Spathulenol
-
Identifiers
CAS number
6750-60-3Molecular formula
C15H24OSMILES
C[C@@]1(CC[C@@H]2[C@@H]1[C@H]3[C@H](C3(C)C)CCC2=C)O
Retention indicies (RI)
- DB5: 1578.71
- Carbowax: 2129.29
-
Odor profile
Fragrance Woody 72.05% Fruity 65.09% Herbal 59.3% Spicy 50.58% Earthy 47.11% Sweet 43.83% Balsamic 42.91% Camphoreous 40.13% Fresh 37.83% Mint 37.57% Flavor Fruity 74.45% Herbal 58.33% Herb 49.9% Fruit 49.7% Woody 44.31% Minty 42.28% Green 41.62% Sweet 38.51% Earthy 38.28% Tropical 30.66% Odor impact est.
Low -
Properties
XLogP3-AA
3.1pKa est.
9.65 (weak base)Molecular weight
220.35 g/molVapor pressure est.
- hPa @ 20°C
- hPa @ 25°C
Evaporation rate
SlowBoiling point
- 296.00 to 298.00 °C. @ 760.00 mm Hg
Flash point
- 89.48 ˚C est.
-
Synonyms
- Spathulenol
- 6750-60-3
- espatulenol
- (+)-Spathulenol
- Spatulenol
- UNII-7XV9L96SJJ
- 7XV9L96SJJ
- spathulenol,(+)-spathulenol,espatulenol
- CHEBI:132824
- 1H-CYCLOPROP(E)AZULEN-7-OL, DECAHYDRO-1,1,7-TRIMETHYL-4-METHYLENE-
- 1H-CYCLOPROP(E)AZULEN-7-OL, DECAHYDRO-1,1,7-TRIMETHYL-4-METHYLENE-, (1AR,4AR,7S,7AR,7BR)-
- (1aR,4aR,7S,7aR,7bR)-1,1,7-trimethyl-4-methylidene-1a,2,3,4a,5,6,7a,7b-octahydrocyclopropa[h]azulen-7-ol
- Spathulenol?
- (1aR,4aR,7S,7aR,7bR)-1,1,7-trimethyl-4-methylidenedecahydro-1H-cyclopropa(e)azulen-7-ol
- (1aR,4aR,7S,7aR,7bR)-1,1,7-trimethyl-4-methylidenedecahydro-1H-cyclopropa[e]azulen-7-ol
- 1H-Cycloprop(e)azulen-7-ol, decahydro-1,1,7-trimethyl-4-methylene-, (1aR-(1aalpha,4aalpha,7beta,7abeta,7balpha))-
- SCHEMBL309962
- CHEMBL518542
- HY-N1205
- AKOS037515399
- FS63189
- DA-67713
- MS-23227
- CS-0016592
- F82083
- Q1376658
-
Applications
Spathulenol is a sesquiterpene alcohol present in a range of natural essential oils and is typically used as an odorant/fragrance component in perfumery. In practical formulations, it may serve as a fragrance ingredient in cosmetics and personal care products; it can be considered an aroma component for flavor formulations in cautiously designed applications. It may also appear in household and cleaning products to impart a natural scent. Additionally, it can be evaluated as an intermediate in fragrance synthesis within the chemical manufacturing sector.
