-
Định danh
Số CAS
3917-48-4Công thức phân tử
C10H16SMILES
CC1=CC[C@]2([C@@H]1C2)C(C)C
Chỉ số lưu (RI)
- DB5: 935.43
- Carbowax: 1027.57
-
Hồ sơ mùi hương
Hương thơm Gỗ 85.19% Thảo mộc 64.19% Xanh 60.66% Cay 58.77% Tươi mát 45.37% Terpen 43.63% Cam chanh 41.44% Dầu 39.29% Khô 38.74% Thông 38.35% Hương vị Woody 77.21% Wood 64.16% Green 57.05% Herbal 49.53% Spice 48.58% Herb 47.32% Terpene 45.02% Citrus 41.16% Turpentine 37.58% Pine 35.89% Cường độ mùi ước lượng
Mạnh -
Thuộc tính
XLogP3-AA
2.8pKa ước lượng
9.93 (kiềm yếu)Khối lượng phân tử
136.23 g/molÁp suất hơi ước lượng
- hPa @ 20°C
- hPa @ 25°C
Tốc độ bay hơi
Rất nhanhĐiểm sôi ước lượng
161°CĐiểm chớp cháy
- 36.52 ˚C ước lượng
-
Các tên gọi
- (-)-alpha-Thujene
- 3917-48-4
- RN746W3HMX
- alpha-Thujene, (-)-
- UNII-RN746W3HMX
- (1R,5S)-5-isopropyl-2-methylbicyclo[3.1.0]hex-2-ene
- (-)-.ALPHA.-THUJENE
- CHEBI:50033
- Bicyclo(3.1.0)hex-2-ene, 2-methyl-5-(1-methylethyl)-, (1R)-
- .ALPHA.-THUJENE, (-)-
- 3-THUJENE, (1R,5R)-(-)-
- (1R,5S)-2-methyl-5-(propan-2-yl)bicyclo[3.1.0]hex-2-ene (1R,5S)-thuj-2-ene
- (1R,5S)-2-methyl-5-(propan-2-yl)bicyclo[3.1.0]hex-2-ene
- (1R,5R)-2-METHYL-5-(1-METHYLETHYL)BICYCLO(3.1.0)HEX-2-ENE
- BICYCLO(3.1.0)HEX-2-ENE, 2-METHYL-5-(1-METHYLETHYL)-, (1R,5R)-
- (1R,5S)-5-Isopropyl-2-methylbicyclo(3.1.0)hex-2-ene
- (1R,5S)-2-methyl-5-(propan-2-yl)bicyclo(3.1.0)hex-2-ene
- trans-Thujene
- (1R,5S)-2-methyl-5-(propan-2-yl)bicyclo(3.1.0)hex-2-ene (1R,5S)-thuj-2-ene
- (-)-I+/--Thujene
- (1R)-2-methyl-5-propan-2-ylbicyclo[3.1.0]hex-2-ene
- KQAZVFVOEIRWHN-NXEZZACHSA-N
- DTXSID001317501
- LMPR0102120038
- Q27121815
-
Ứng dụng
(-)-alpha-Thujene, CAS 3917-48-4, is used as an odorant and fragrance ingredient in perfumery, cosmetics, and personal care, contributing piney and herbaceous notes to essential-oil-derived formulations. It is commonly evaluated for use as a flavor/aroma component in food processing, where small amounts add subtle herbal notes. In household products such as cleaners and air fresheners, it provides fragrance and odor profiles. In industrial manufacturing, it can serve as a fragrance precursor or building block in terpene synthesis and related aroma compounds. It may also be used as an intermediate in the production of other fragrance or flavor chemicals.
