum Blume (C. verum L. Presl), fam. Lauraceae | 0.5% |
| Grapefruit (Italy) 2 | 8016-20-4 | Citrus paradisi Macfayden, fam. Rutaceae | 0.06% |
| Cascarilla 1 | 8007-06-5 | Croton eluteria Bennett, fam. Euphorbiaceae | 1.3% |
| Vassoura (Brazil) 2 | Baccharis dracunculifolia DC., fam. Asteraceae (Compositae) | 0.87% | |
| Abies ernestii (China) | Abies ernestii Rehd., fam. Pinaceae | 0.19% | |
| Abies faxoniana (China) | Abies faxoniana Rehd. et Wils., fam. Pinaceae | 0.63% | |
| Artemisia argentea (Madeira) | Artemisia argentea L'Her., fam. Asteraceae (Compositae) | 0.6% | |
| Blumea brevipes | Blumea brevipes (Oliv. & Hiern) Willd., fam. Asteraceae (Compositae) | 0.8% | |
| Heteromorpha trifoliata | Heteromorpha trifoliata (Wendl.) Eckl. & Zey., fam.Apiaceae (Umbelliferae) | 1.4% | |
| Swangi (Citrus hystrix) leaf (Thailand) 1 | Citrus hystrix DC (Swangi), fam. Rutaceae | 0.1% | |
| Camphor (China) | 8008-51-3 | Cinnamomum camphora (L.) Nees et Ebermaier, fam. Lauraceae | 0.45% |
| Ho leaf (China) 4 | 8022-91-1 | Cinnamomum camphora Sieb. linaloolifera Fujita, fam. Lauraceae | 0.11% |
| Laurel leaf (Albania) | 8006-78-8 | Laurus nobilis L., fam. Lauraceae | 0.1% |
| Ylang Ylang 3 | 8006-81-3 | Cananga odorata (Lamk.) Hook. f. et Thomson forma genuina, fam. Annonaceae | 3.0% |
| Cinnamomum "Re G—ng" (Vietnam) 1b stem | Cinnamomum species "Re G—ng", fam. Lauraceae | 0.2% | |
| Fitweed seed | Eryngium foetidum L., fam. Apiaceae (Umbelliferae) | 0.06% | |
| Solanum stuckertii flower | Solanum stuckertii Bitter, fam. Solanaceae | 1.68% | |
| Ambrosia microcephala | Ambrosia microcephala DC., fam. Asteraceae (Compositae) | 0.5% | |
| Hexalobus monopetalus leaf | Hexalobus monopetalus (A. Rich) Engl., fam. Annonaceae | 0.3% | |
| Angelica root (Brazil) 1a hydrodistilled | 8015-64-3 | Angelica archangelica L., fam. Apiaceae (Umbelliferae) | 0.9% |
| Lippia alba (Cuba) 1a leaf | Lippia alba (Mill.) N.E. Brown, fam. Verbenaceae | 0.02% | |
| Flourensia oolepsis | Flourensia oolepsis S.L. Blake, fam. Asteraceae (Compositae) | 0.01% | |
| Annona squamosa leaf | Annona squamosa L., fam. Annonaceae (sweetsop or custard apple) | 1.3% | |
| Nepeta italica (Turkey) | Nepeta italica L., fam. Lamiaceae (Labiatae) | 0.2% | |
| Nepeta sulfuriflora (Turkey) | Nepeta sulfurifloral P.H. David, fam. Lamiaceae (Labiatae) | 0.4% | |
| Tagetes lucida | Tagetes lucida Cav. ssp. lucida, fam. Asteraceae (Compositae) | 0.05% | |
| Laurel stem bark (France) | Laurus nobilis L., fam. Lauraceae | 1.8% | |
| Laurel flower (France) | Laurus nobilis L., fam. Lauraceae | 0.3% | |
| Laurel stem wood (France) | Laurus nobilis L., fam. Lauraceae | 0.9% | |
| Nepeta cilicia | Nepeta cilicia Boiss., fam. Lamiaceae (Labiatae) | 7.3% | |