gpt-5-nano
-
Solubility @25˚C
Solvent Solubility (g/L) ethanol 274.07 methanol 235.72 isopropanol 355.71 water 0.83 ethyl acetate 235.34 n-propanol 276.99 acetone 381.16 n-butanol 270.72 acetonitrile 179.89 DMF 468.79 toluene 194.37 isobutanol 235.5 1,4-dioxane 497.08 methyl acetate 245.56 THF 1028.1 2-butanone 351.41 n-pentanol 146.38 sec-butanol 218.3 n-hexane 14.33 ethylene glycol 77.22 NMP 206.85 cyclohexane 31.44 DMSO 287.85 n-butyl acetate 196.6 n-octanol 134.19 chloroform 525.21 n-propyl acetate 149.31 acetic acid 108.1 dichloromethane 348.68 cyclohexanone 378.93 propylene glycol 133.08 isopropyl acetate 218.09 DMAc 310.4 2-ethoxyethanol 230.38 isopentanol 240.15 n-heptane 20.88 ethyl formate 178.67 1,2-dichloroethane 220.08 n-hexanol 235.73 2-methoxyethanol 437.66 isobutyl acetate 147.22 tetrachloromethane 86.43 n-pentyl acetate 163.64 transcutol 366.57 n-heptanol 138.35 ethylbenzene 103.12 MIBK 243.86 2-propoxyethanol 404.04 tert-butanol 334.2 MTBE 286.72 2-butoxyethanol 247.07 propionic acid 128.84 o-xylene 109.38 formic acid 38.84 diethyl ether 238.47 m-xylene 147.35 p-xylene 134.71 chlorobenzene 172.86 dimethyl carbonate 121.73 n-octane 13.21 formamide 72.87 cyclopentanone 549.73 2-pentanone 306.51 anisole 206.95 cyclopentyl methyl ether 281.61 gamma-butyrolactone 432.51 1-methoxy-2-propanol 397.62 pyridine 332.97 3-pentanone 201.31 furfural 327.54 n-dodecane 12.85 diethylene glycol 288.71 diisopropyl ether 90.4 tert-amyl alcohol 202.34 acetylacetone 319.9 n-hexadecane 14.8 acetophenone 171.14 methyl propionate 205.26 isopentyl acetate 221.45 trichloroethylene 367.48 n-nonanol 123.26 cyclohexanol 188.52 benzyl alcohol 174.8 2-ethylhexanol 122.97 isooctanol 118.76 dipropyl ether 135.16 1,2-dichlorobenzene 148.68 ethyl lactate 118.11 propylene carbonate 225.47 n-methylformamide 193.29 2-pentanol 181.75 n-pentane 21.32 1-propoxy-2-propanol 288.95 1-methoxy-2-propyl acetate 274.25 2-(2-methoxypropoxy) propanol 202.77 mesitylene 89.52 ε-caprolactone 280.5 p-cymene 81.74 epichlorohydrin 499.93 1,1,1-trichloroethane 223.56 2-aminoethanol 151.14 morpholine-4-carbaldehyde 345.06 sulfolane 349.15 2,2,4-trimethylpentane 14.38 2-methyltetrahydrofuran 433.28 n-hexyl acetate 220.64 isooctane 17.82 2-(2-butoxyethoxy)ethanol 251.85 sec-butyl acetate 126.53 tert-butyl acetate 225.81 decalin 19.9 glycerin 159.05 diglyme 410.9 acrylic acid 106.21 isopropyl myristate 99.16 n-butyric acid 211.01 acetyl acetate 155.23 di(2-ethylhexyl) phthalate 99.66 ethyl propionate 141.46 nitromethane 228.77 1,2-diethoxyethane 178.04 benzonitrile 207.21 trioctyl phosphate 80.06 1-bromopropane 168.45 gamma-valerolactone 587.47 n-decanol 94.17 triethyl phosphate 83.65 4-methyl-2-pentanol 144.14 propionitrile 233.84 vinylene carbonate 217.74 1,1,2-trichlorotrifluoroethane 271.8 DMS 156.4 cumene 78.24 2-octanol 105.44 2-hexanone 182.26 octyl acetate 123.27 limonene 91.48 1,2-dimethoxyethane 391.78 ethyl orthosilicate 81.57 tributyl phosphate 81.82 diacetone alcohol 258.26 N,N-dimethylaniline 132.85 acrylonitrile 239.02 