-
Độ tan @25˚C
Dung môi Độ tan (g/L) ethanol 422.14 methanol 286.26 isopropanol 483.87 water 0.96 ethyl acetate 685.27 n-propanol 481.41 acetone 696.17 n-butanol 508.77 acetonitrile 511.79 DMF 516.94 toluene 583.38 isobutanol 385.94 1,4-dioxane 1246.06 methyl acetate 626.02 THF 1428.35 2-butanone 676.88 n-pentanol 312.98 sec-butanol 444.07 n-hexane 218.24 ethylene glycol 92.56 NMP 288.66 cyclohexane 264.0 DMSO 326.08 n-butyl acetate 624.59 n-octanol 281.55 chloroform 1140.17 n-propyl acetate 361.37 acetic acid 181.08 dichloromethane 833.21 cyclohexanone 610.71 propylene glycol 155.0 isopropyl acetate 580.5 DMAc 474.58 2-ethoxyethanol 417.99 isopentanol 469.15 n-heptane 197.37 ethyl formate 285.13 1,2-dichloroethane 618.64 n-hexanol 620.65 2-methoxyethanol 580.05 isobutyl acetate 327.79 tetrachloromethane 334.61 n-pentyl acetate 348.95 transcutol 1139.48 n-heptanol 287.05 ethylbenzene 329.06 MIBK 523.57 2-propoxyethanol 842.47 tert-butanol 602.57 MTBE 919.92 2-butoxyethanol 430.82 propionic acid 237.89 o-xylene 352.42 formic acid 49.95 diethyl ether 930.24 m-xylene 435.25 p-xylene 420.61 chlorobenzene 448.8 dimethyl carbonate 247.56 n-octane 94.7 formamide 108.51 cyclopentanone 707.51 2-pentanone 603.28 anisole 586.58 cyclopentyl methyl ether 690.95 gamma-butyrolactone 567.32 1-methoxy-2-propanol 591.77 pyridine 670.06 3-pentanone 517.69 furfural 441.12 n-dodecane 73.2 diethylene glycol 423.47 diisopropyl ether 451.4 tert-amyl alcohol 475.41 acetylacetone 644.21 n-hexadecane 84.19 acetophenone 370.88 methyl propionate 485.83 isopentyl acetate 661.63 trichloroethylene 830.23 n-nonanol 265.43 cyclohexanol 376.88 benzyl alcohol 283.48 2-ethylhexanol 374.54 isooctanol 248.42 dipropyl ether 665.84 1,2-dichlorobenzene 396.38 ethyl lactate 171.35 propylene carbonate 332.97 n-methylformamide 232.45 2-pentanol 437.78 n-pentane 220.42 1-propoxy-2-propanol 642.91 1-methoxy-2-propyl acetate 693.43 2-(2-methoxypropoxy) propanol 418.63 mesitylene 325.07 ε-caprolactone 502.13 p-cymene 276.39 epichlorohydrin 790.23 1,1,1-trichloroethane 747.71 2-aminoethanol 190.44 morpholine-4-carbaldehyde 523.59 sulfolane 438.9 2,2,4-trimethylpentane 115.91 2-methyltetrahydrofuran 917.71 n-hexyl acetate 498.14 isooctane 128.97 2-(2-butoxyethoxy)ethanol 540.35 sec-butyl acetate 357.72 tert-butyl acetate 648.5 decalin 153.07 glycerin 170.72 diglyme 939.1 acrylic acid 166.16 isopropyl myristate 276.85 n-butyric acid 367.05 acetyl acetate 433.95 di(2-ethylhexyl) phthalate 187.97 ethyl propionate 392.81 nitromethane 382.74 1,2-diethoxyethane 749.6 benzonitrile 356.92 trioctyl phosphate 141.38 1-bromopropane 585.25 gamma-valerolactone 753.5 n-decanol 211.49 triethyl phosphate 218.33 4-methyl-2-pentanol 330.11 propionitrile 582.2 vinylene carbonate 320.61 1,1,2-trichlorotrifluoroethane 373.08 DMS 403.48 cumene 265.91 2-octanol 213.97 2-hexanone 433.57 octyl acetate 293.06 limonene 333.36 1,2-dimethoxyethane 844.47 ethyl orthosilicate 236.27 tributyl phosphate 176.46 diacetone alcohol 476.73 N,N-dimethylaniline 361.1 acrylonitrile 468.0 aniline 422.82 1,3-propanediol 307.87 bromobenzene 522.73 dibromomethane 636.11 1,1,2,2-tetrachloroethane 740.81 2-methyl-cyclohexyl acetate 351.1 tetrabutyl urea 199.1 diisobutyl methanol 301.25 2-phenylethanol 