| Teucrium divaricatum (Greece) | Teucrium divaricatum Heldr. ssp. divaricatum, fam. Lamiaceae (Labiatae) | 0.65% | |
| Cistus (France) | 8016-26-0 | Cistus ladaniferus L. var. maculatus Dun, fam. Cistaceae | 0.8% |
| Clementine (Italy) 3a | Citrus clementina Hort. ex Tan., cultivar Oroval, fam. Rutaceae | 0.02% | |
| Clementine (Italy) 3b | Citrus clementina Hort. ex Tan., cultivar Monreal, fam. Rutaceae | 0.02% | |
| Clementine (Italy) 3c | Citrus clementina Hort. ex Tan., cultivar Comune, fam. Rutaceae | 0.04% | |
| Basil (Philippines) 1b | 8015-73-4 | Ocimum basilicum L., fam. Lamiaceae (Labiatae) | 0.05% |
| Annual wormwood (Finland) | 84775-74-6 | Artemisia annua L., fam. Asteraceae (Compositae) | 3.0% |
| St. John's wort (Turkey) | 84082-80-4 | Hypericum perforatum L., fam. Guttiferae (Hypericaceae) | 0.5% |
| Hypericum scabrum (Turkey) | Hypericum scabrum L., fam. Guttiferae (Hypericeae) | 0.01% | |
| Eremocharis triradiata | Eremocharis triradiata (Wolff.) Johnston, fam. Apiaceae (Umbelliferae) | 0.1% | |
| Stevia achalensis | Stevia achalensis Hieronymus, fam. Asteraceae (Compositae) | 0.01% | |
| Teucrium haenseleri flower | Teucrium haenseleri Boiss., fam. Lamiaceae (Labiatae) | 0.01% | |
| Aristolochia brevipes | Aristolochia brevipes Benth., fam. Aristolochiaceae | 0.3% | |
| Baccharis crispa | Baccharis crispa Spreng., fam. Asteraceae (Compositae) | 4.0% | |
| Baccharis salicifolia (Argentina) | Baccharis salicifolia Pers., fam Asteraceae (Compositae) | 1.6% | |
| Artemisia austriaca (Turkey) | Artemisia austriaca Jacq., fam. Asteraceae (Compositae) | 0.1% | |
| Artemisia spicigera (Turkey) | Artemisia spicigera C. Koch., fam. Asteraceae (Compositae) | 0.8% | |
| Pelargonium sidoides | Pelargonium sidoides DC., fam. Geraniaceae | 0.2% | |
| Pelargonium reniforme | Pelargonium reniforme Curt., fam. Geraniaceae | 0.3% | |
| Cabore (Brazil) | Micrastur ruficolis, fam. Leguminosae (so-called: officially unknown) | 22.9% | |
| Hoslundia opposita | Hoslundia opposita Vahl., fam. Lamiaceae (Labiatae) | 12.3% | |
| Hyptis lanceolata | Hyptis lanciolata Poit., fam. Lamiaceae (Labiatae) | 0.7% | |
| Hyptis suaveolens (Cameroon) | Hyptis suaveolens (L.) Poit., fam. Lamiaceae (Labiatae) | 0.05% | |
| Basil (Cameroon) | 8015-73-4 | Ocimum basilicum L., fam. Lamiaceae (Labiatae) | 0.05% |
| Ocimum canum (Cameroon) | Ocimum canum Sims., fam. Lamiaceae (Labiatae) | 0.2% | |
| Ocimum gratissimum (Cameroon) 1 | Ocimum gratissimum L., fam. Lamiaceae (Labiatae) | 0.4% | |
| Plectranthus glandulosus (Cameroon) 1 | Plectranthus glandulosus Hook f., fam. Lamiaceae (Labiatae) | 0.5% | |
| Thyme (Cameroon) | 8007-46-3 | Thymus vulgaris L., fam. Lamiaceae (Labiatae) | 0.1% |
| Piper capense (Cameroon) 1a | Piper capense L., fam. Piperaceae | 0.1% | |