aniline 181.66 1,3-propanediol 238.61 bromobenzene 174.03 dibromomethane 239.89 1,1,2,2-tetrachloroethane 319.51 2-methyl-cyclohexyl acetate 140.84 tetrabutyl urea 105.33 diisobutyl methanol 99.08 2-phenylethanol 218.09 styrene 108.73 dioctyl adipate 112.72 dimethyl sulfate 144.85 ethyl butyrate 143.91 methyl lactate 151.54 butyl lactate 148.18 diethyl carbonate 101.44 propanediol butyl ether 214.47 triethyl orthoformate 114.51 p-tert-butyltoluene 84.98 methyl 4-tert-butylbenzoate 178.56 morpholine 490.52 tert-butylamine 198.66 n-dodecanol 72.19 dimethoxymethane 410.53 ethylene carbonate 192.36 cyrene 172.23 2-ethoxyethyl acetate 210.48 2-ethylhexyl acetate 159.21 1,2,4-trichlorobenzene 168.08 4-methylpyridine 332.16 dibutyl ether 116.17 2,6-dimethyl-4-heptanol 99.08 DEF 217.54 dimethyl isosorbide 269.48 tetrachloroethylene 201.15 eugenol 177.32 triacetin 178.0 span 80 165.48 1,4-butanediol 105.51 1,1-dichloroethane 265.56 2-methyl-1-pentanol 130.17 methyl formate 166.6 2-methyl-1-butanol 190.65 n-decane 21.33 butyronitrile 255.9 3,7-dimethyl-1-octanol 131.22 1-chlorooctane 79.31 1-chlorotetradecane 33.51 n-nonane 18.4 undecane 16.17 tert-butylcyclohexane 21.12 cyclooctane 13.61 cyclopentanol 241.65 tetrahydropyran 463.01 tert-amyl methyl ether 157.72 2,5,8-trioxanonane 278.82 1-hexene 59.71 2-isopropoxyethanol 194.12 2,2,2-trifluoroethanol 62.33 methyl butyrate 180.97 Scent© AI
| Maximum acceptable concentrations in the finished product (%) | |||
|---|---|---|---|
|
Category 1
Products applied to the lips
|
No restriction |
Category 7A
Rinse-off products applied to the hair with some hand contact
|
No restriction |
|
Category 2
Products applied to the axillae
|
No restriction |
Category 7B
Leave-on products applied to the hair with some hand contact
|
No restriction |
|
Category 3
Products applied to the face/body using fingertips
|
No restriction |
Category 8
Products with significant anogenital exposure
|
No restriction |
|
Category 4
Products related to fine fragrance
|
No restriction |
Category 9
Products with body and hand exposure, primarily rinse off
|
No restriction |
|
Category 5A
Body lotion products applied to the body using the hands (palms), primarily leave on
|
No restriction |
Category 10A
Household care products with mostly hand contact
|
No restriction |
|
Category 5B
Face moisturizer products applied to the face using the hands (palms), primarily leave on
|
No restriction |
Category 10B
Household care products with mostly hand contact, including aerosol/spray products (with potential leave-on skin contact)
|
No restriction |
|
Category 5C
Hand cream products applied to the hands using the hands (palms), primarily leave on
|
No restriction |
Category 11A
Products with intended skin contact but minimal transfer of fragrance to skin from inert substrate without UV exposure
|
No restriction |
|
Category 5D
Baby Creams, baby Oils and baby talc
|
No restriction |
Category 11B
Products with intended skin contact but minimal transfer of fragrance to skin from inert substrate with potential UV exposure