427.09 styrene 355.58 dioctyl adipate 262.33 dimethyl sulfate 239.06 ethyl butyrate 454.7 methyl lactate 221.36 butyl lactate 221.38 diethyl carbonate 301.0 propanediol butyl ether 308.66 triethyl orthoformate 358.96 p-tert-butyltoluene 298.42 methyl 4-tert-butylbenzoate 391.63 morpholine 1039.65 tert-butylamine 505.08 n-dodecanol 174.07 dimethoxymethane 673.19 ethylene carbonate 322.34 cyrene 228.77 2-ethoxyethyl acetate 481.19 2-ethylhexyl acetate 515.27 1,2,4-trichlorobenzene 414.2 4-methylpyridine 649.28 dibutyl ether 468.86 2,6-dimethyl-4-heptanol 301.25 DEF 455.79 dimethyl isosorbide 591.9 tetrachloroethylene 488.12 eugenol 324.73 triacetin 372.5 span 80 316.05 1,4-butanediol 132.36 1,1-dichloroethane 746.87 2-methyl-1-pentanol 292.56 methyl formate 189.97 2-methyl-1-butanol 408.29 n-decane 112.21 butyronitrile 541.75 3,7-dimethyl-1-octanol 330.73 1-chlorooctane 270.72 1-chlorotetradecane 139.03 n-nonane 109.09 undecane 87.58 tert-butylcyclohexane 156.61 cyclooctane 143.87 cyclopentanol 360.27 tetrahydropyran 1103.01 tert-amyl methyl ether 569.6 2,5,8-trioxanonane 608.87 1-hexene 401.65 2-isopropoxyethanol 364.26 2,2,2-trifluoroethanol 102.17 methyl butyrate 395.4 Scent© AI
| Nồng độ tối đa được chấp nhận trong sản phẩm hoàn thiện (%) | |||
|---|---|---|---|
|
Danh mục 1
Sản phẩm sử dụng cho môi
|
Không hạn chế |
Danh mục 7A
Sản phẩm rửa xả thoa lên tóc có tiếp xúc với tay
|
Không hạn chế |
|
Danh mục 2
Sản phẩm sử dụng cho vùng nách
|
Không hạn chế |
Danh mục 7B
Sản phẩm lưu lại trên tóc có tiếp xúc với tay
|
Không hạn chế |
|
Danh mục 3
Sản phẩm thoa lên mặt/cơ thể bằng đầu ngón tay
|
Không hạn chế |
Danh mục 8
Sản phẩm có tiếp xúc đáng kể với vùng hậu môn - sinh dục
|
Không hạn chế |
|
Danh mục 4
Sản phẩm liên quan đến nước hoa
|
Không hạn chế |
Danh mục 9
Sản phẩm tiếp xúc với cơ thể và tay, chủ yếu rửa xả
|
Không hạn chế |
|
Danh mục 5A
Sản phẩm dưỡng thể thoa lên cơ thể bằng tay (lòng bàn tay), chủ yếu lưu lại trên da
|
Không hạn chế |
Danh mục 10A
Sản phẩm chăm sóc nhà cửa chủ yếu tiếp xúc với tay
|
Không hạn chế |
|
Danh mục 5B
Sản phẩm dưỡng ẩm cho mặt thoa lên mặt bằng tay (lòng bàn tay), chủ yếu lưu lại trên da
|
Không hạn chế |
Danh mục 10B
Sản phẩm chăm sóc nhà cửa chủ yếu tiếp xúc với tay, bao gồm dạng xịt/phun (có khả năng lưu lại trên da)
|
Không hạn chế |
|
Danh mục 5C
Kem dưỡng da tay thoa lên tay bằng tay (lòng bàn tay), chủ yếu lưu lại trên da
|
Không hạn chế |
Danh mục 11A
Sản phẩm dự kiến tiếp xúc với da nhưng hầu như không truyền hương lên da từ chất nền trơ, không tiếp xúc với tia UV
|
Không hạn chế |
|
Danh mục 5D
Kem dưỡng, dầu dưỡng và phấn rôm cho em bé
|
Không hạn chế |
Danh mục 11B
Sản phẩm dự kiến tiếp xúc với da nhưng hầu như không truyền hương lên da từ chất nền trơ, có khả năng tiếp xúc với tia UV
|
Không hạn chế |
|
Danh mục 6
Sản phẩm tiếp xúc với miệng và môi
|
Không hạn chế |
Danh mục 12
Sản phẩm không nhằm tiếp xúc trực tiếp với da, chỉ truyền rất ít hoặc không đáng kể sang da
|
Không hạn chế |
| Tên | CAS | Thực vật | Tỷ lệ |
|---|---|---|---|
| Achillea abrotanoides | Achillea abrotanoides (Vis.) Vis., fam. Asteraceae (Compositae) | 5.5% | |
| Amomum villosum | Amomum villosum Lour., fam. Zingiberaceae | 0.35% | |