| Piper capense (Cameroon) 1b | Piper capense L., fam. Piperaceae | 0.3% | |
| Piper guineense (Cameroon) 1a | Piper guineense Schum. et Thom., fam. Piperaceae | 0.05% | |
| Piper guineense (Cameroon) 1b | Piper guineense Schum. et Thom., fam. Piperaceae | 6.3% | |
| Bixa orellana (Cameroon) | Bixa orellana L., fam. Bixaceae | 0.6% | |
| Grapefruit (Italy) 4a | 8016-20-4 | Citrus paradisi Macfayden, fam. Rutaceae | 0.08% |
| Calamus (Bangladesh) root | 8015-79-0 | Acorus calamus L., fam. Araceae | 0.01% |
| Eupatorium ballotaefolium | Eupatorium ballotaefolium H.B.K., fam. Asteraceae (Compositae) | 0.5% | |
| Artemisia barrelieri | Artemisia barrelieri Besser, fam. Asteraceae (Compositae) | 2.2% | |
| Nepeta glomerulosa (Iran) | Nepeta glomerulosa Boiss., fam. Lamiaceae (Labiatae) | 0.4% | |
| Afrocarpus mannii 1a leaf | Afrocarpus mannii Hook f., fam. Podocarpaceae | 1.6% | |
| Afrocarpus mannii 1b bark | Afrocarpus mannii Hook f., fam. Podocarpaceae | 1.9% | |
| Carapa guianensis | Carapa guianensis Aubl., fam. Meliaceae | 0.3% | |
| Carrot umbel (Poland) | 8015-88-1 | Daucus carota L. ssp. carota, fam. Apiaceae (Umbelliferae) | 0.08% |
| Teucrium carolipaui (Spain) | Teucrium carolipaui Pau, fam. Lamiaceae (Labiatae) | 0.7% | |
| Eupatorium cannabinum | Eupatorium cannabinum L. ssp. cannabinum, fam. Astercaceae (Compositae) | 0.2% | |
| Solidago gigantea | Solidago gigantea Ait., fam. Asteraceae (Compositae) | 0.2% | |
| Satureja cuneifolia (Croatia) | Satureja cuneifolia Ten. (S. pisidica Wettst.), fam. Lamiaceae (Labiatae) | 0.5% | |
| Oregano, mexican (Guatemala) | Lippia graveolens HBK., fam. Verbenaceae | 0.8% | |
| Tanacetum balsamita | Tanacetum balsamita L., fam. Asteraceae (Compositae) | 0.1% | |
| St. John's wort (Yugoslavia) | 84082-80-4 | Hypericum perforatum L., fam. Guttiferae (Hypericaceae) | 0.2% |
| Hypericum olympicum (Yugoslavia) | Hypericum olympicum L., fam. Guttiferae (Hyperiaceae) | 2.7% | |
| Salvia argentea (Greece) | Salvia argentea L., fam. Lamiaceae (Labiatae) | 0.05% | |
| Hymenocrater incanus (Iran) | Hymenocrater incanus Bunge, fam. Lamiaceae (Labiatae) | 0.2% | |
| Melia dubia (India) | Melia dubia Cav., fam. Meliaceae | 0.01% | |
| Helichrysum bracteiferum (Madagascar) 2 | Helichrysum bracteiferum (DC) H. Humbert, fam. Asteraceae (Compositae) | 0.3% | |
| Helichrysum hypnoides (Madagascar) 3 | Helichrysum hypnoides (DC.) R.Vig. et Humbert, fam.Asteraceae (Compositae) | 1.8% | |
| Baccharis uncinella (Brazil) | Baccharis uncinella DC., fam. Asteraceae (Compositae) | 0.4% | |
| Geranium (India) 15a cv. Kunti | 8000-46-2 | Pelargonium graveolens L'Herit. ex Aiton, cv. Kunti, fam. Geraniaceae | 0.3% |
| Geranium (India) 15b cv. Kunti variant | 8000-46-2 | Pelargonium graveolens L'Herit. ex Aiton, cv.Kunti variant, fam. Geraniace | 0.1% |