|
No restriction |
|
Category 6
Products with oral and lip exposure
|
No restriction |
Category 12
Products not intended for direct skin contact, minimal or insignificant transfer to skin
|
No restriction |
| Name | CAS | Botanical | Proportion |
|---|---|---|---|
| Achillea wilhelmsii (Egypt) | Achillea wilhelmsii C. Koch (A. santolina Auct. Mult.), fam. Asteraceae | 0.3% | |
| Achillea wilhelmsii (Turkey) | Achillea wilhelmsii C. Koch (A. santolina Auct. Mult.), fam. Asteraceae | 0.3% | |
| Basil (Comoro Islands) 1 | 8015-73-4 | Ocimum basilicum L., fam. Lamiaceae (Labiatae) | 0.12% |
| Basil (Egypt) 1 (linalool-type) | 8015-73-4 | Ocimum basilicum L., fam. Lamiaceae (Labiatae) | 0.1% |
| Basil (France) 1 | 8015-73-4 | Ocimum basilicum L., fam. Lamiaceae (Labiatae) | 0.1% |
| Basil (Madagascar) 1 | 8015-73-4 | Ocimum basilicum L., fam. Lamiaceae (Labiatae) | 0.1% |
| Basil (Nigeria) 1 | 8015-73-4 | Ocimum basilicum L., fam. Lamiaceae (Labiatae) | 0.04% |
| Basil (Nigeria) 2 | 8015-73-4 | Ocimum basilicum L., fam. Lamiaceae (Labiatae) | 0.65% |
| Basil (Pakistan) | 8015-73-4 | Ocimum basilicum L., fam. Lamiaceae (Labiatae) | 0.15% |
| Basil (Vietnam) | 8015-73-4 | Ocimum basilicum L., fam. Lamiaceae (Labiatae) | 0.08% |
| Basil (Yugoslavia) | 8015-73-4 | Ocimum basilicum L., fam. Lamiaceae (Labiatae) | 0.15% |
| Blackcurrant bud 1 | 68606-81-5 | Ribes nigrum L., fam. Grossulariaceae | 1.0% |
| Calamus (Italy) root | 8015-79-0 | Acorus calamus L., fam. Araceae | 0.71% |
| Cedrela odorata | Cedrela odorata L., fam. Meliaceae | 0.08% | |
| Coleonema pulchellum | Coleonema pulchellum Williams (C. pulchrum Hook.), fam. Rutaceae | 0.07% | |
| Davana 1 | 8016-03-3 | Artemisia pallens Wall. ex DC., fam. Asteraceae (Compositae) | 3.4% |
| Dragonhead | Dracocephalum moldavica L., fam. Lamiaceae (Labiatae) | 0.2% | |
| Eucalyptus citriodora (China) 1 | 8000-48-4 | Eucalyptus citriodora Hook. f., fam. Myrtaceae | 0.12% |
| Eucalyptus cloeziana leaf (Chemotype 1) | Eucalyptus cloeziana F. Muell., fam. Myrtaeceae | 1.61% | |
| Hyptis pectinata | Hyptis pectinata (L.) Poit., fam. Lamiaceae (Labiatae) | 0.2% | |
| Hyssop (France) 1 | 8006-83-5 | Hyssopus officinalis L., fam. Lamiaceae (Labiatae) | 2.2% |
| Hyssop (USA) | 8006-83-5 | Hyssopus officinalis L., fam. Lamiaceae (Labiatae) | 0.68% |
| Lavender (Spain) (var. pyrenaica) | Lavandula angustifolia Mill. ssp. pyrenaica, fam. Lamiaceae (Labiatae) | 0.4% | |
| Lavandula multifida | Lavandula multifida L., fam. Lamiaceae (Labiatae) | 2.2% | |
| Mentha longifolia (France) | 90063-99-3 | Mentha longifolia (L.) Hudson, fam. Lamiaceae (Labiatae) | 0.25% |
| Pimento (Allspice) 2 | 8006-77-7 | Pimenta dioica (L.) Merr. (P. officinalis Lindl.), fam. Myrtaceae | 0.2% |
| Sage, spanish (Spain) 5 | 8016-65-7 | Salvia lavandulaefolia Vahl. ssp. lavandulafolia, fam Lamiaceae (Labiatae) | 0.35% |
| Sage, spanish (Spain) 6 | 8016-65-7 | Salvia lavandulaefolia Vahl. ssp. vellerea (Chemotype 1), fam. Lamiaceae | 0.1% |