| Angelica root (Finland) 1 | 8015-64-3 | Angelica archangelica L., fam. Apiaceae (Umbelliferae) | 0.01% |
| Armoise flower | 8008-93-3 | Artemisia vulgaris L., fam. Asteraceae (Compositae) | 1.42% |
| Artemisia nilagirica (vulgaris) (India) 2 | Artemisia nilagirica (C.B. Clarks) Pamp. (A. vulgaris Hook f.), Asteraceae | 0.01% | |
| Artemisia nilagirica (vulgaris) (India) 1 | Artemisia nilagirica (C.B. Clarks) Pamp. (A. vulgaris Hook f.), Asteraceae | 0.09% | |
| Ayou | Aydendron barbeyana Mez. (Nectandra globosa Mez.), fam. Lauraceae | 0.05% | |
| Basil (Italy) 1a CO2-extract | 8015-73-4 | Ocimum basilicum L., fam. Lamiaceae (Labiatae) | 0.01% |
| Basil 2 | 8015-73-4 | Ocimum basilicum L., fam. Lamiaceae (Labiatae) | 0.14% |
| Bergamot (China) 5 | 8007-75-8 | Citrus bergamia Risso et Poiteau, fam. Rutaceae | 0.03% |
| Bergamot (China) 2 | 8007-75-8 | Citrus bergamia Risso et Poiteau, fam. Rutaceae | 0.01% |
| Bergamot (Italy) 1 | 8007-75-8 | Citrus bergamia Risso et Poiteau, fam. Rutaceae | 0.01% |
| Bergamot (Italy, Calabria) 4 | 8007-75-8 | Citrus bergamia Risso et Poiteau, fam. Rutaceae | 0.36% |
| Bergamot (Italy, Calabria) 6 | 8007-75-8 | Citrus bergamia Risso et Poiteau, fam. Rutaceae | 0.36% |
| Bergamot (Italy, Calabria) 5 | 8007-75-8 | Citrus bergamia Risso et Poiteau, fam. Rutaceae | 0.35% |
| Bergamot (China) 1 | 8007-75-8 | Citrus bergamia Risso et Poiteau, fam. Rutaceae | 0.18% |
| Blackcurrant bud, absolute | 68606-81-5 | Ribes nigrum L., fam. Grossulariaceae | 0.38% |
| Lemon (Spain) 7 | 84929-31-7 | Citrus limon (L.) Burm. f., fam. Rutaceae | 0.35% |
| Bupleurum linearifolium | Bupleurum linearifolium DC., fam. Apiaceae (Umbelliferae) | 1.9% | |
| Calamintha nepeta (Belgium) | Calamintha nepeta (L.) Savi (Melissa nepeta L.), fam. Lamiaceae (Labiatae) | 0.05% | |
| Calamintha sylvatica (Belgium) | Calamintha sylvatica Bromf., fam. Lamiaceae (Labiatae) | 0.05% | |
| Caraway seed 1 | 8000-42-8 | Carum carvi L., fam. Apiaceae (Umbelliferae) | 0.01% |
| Cardamom (Costa Rica) | 8000-66-6 | Elettaria cardamomum (L.) Maton, fam. Zingiberaceae | 0.01% |
| Carrot leaf (India) | 8015-88-1 | Daucus carota L. var. sativa, fam. Apiaceae (Umbelliferae) | 1.06% |
| Carrot seed (France) 1 | 8015-88-1 | Daucus carota L., fam. Apiaceae (Umbelliferae) | 0.68% |
| Cinnamon bark 2a | 8007-80-5 | Cinnamomum zeylanicum Blume (C. verum L. Presl), fam. Lauraceae | 0.04% |
| Cinnamon bark 3 | 8007-80-5 | Cinnamomum zeylanicum Blume (C. verum L. Presl), fam. Lauraceae | 0.04% |
| Citronella java (Argentina) 2 | 8000-29-1 | Cymbopogon winterianus Jowitt., fam. Poaceae (Gramineae) | 0.1% |
| Citronella ceylon 5 | 8000-29-1 | Cymbopogon nardus (L.) Rendle, fam. Poaceae (Gramineae) | 0.02% |
| Clementine (Italy) 1 | Citrus clementina Hort. ex Tan., (C. deliciosa Ten. var. Clementina) | 0.01% | |
| Clove bud 3 | 8000-34-8 | Eugenia caryophyllus (Spreng.) Bullock & Harrison (E.caryophyllata Thunb.) | 0.25% |
| Ginger (Australia) 1 | 8007-08-7 | Zingiber officinale Roscoe, fam. Zingiberaceae | 0.03% |
| Coriander fruit (Italy) 1 | 8008-52-4 | Coriandrum sativum L., fam. Apiaceae (Umbelliferae) | 0.05% |
| Coriander, headspace | 8008-52-4 | Coriandrum sativum L., fam. Apiaceae (Umbelliferae) | 0.2% |