| Clove leaf (India) | 8000-34-8 | Eugenia caryophyllus (Spreng.) Bullock & Harrison, fam. Myrtaceae | 0.04% |
| Artemisia campestris (Tunisia) | Artemisia campestris L., fam. Asteraceae (Compositae) | 2.0% | |
| Erichtites hieracifolia (Bolivia) | Erichtites hieracifolia (L.) Raf. ex DC, fam. Asteraceae (Compositae) | 1.6% | |
| Lippia alba (Uruguay) cultivar | Lippia alba (Mill.) N.E. Brown, fam. Verbenaceae | 0.8% | |
| Teucrium fruticans (Italy) 1a flowering phase | Teucrium fruticans L., fam. Lamiaceae (Labiatae) | 0.3% | |
| Teucrium fruticans (Italy) 1b fruiting phase | Teucrium fruticans L., fam. Lamiaceae (LAbiatae) | 0.4% | |
| Yarrow (India) | 84082-83-7 | Achillea millefolium L., fam. Asteraceae (Compositae) | 0.1% |
| Lime (Mexican, West Indian, Key) (Vietnam) | 8008-26-2 | Citrus aurantifolia (Christm.) Swingle, fam. Rutaceae | 0.02% |
| Clary sage (Italy) 2a inflorescense | 8016-63-5 | Salvia sclarea L., fam. Lamiaceae (Labiatae) | 0.54% |
| Clary sage (Italy) 2b leaf | 8016-63-5 | Salvia sclarea L., fam. Lamiaceae (Labiatae) | 5.26% |
| Pistacia lentiscus (Italy) 1a CO2-extract | 90082-83-0 | Pistacia lentiscus L., fam. Anacardiaceae | 0.87% |
| Pistacia lentiscus (Italy) 1b CO2-extract | 90082-83-0 | Pistacia lentiscus L., fam. Anacardiaceae | 0.19% |
| Pistacia lentiscus (Italy) 3a CO2 extract leaf | 90082-83-0 | Pistacia lentiscus L., fam. Anacardiaceae | 0.87% |
| Pistacia lentiscus (Italy) 3b hydrodist. leaf | 90082-83-0 | Pistacia lentiscus L., fam. Anacardiaceae | 0.25% |
| Ageratum conyzoides (Nigeria) | 85480-32-6 | Ageratum conyzoides L., fam. Asteraceae (Compositae) | 0.6% |
| Eucalyptus camaldulensis (Egypt) fruit | Eucalyptus camaldulensis Dehn. var. brevirostris, fam. Myrtaceae | 0.55% | |
| Nepeta argolica (Greece) 1a chemotype 1 | Nepeta argolica Bory & Chaub. ssp. argolica, fam. Lamiaceae (Labiatae) | 4.06% | |
| Geranium (India) 12a Genotype 1 'Algerian' | 8000-46-2 | Pelargonium species, fam. Geraniaceae | 0.1% |
| Geranium (India) 12b Genotype 2 'Bourbon' | 8000-46-2 | Pelargonium species, fam. Geraniaceae | 0.3% |
| Geranium (India) 12c Genotype 3 'Kelkar' | 8000-46-2 | Pelargonium species, fam. Geraniaceae | 0.2% |
| Croton ovalifolius (Venezuela) | Croton ovalifolius Vahl, fam. Euphorbiaceae | 1.5% | |
| Baccharis cordobensis (Argentina) | Baccharis cordobensis Heering, fam. Asteraceae (Compisitae) | 1.0% | |
| Orange, sweet (Ethiopia) 1a cv Valencia | 8028-48-6 | Citrus sinensis (L.) Osbeck, fam. Rutaceae | 0.02% |
| Orange, sweet (Ethiopia) 1b cv Hamlin | 8028-48-6 | Citrus sinensis (L.) Osbeck, fam. Rutaceae | 0.02% |
| Yuzu (Japana) 6 | Citrus junos Sieb. ex Tanaka, fam. Rutaceae | 0.01% | |
| Armoise (Israel) | 8008-93-3 | Artemisia herba-alba Asso, fam. Asteraceae (Compositae) | 0.01% |