| Sage, spanish (Spain) 7 | 8016-65-7 | Salvia lavandulaefolia Vahl. ssp. vellerea (Chemotype 2), fam. Lamiaceae | 0.55% |
| Sage, spanish (Spain) 8 | 8016-65-7 | Salvia lavandulaefolia Vahl. ssp. blancoana, fam. Lamiaceae (Labiatae) | 1.7% |
| Santolina canescens | Santolina rosmarinifolia (L.) ssp. canescens (Lag.) Nyman, fam. Asteraceae | 1.8% | |
| Santolina pectina | Santolina pectina Lag., fam. Asteraceae (Compositae) | 2.6% | |
| Santolina rosmarinifolia | Santolina rosmarinifolia L.ssp.rosmarinifolia, fam.Asteraceae (Compositae) | 1.4% | |
| Santolina semidentata | Santolina semidentata Hoffmanns. & Link, fam. Asteraceae (Compositae) | 2.4% | |
| Schinus molle | 68917-52-2 | Schinus molle L., fam. Anarcadiaceae | 2.7% |
| Stevia rebaudiana | Stevia rebaudiana Bertoni, fam. Asteraceae (Compositae) | 2.1% | |
| Vassoura (Brazil) 1 | Baccharis dracunculifolia DC., fam. Asteraceae (Compositae) | 2.0% | |
| Vitex limonifolia leaf | Vitex limonifolia Wall., fam. Verbenaceae | 0.95% | |
| Eucalyptus paniculata (Uruguay) | Eucalyptus paniculata Sm., fam. Myrtaceae | 0.5% | |
| Eucalyptus melliodora (Uruguay) | Eucalyptus melliodora Cumn., fam. Myrtaceae | 2.4% | |
| Eucalyptus botryoides (Uruguay) | Eucalyptus botryoides Sm., fam. Myrtaceae | 4.9% | |
| Eucalyptus grandis (Uruguay) | Eucalyptus grandis W. Hill ex Maiden, fam. Myrtaceae | 4.2% | |
| Eucalyptus sideroxylon (Uruguay) | Eucalyptus sideroxylon Sm., fam. Myrtaceae | 6.2% | |
| Eucalyptus maculata (Uruguay) | Eucalyptus maculata Hook., fam. Myrtaceae | 1.7% | |
| Eucalyptus pellita (Uruguay) | Eucalyptus pellita F. v. Muell., fam. Myrtaceae | 1.0% | |
| Eucalyptus longifolia (Uruguay) | Eucalyptus longifolia Link & Otto, fam. Myrtaceae | 0.5% | |
| Eucalyptus affinis (Uruguay) | Eucalyptus affinis Deane & Maiden, fam. Myrtaceae | 7.0% | |
| Eucalyptus brassiana | Eucalyptus brassiana S.T. Blake, fam. Myrtaceae | 0.15% | |
| Micromyrtus striata | Micromyrtus striata J.W. Green (M. ciliata (Sm) Druce), fam. Myrtaceae | 1.2% | |
| Melittis melissophyllum | Melittis melissophylum L., ssp. albida Guss, fam. Lamiaceae (Labiatae) | 0.14% | |
| Cinnamomum "Re G—ng" (Vietnam) 1a leaf | Cinnamomum species "Re G—ng", fam. Lauraceae | 1.3% | |
| Cinnamomum "Re G—ng" (Vietnam) 1b stem | Cinnamomum species "Re G—ng", fam. Lauraceae | 0.3% | |
| Cinnamomum "Re G—ng" (Vietnam) 1d root | Cinnamomum species "Re G—ng", fam. Lauraceae | 0.2% | |
| Hexalobus monopetalus leaf | Hexalobus monopetalus (A. Rich) Engl., fam. Annonaceae | 0.01% | |
| Tagetes lucida | Tagetes lucida Cav. ssp. lucida, fam. Asteraceae (Compositae) | 0.1% | |
| Nepeta cilicia | Nepeta cilicia Boiss., fam. Lamiaceae (Labiatae) | 1.5% | |
| Teucrium divaricatum (Greece) | Teucrium divaricatum Heldr. ssp. divaricatum, fam. Lamiaceae (Labiatae) | 2.2% | |
| Cistus (France) | 8016-26-0 | Cistus ladaniferus L. var. maculatus Dun, fam. Cistaceae | 0.5% |
| Eremocharis triradiata | Eremocharis triradiata (Wolff.) Johnston, fam. Apiaceae (Umbelliferae) | 0.1% | |