| Mandarin (Spain) 1 | 8008-31-9 | Citrus deliciosa Tenore (C. reticulata Blanco, cv.mandarin), fam. Rutaceae | 0.57% |
| Cubeb 1 | 8007-87-2 | Piper cubeba L., fam. Piperaceae | 0.2% |
| Cumin (Egypt) 1 | 8014-30-9 | Cuminum cyminum L., fam. Apiaceae (Umbelliferae) | 0.1% |
| Cymbopogon jwarancusa (India) | Cymbopogon jwarancusa (Jones) Schult., fam. Poaceae (Gramineae) | 1.9% | |
| Dragonhead | Dracocephalum moldavica L., fam. Lamiaceae (Labiatae) | 0.05% | |
| Ducrosia anethifolia (Pakistan) | Ducrosia anethifolia (DC.) Boiss., fam. Apiaceae (Umbelliferae) | 0.07% | |
| Elsholtzia blanda (China) | Elsholtzia blanda Benth., fam. Lamiaceae (Labiatae) | 0.67% | |
| Tarragon 1 | 8016-88-4 | Artemisia dracunculus L., fam. Asteraceae (Compositae) | 0.16% |
| Ginger (India) 3 | 8007-08-7 | Zingiber officinale Roscoe, fam. Zingiberaceae | 0.01% |
| Grapefruit (Israel) 2 | 8016-20-4 | Citrus paradisi Macfayden, fam. Rutaceae | 0.01% |
| Fern, sweet 1 | Comptonia peregrina (L.) Coulter, fam. Pteridophytae | 0.23% | |
| Fern, sweet 2 | Comptonia peregrina (L.) Coulter, fam. Pteridophytae | 0.27% | |
| Galangal root (Indonesia) | 8023-91-4 | Alpinia galanga (L.) Willd., fam. Zingiberaceae | 6.2% |
| Germander, common (Italy) | Teucrium chamaedrys L., fam. Lamiaceae (Labiatae) | 0.05% | |
| Germander, common (Italy) headspace | Teucrium chamaedrys L., fam. Lamiaceae (Labiatae) | 0.7% | |
| Ginger (India) 1 | 8007-08-7 | Zingiber officinale Roscoe, fam. Zingiberaceae | 0.1% |
| Mandarin 2 | 8008-31-9 | Citrus deliciosa Tenore (C. reticulata Blanco, cv.mandarin), fam. Rutaceae | 0.63% |
| Orange, sweet (Italy) 1 | 8028-48-6 | Citrus sinensis (L.) Osbeck, fam. Rutaceae | 0.01% |
| Orange, sweet (China) 1, Wenzhou | 8028-48-6 | Citrus sinensis (L.) Osbeck, Wenzhou honey orange, fam. Rutaceae | 0.15% |
| Cedarleaf 5 | 8000-27-9 | Thuja occidentalis L., fam. Taxodiaceae | 1.0% |
| Nutmeg (Sri Lanka) 2 | 8008-45-5 | Myristica fragrans Houtt., fam. Myristicaceae | 2.46% |
| Celery plant | 8015-90-5 | Apium graveolens L. var. dulce, fam. Apiaceae (Umbelliferae) | 0.1% |
| Thyme 5 | 8007-46-3 | Thymus vulgaris L., fam. Lamiaceae (Labiatae) | 1.2% |
| Lovage seed (France) | 8016-31-7 | Levisticum officinale Koch, fam. Apiaceae (Umbelliferae) | 0.11% |
| Myrtle leaf (Spain) | 8008-46-6 | Myrtus communis L., fam. Myrtaceae | 0.06% |
| Myrtle flower (Spain) | 8008-46-6 | Myrtus communis L., fam. Myrtaceae | 0.16% |
| Myrtle unripe fruits (Spain) | 8008-46-6 | Myrtus communis L., fam. Myrtaceae | 0.08% |
| Myrtle ripe fruits (Spain) | 8008-46-6 | Myrtus communis L., fam. Myrtaceae | 0.06% |
| Laurel leaf (Pakistan) | 8006-78-8 | Laurus nobilis L., fam. Lauraceae | 0.31% |
| Tea Tree (Australia) 7 | 68647-73-4 | Melaleuca alternifolia (Maiden et Betche) Cheel, fam. Myrtaceae | 0.9% |
| Tea Tree (Australia) 8 | 68647-73-4 | Melaleuca alternifolia (Maiden et Betche) Cheel, fam. Myrtaceae | 1.1% |
| Patchouli (India) 1 | 8014-09-3 | Pogostemon cablin Benth., fam. Lamiaceae (Labiatae) | 0.01% |
| Tarragon (USA) 1 | 8016-88-4 | Artemisia dracunculus L. (French type), fam. Asteraceae (Compositae) | 0.01% |
| Tarragon (USA) 2 | 8016-88-4 | Artemisia dracunculus L. (French type), fam. Asteraceae (Compositae) | 0.01% |
| Tarragon (USA) 3 | 8016-88-4 | Artemisia dracunculus L. (Russian type), fam. Asteraceae (Compositae) | 0.01% |
| Tarragon (USA) 4 | 8016-88-4 | Artemisia dracunculus L. (Russian type), fam. Asteraceae (Compositae) | 0.02% |
| Sage, spanish (Spain) 4 | 8016-65-7 | Salvia lavandulaefolia Vahl., fam. Lamiaceae (Labiatae) | 0.22% |
| Pimento (Allspice) (Jamaica) 2 | 8006-77-7 | Pimenta dioica (L.) Merr. (P. officinalis Lindl.), fam. Myrtaceae | 0.45% |
| Sage, dalmatian 3 | 8022-56-8 | Salvia officinalis L., fam. Lamiaceae (Labiatae) | 0.1% |
| Galbanum 1 | 9000-24-2 | Ferula galbaniflua Boiss. et Buhse, fam. Apiaceae (Umbelliferae) | 0.4% |
| Angelica root 1 | 8015-64-3 | Angelica archangelica L., fam. Apiaceae (Umbelliferae) | 0.69% |
| Lemon (Argentina) 2 | 84929-31-7 | Citrus limon (L.) Burm. f., fam. Rutaceae | 0.01% |
| Lemon (Italy-Sicily) 3 | 84929-31-7 | Citrus limon (L.) Burm. f., fam. Rutaceae | 0.01% |
| Lemon (Italy-Sicily) 2 | 84929-31-7 | Citrus limon (L.) Burm. f., fam. Rutaceae | 0.37% |
| Lemon (Spain) 1 | 84929-31-7 | Citrus limon (L.) Burm. f., cultivar Verna, fam. Rutaceae | 0.33% |
| Lemon (Spain) 2 | 84929-31-7 | Citrus limon (L.) Burm. f., cultivar Fino, fam. Rutaceae | 0.24% |
| Lemon (Spain) 3 | 84929-31-7 | Citrus limon (L.) Burm. f., cultivar Eureka, fam. Rutaceae | 0.25% |
| Lemon (Spain) 4 | 84929-31-7 | Citrus limon (L.) Burm. f., cultivar Villafranca, fam. Rutaceae | 0.27% |
| Lemon (Spain) 5 | 84929-31-7 | Citrus limon (L.) Burm. f., cultivar Lisbon, fam. Rutaceae | 0.26% |
| Lemon (Spain) 6 | 84929-31-7 | Citrus limon (L.) Burm. f., cultivar Rodrejo, fam. Rutaceae | 0.47% |
| Oregano, spanish (Italy) 1 | 8007-11-2 | Coridothymus capitatus Rchb. (Thymus capitatus Hoffm. et Link.), Lamiaceae | 0.31% |
| Lavender (France) 6 | 8000-28-0 | Lavandula angustifolia Mill., fam. Lamiaceae (Labiatae) | 0.22% |
| Thyme 3 | 8007-46-3 | Thymus vulgaris L., fam. Lamiaceae (Labiatae) | 0.36% |
| Thyme 4 | 8007-46-3 | Thymus vulgaris L., fam. Lamiaceae (Labiatae) | 0.03% |
| Thyme red (Spain) 2 | 8007-46-3 | Thymus zygis L. ssp. sylvestris (Hoffm. et Link) Morales, fam. Lamiaceae | 0.36% |
| Thymus satureoides (Morocco) | 8007-46-3 | Thymus satureoides Boiss. et Reut., fam. Lamiaceae (Labiatae) | 0.4% |
| Achillea biebersteinii (Turkey) 1 | Achillea biebersteinii Afan., fam. Asteraceae (Compositae) | 0.01% | |
| Peppermint (Lithuania) | 8006-90-4 | Mentha piperita L. cultivar Lekartstvenaya-1, fam. Lamiaceae (Labiatae) | 1.2% |
| Peppermint (Italy) 6a | 8006-90-4 | Mentha piperita L., fam. Lamiaceae (Labiatae) | 0.1% |
| Peppermint (Italy) 6b | 8006-90-4 | Mentha piperita L., fam. Lamiaceae (Labiatae) | 0.4% |
| Ginger (China) 5 | 8007-08-7 | Zingiber officinale Roscoe, fam. Zingiberaceae | 0.1% |
| Sage, dalmatian (Yugoslavia) 1 | 8022-56-8 | Salvia officinalis L., fam. Lamiaceae (Labiatae) | 0.1% |
| Sage, dalmatian (Albany) 1 | 8022-56-8 | Salvia officinalis L., fam. Lamiaceae (Labiatae) | 0.17% |
| Sage, dalmatian (Dalmatia) 2 | 8022-56-8 | Salvia officinalis L., fam. Lamiaceae (Labiatae) | 0.12% |
| Juniper berry 4 | 8012-91-7 | Juniperus communis L., fam. Cupressaceae | 0.7% |
| Ajowan 2 seed | Trachyspermum copticum (L.) Link., fam. Apiaceae (Umbelliferae) | 0.2% | |
| Sideritis lycia (Turkey) | Sideritis lycia Boiss. et Heldr., fam. Lamiaceae (Labiatae) | 0.5% | |