| Stevia achalensis | Stevia achalensis Hieronymus, fam. Asteraceae (Compositae) | 1.5% | |
| Teucrium haenseleri flower | Teucrium haenseleri Boiss., fam. Lamiaceae (Labiatae) | 0.2% | |
| Baccharis crispa | Baccharis crispa Spreng., fam. Asteraceae (Compositae) | 3.1% | |
| Baccharis salicifolia (Argentina) | Baccharis salicifolia Pers., fam Asteraceae (Compositae) | 1.6% | |
| Satureja boliviana (Peru) 2 | Satureja boliviana Briq. (Micromeria boliviana Benth.), fam. Lamiaceae | 1.3% | |
| Satureja brevicalix (Peru) | Satureja brevicalix Epl., fam. Lamiaceae (Labiatae) | 1.2% | |
| Pelargonium sidoides | Pelargonium sidoides DC., fam. Geraniaceae | 0.3% | |
| Pelargonium reniforme | Pelargonium reniforme Curt., fam. Geraniaceae | 2.4% | |
| Cabore (Brazil) | Micrastur ruficolis, fam. Leguminosae (so-called: officially unknown) | 0.2% | |
| Hoslundia opposita | Hoslundia opposita Vahl., fam. Lamiaceae (Labiatae) | 1.2% | |
| Hyptis lanceolata | Hyptis lanciolata Poit., fam. Lamiaceae (Labiatae) | 1.5% | |
| Hyptis suaveolens (Cameroon) | Hyptis suaveolens (L.) Poit., fam. Lamiaceae (Labiatae) | 1.0% | |
| Ocimum gratissimum (Cameroon) 1 | Ocimum gratissimum L., fam. Lamiaceae (Labiatae) | 0.05% | |
| Piper capense (Cameroon) 1b | Piper capense L., fam. Piperaceae | 0.05% | |
| Bixa orellana (Cameroon) | Bixa orellana L., fam. Bixaceae | 0.4% | |
| Tagetes filifolia (Peru) | Tagetes filifolia Lag., fam. Asteraceae (Compositae) | 0.5% | |
| Ocimum gratissimum (Bangladesh) 1b | Ocimum gratissimum L., var. clocimum, fam. Lamiaceae (Labiatae) | 0.2% | |
| Mentha longifolia (Israel) | 90063-99-3 | Mentha longifolia (L.) Hudson, fam. Lamiaceae (Labiatae) | 0.5% |
| Basil (Italy) 4a steamdistillate | 8015-73-4 | Ocimum basilicum L., fam. Lamiaceae (Labiatae) | 1.5% |
| Basil (Italy) 4b CO2-extract | 8015-73-4 | Ocimum basilicum L., fam. Lamiaceae (Labiatae) | 0.62% |
| Basil (Italy) 4b extract | 8015-73-4 | Ocimum basilicum L., fam. Lamiaceae (Labiatae) | 0.01% |
| Basil (Benin) 1a | 8015-73-4 | Ocimum basilicum L., fam. Lamiaceae (Labiatae) | 0.09% |
| Basil (Benin) 1b | 8015-73-4 | Ocimum basilicum L., fam. Lamiaceae (Labiatae) | 0.01% |
| Litsea cubeba (India) 2a stem | 68555-99-2 | Litsea cubeba (Lour.) Pers. (L. citrata Blume), fam. Lauraceae | 0.6% |
| Origanum husnuca-baserii (Turkey) | Origanum husnucan-baserii H. Duman, Z. Aytac et A. Duran, fam. Lamiaceae | 2.33% | |
| Camphor (Cuba) | 8008-51-3 | Cinnamomum camphora (L.) Nees et Ebermaier, fam. Lauraceae | 1.1% |
| Commiphora africana (Benin) | Commiphora africana (A. Rich.) Engl. (Heudelotia africana),fam. Burseracea | 0.2% | |
| Tessaria absinthioides (Argentina) | Tessaria absinthioides (Hook et Arn.) D. Candole, fam. Asteraceae (Comp.) | 0.4% | |
| Eupatorium capillifolium (Cuba) | Eupatorium capillifolium (Lam.) Small, fam. Asteraceae (Compositae) | 2.12% | |
| Eucalyptus citriodora (Bangladesh) | 8000-48-4 | Eucalyptus citriodora Hook. f., fam. Myrtaceae | 0.01% |
| Citron (Italy) peel 1a | Citrus medica L., cultivar Diamante, fam. Rutaceae | 0.01% | |