| Coleus aromaticus (Vietnam) | Coleus aromaticus Benth. (wild oregano), fam. Lamiaceae (Labiatae) | 0.05% | |
| Coleus aromaticus (Java) | Coleus aromaticus Benth. (wild oregano), fam. Lamiaceae (Labiatae) | 0.2% | |
| Chenopodium ambrosioides | Chenopodium ambrosioides L., fam. Chenopodiaceae | 0.26% | |
| Geum montanum root | Geum montanum L., fam. Rosaceae | 0.13% | |
| Zingiber zerumbet (Vietnam) 2a stem | Zingiber zerumbet (L.) Sm., fam. Zingiberaceae | 0.05% | |
| Zingiber zerumbet (Vietnam) 2b leaf | Zingiber zerumbet (L.) Sm., fam. Zingiberaceae | 0.05% | |
| Athamanta macedonia (Greece) | Athamanta macedonia (L.) Sprengel, ssp. macedonia, fam. Apiaceae (Umbell.) | 0.64% | |
| Lippia multiflora leaf (Benin) | Lippia multiflora Moldenke (syn.L.adoensis & L.grandiflora) fam.Verbenacea | 0.1% | |
| Sage, spanish (Spain) 11 | 8016-65-7 | Salvia lavandulaefolia Vahl. ssp. vellerea, fam. Lamiaceae (Labiatae) | 0.18% |
| Sage, dalmatian (Spain) | 8022-56-8 | Salvia officinalis L., fam. Lamiaceae (Labiatae) | 0.06% |
| Salvia officinalis x S. lavandulaefolia vellerea | Salvia officinalis x S. lavandulaefolia ssp. vellerea, fam. Lamiaceae | 0.28% | |
| Camphor (Cote d'Ivoire), 1a leaf | 8008-51-3 | Cinnamomum camphora (L.) Nees et Ebermaier, fam. Lauraceae | 0.05% |
| Camphor (Cote d'Ivoire), 1b stem | 8008-51-3 | Cinnamomum camphora (L.) Nees et Ebermaier, fam. Lauraceae | 0.05% |
| Otostegia fruticosa | Otostegia fruticosa Forssk., fam. Lamiaceae (Labiatae) | 0.7% | |
| Curcuma pierreana (Vietnam), 1a rhizome | Curcuma pierreana Gagnep., fam. Zingiberaceae | 0.05% | |
| Curcuma pierreana (Vietnam), 1b stem | Curcuma pierreana Gagnep., fam. Zingiberaceae | 0.01% | |
| Curcuma pierreana (Vietnam), 1c leaf | Curcuma pierreana Gagnep., fam. Zingiberaceae | 0.05% | |
| Illicium griffithii fruit | Illicium griffithii Hook. f. et Thoms., fam. Magnoliaceae (Illiciaceae) | 0.05% | |
| Sage, dalmatian (Italy) 5 | 8022-56-8 | Salvia officinalis L. var. angustifolia Ten., fam. Lamiaceae (Labiatae) | 0.25% |
| Cymbopogon caesius leaf | Cymbopogon caesius (Nees ex Hook. et Arn.) Stapf., fam. Poaceae (Graminea) | 0.57% | |
| Mandarin (Columbia) | 8008-31-9 | Citrus deliciosa Tenore (C. reticulata Blanco, cv.mandarin), fam. Rutaceae | 0.17% |
| Mandarin (Italy) 7 | 8008-31-9 | Citrus deliciosa Tenore (C. reticulata Blanco, cv.mandarin), fam. Rutacaea | 0.91% |
| Ocimum gratissimum (Cuba) 1a | Ocimum gratissimum L., fam. Lamiaceae (Labiatae) | 8.23% | |
| Ocimum gratissimum (Cuba) 1b | Ocimum gratissimum L., fam. Lamiaceae (Labiatae) | 2.21% | |
| Lemon (Italy-Sardinia) | 84929-31-7 | Citrus limon (L.) Burm. f., fam. Rutaceae | 0.2% |
| Satureja gilliesii | Satureja gilliesii (Grah.) Briq., fam. Lamiaceae (Labiatae) | 0.1% | |
| Bay, West Indian (Benin) | 8015-73-4 | Pimenta racemosa var. racemosa (P. Miller) J.W. Moore, fam. Myrtaceae | 0.2% |
| Bay, West Indian 3 | 8015-73-4 | Pimenta racemosa var. racemosa (P. Miller) J.W. Moore, fam. Myrtaceae | 0.01% |
| Myrica cerifera leaf (Cuba) | Myrica cerifera L., fam. Myricaceae | 0.1% | |
| Hyssop (Spain) | 8006-83-5 | Hyssopus officinalis L., fam. Lamiaceae (Labiatae) | 0.21% |
| Achillea ligustica leaf (Greece) | Achillea ligustica All., fam. Asteraceae (Compositae) | 0.04% | |