| Citron (Italy) peel 1b | Citrus medica L., cultivar Diamante, fam. Rutaceae | 0.01% | |
| Citron (Italy) peel 1c | Citrus medica L., cultivar Diamante, fam. Rutaceae | 0.15% | |
| Yuzu (Japan) 4 | Citrus junos Sieb. ex Tanaka, fam. Rutaceae | 0.02% | |
| Teucrium flavum (Greece) 1b leaf | Teucrium flavum L. ssp. hellenicum Rech. fil., fam. Lamiaceae (Labiatae) | 17.9% | |
| Teucrium flavum (Greece) 1a flower | Teucrium flavum L. ssp. hellenicum Rech. fil., fam. Lamiaceae (Labiatae) | 2.7% | |
| Eucalyptus alba (Burkina Faso) | Eucalyptus alba Muell., fam. Myrtaceae | 0.5% | |
| Eucalyptus camaldulensis (Burkina Faso) | Eucalyptus camaldulensis Dehn., fam. Myrtaceae | 0.6% | |
| Pistacia lentiscus (Spain) 2 whole plant | 90082-83-0 | Pistacia lentiscus L., fam. Anarcadiaceae | 1.4% |
| Aegopodium podagraria | Aegodopodium podagraria L., fam. Apiaceae (Umbelliferae) | 1.7% | |
| Acinos alpinus oil (Greece) | Acinos alpinus (L.) Moench., fam. Lamiaceae (Labiatae) | 5.0% | |
| Lippia lupulina stalk & leaf (Brazil) | Lippia lupulina Cham., fam. Verbenaceae | 3.2% | |
| Lippia lupulina flower (Brazil) | Lippia lupulina Cham., fam. Verbenaceae | 3.5% | |
| Thymus migricus (Turkey) | Thymus migricus Klokov et Des.-Shost., fam. Lamiaceae (Labiatae) | 0.2% | |
| Thymus fedtschenkoi var. handelii (Turkey) | Thymus fedtschenkoi var. handelii, fam. Lamiaceae (Labiatae) | 1.8% | |
| Cachrys sicula (Spain) | Cachrys sicula L., fam. Apiaceae (Umbelliferae) | 0.05% | |
| Astronium urundeuva (Brazil) | Astronium urundeuva (Allemao) Engl., fam. Anacardiaceae | 0.15% | |
| Astronium fraxinifolium (Brazil) | Astronium fraxinifolium Schott., fam. Anacardiaceae | 1.2% | |
| Artemisia marschaliana (Iran) | Artemisia marschaliana Sprengel, fam. Asteraceae (Compositae) | 9.9% | |
| Murraya koenigii (India) | Murraya koenigii (L.) Spreng., fam. Rutaceae | 1.0% | |
| Croton zambesicus (Cameroon) 1a leaf | Croton zambesicus Muell. Arg., fam. Euphorbiaceae | 2.6% | |
| Croton zambesicus (Cameroon) 1b root bark | Croton zambesicus Muell. Arg., fam. Euphorbiaceae | 14.0% | |
| Croton zambesicus (Cameroon) 1c stem bark | Croton zambesicus Muell. Arg., fam. Euphorbiaceae | 4.2% | |
| Pinus sylvestris (Lithuania) | 8023-99-2 | Pinus sylvestris L. (Scotch pine), fam. Pinaceae | 0.2% |
| Teucrium arduini (Serbia/Montenegro) | Teucrium arduini L., fam. Lamiaceae (Labiatae) | 1.5% | |
| Teucrium botrys (Serbia/Montenegro) | Teucrium botrys L., fam. Lamiaceae (Labiatae) | 0.6% | |
| Germander, common (Serbia/Montenegro) | Teucrium chamaedrys L., fam. Lamiaceae (Labiatae) | 0.7% | |
| Teucrium flavum (Serbia/Montenegro) | Teucrium flavum L., fam. Lamiaceae (Labiatae) | 0.2% | |
| Teucrium montanum (Serbia/Montenegro) | Teucrium montanum L., fam. Lamiaceae (Labiatae) | 1.1% | |
| Teucrium polium (Serbia/Montenegro) | Teucrium polium L., fam. Lamiaceae (Labiatae) | 2.9% | |
| Teucrium scordium (Serbia/Montenegro) | 90131-54-7 | Teucrium scordium L., fam. Lamiaceae (Labiatae) | 0.5% |
| Piper mikanianum (Brazil) | Piper mikanianum (Kunth) Steudel, fasm. Piperaceae | 0.5% | |
| Croton jimenezii (Costa Rica) | Croton jimenezii Standl. et Valerio, fam. Euphorbiaceae | 0.01% | |
| Conyza bonariensis (Brazil) | Conyza bonariensis (L.) Cronquist, fam. Asteraceae (Compositae) | 5.0% | |
| Desmos goezeanus leaf (Australia) | Desmos goezeanus (F. Muell.) L.W. Jessup, fam. Annonaceae | 2.9% | |
| Desmos wardianus leaf (Australia) | Desmos wardianus (F.M. Bailey) L.W. Jessup, fam. Annonaceae | 1.3% | |
| Myrceugenia alpigena (Brazil) | Myrceugenia alpigena (DC.) Landrum, fam. Myrtaceae | 3.2% | |
| Myrceugenia miersiana (Brazil) | Myrceugenia miersiana (Gardner) D. Legrand et Kausel, fam. Myrtaceae | 2.2% | |
| Myrceugenia myrcioides (Brazil) | Myrceugenia myrcioides (Cambess.) O. Berg, fam. Myrtaceae | 22.8% | |
| Eugenia moraviana (Brazil) | Eugenia moraviana O. Berg, fam. Myrtaceae | 0.7% | |
| Eugenia klappenbachiana (Brazil) | Eugenia klappenbachiana Mattos et D. Legrand, fam. Myrtaceae | 5.9% | |
| Eugenia repanda (Brazil) | Eugenia repanda O. Berg, fam. Myrtaceae | 0.7% | |
| Coespeletia moritziana leaf (Venezuela) | Coespeletia moritziana (Sch. Bip. ex Wedd.) Cuatr., fam. Asteraceae | 0.5% | |
| Coespeletia spicata leaf (Venezuela) | Coespeletia spicata (Sch. Bip. ex Wedd.) Cuatr., fam. Asteraceae | 0.4% | |
| Coespeletia thyrsiformis leaf (Venezuela) | Coespeletia thyrsiformis (A.C. Smith) Cuatr., fam. Asteraceae | 0.05% | |
| Philodendron imbe root (Brazil) | Plidodendron imbe Schott, fam. Araceae | 14.2% | |
| Eugenia burkartiana leaf (Brazil) | Eugenia burkartiana D. Legrand, fam. Myrtaceae | 1.5% | |
| Eugenia bacopari leaf (Brazil) | Eugenia bacopari D. Legrand, fam. Myrtaceae | 1.8% | |
| Philodendron acutatum root | Philodendron acutatum Schott, fam. Araceae | 0.4% | |
| Hyptis floribunda (Argentina) | Hyptis floribunda Briq. ex Micheli, fam. Lamiaceae (Labiatae) | 1.7% | |
| Neolitsea dealbata leaf (Australia) | Neolitsea dealbata (R. Br.) Merr., fam. Lauraceae | 11.5% | |
| Aniba riparia (Brazil) 1a leaf | Aniba riparia (Nees) Mez, fam. Lauraceae | 3.8% | |
| Pichana (Broom) (Argentina) | Baccharis spartioides (Hook. et Arn.) Remy, fam. Asteraceae (Compositae) | 1.7% | |
| Aniba riparia (Brazil) 1d trunk wood | Aniba riparia (Nees) Mez, fam. Lauraceae | 0.8% | |
| Polylepis besseri (Bolivia) | Polylepis besseri Hieron. ssp. besseri, fam. Rosaceae | 1.2% | |
| Salvia aucheri (Turkey) 1a var. aucheri | Salvia aucheri Benth. var. aucheri, fam. Lamiaceae (Labiatae) | 6.3% | |
| Salvia aucheri (Turkey) 1b var. canenscens | Salvia aucheri Benth. var. canenscens, fam. Lamiaceae (Labiatae) | 4.3% | |
| Thymus x oblongifolius (Lithuania) | Thymus x oblongifolius Opiz, fam. Lamiaceae (Labiatae) | 1.0% | |
| Artemisia variabilis (Italy) | Artemisia variabilis Ten., fam. Asteraceae (Compositae) | 0.5% | |
| Artemisia campestris, ssp. glutinosa (Italy) | Artemisia campestris L. ssp. glutinosa (Ten.) Briq. et Cavill., Asteraceae | 3.0% | |
| Cinnamomum oliveri leaf (Australia) | Cinnamomum oliveri F.M. Bailey, fam. Lauraceae | 0.95% |