| Achillea ligustica flower (Greece) | Achillea ligustica All., fam. Asteraceae (Compositae) | 0.03% | |
| Psiadia viscosa | Psiadia viscosa (Lam.) A.J. Scott, fam. Asteraceae (Compositae) | 0.1% | |
| Turmeric (Vietnam) 2 leaf | 8024-37-1 | Curcuma longa L. (C. domestica Val.), fam. Zingiberaceae | 0.2% |
| Canella winterana (French West Indies) stem bark | Canella winterana (L.) Gaertn., fam. Canellaceae | 0.2% | |
| Cardamom, large (Nepalese) (India) 2 | Amomum subulatum Roxb., fam. Zingiberaceae | 0.32% | |
| Vassoura (Brazil) 3 | Baccharis dracunculifolia DC., fam. Asteraceae (Compositae) | 0.1% | |
| Lime (Persian) (Japan) | Citrus latifolia Tanaka, fam. Rutaceae | 0.02% | |
| Minthostachys spicata | Minthostachys spicata (Benth.) Epl., fam Lamiaceae (Labiatae) | 0.01% | |
| Artemisia umbelliformis (Italy) | Artemisia umbelliformis Lam., fam. Asteraceae (Compositae) | 0.3% | |
| Artemisia campestris (Italy) 1 | Artemisia campestris L. ssp. borealis (Pallas), H.M. Hall et Clements | 0.01% | |
| Artemisia genipi (Italy) | Artemisia genipi Weber, fam. Asteraceae (Compositae) | 0.8% | |
| Artemisia petrosa (Italy) | Artemisia petrosa Baumg. ssp. eriantha Ten., fam. Asteraceae (Compositae) | 0.1% | |
| Artemisia vallesiaca (Italy) | Artemisia vallesiaca All., fam. Asteraceae (Compositae) | 0.01% | |
| Wormwood (Mugwort) (Italy) 2 | 8008-93-3 | Artemisia absinthium L., fam. Asteraceae (Compositae) | 0.01% |
| Artemisia chamaemelifolia (Italy) | Artemisia chamaemelifolia Vill., fam. Asteraceae (Compositae) | 0.1% | |
| Artemisia glacialis (Italy) | Artemisia glacialis L., fam. Asteraceae (Compositae) | 0.01% | |
| Artemisia campestris (Italy) 2 | Artemisia campestris L. ssp. campestris, fam. Asteraceae (Compositae) | 0.01% | |
| Artemisia alba (Italy) | 84775-75-7 | Artemisia alba Turra, fam. Asteraceae (Compositae) | 0.2% |
| Oregano, spanish (Greece) 4 | 8007-11-2 | Coridothymus capitatus Rchb. (Thymus capitatus Hoffm. et Link.), Lamiaceae | 0.7% |
| Eucalyptus camaldulensis (Burkina Faso) | Eucalyptus camaldulensis Dehn., fam. Myrtaceae | 1.3% | |
| Piper auritum (Cuba) | Piper auritum H.B.K., fam. Piperaceae | 0.1% | |
| Bupleurum gibraltarium (Spain) | Bupleurum gibraltarium Lam., fam. Apiaceae (Umbelliferae) | 0.2% | |
| Lemon (Italy-Sicily) 12a Femminello | 84929-31-7 | Citrus limon (L.) Burm. f., cultivar Femminello, fam. Rutaceae | 0.41% |
| Lemon (Italy-Sicily) 12b Lo Porto | 84929-31-7 | Citrus limon (L.) Burm. f., cultivar Lo Porto, fam. Rutaceae | 0.3% |
| Lemon (Italy-Sicily) 12c Monachello | 84929-31-7 | Citrus limon (L.) Burm. f., cultivar Monachello, fam. Rutaceae | 0.48% |
| Lime (Mexican, West Indian, Key) 6 | 8008-26-2 | Citrus aurantifolia (Christm.) Swingle, fam. Rutaceae | 0.43% |
| Santolina ligustica (Italy) | Santolina ligustica Arrigonia, fam. Asteraceae (Compositae) | 0.4% | |
| Cypress, Leyland (Poland) | Cupressocyparis leylandii (Dall. et Jacks.) Dall., fam. Cupressaceae | 0.6% | |
| Rosemary (Brazil) 1 | 8000-25-7 | Rosmarinus officinalis L., fam. Lamiaceae (Labiatae) | 6.0% |
| Rosemary (Uruguay) | 8000-25-7 | Rosmarinus officinalis L., fam. Lamiaceae (Labiatae) | 0.25% |
| Sage, dalmatian (Hungary) 2 | 8022-56-8 | Salvia officinalis L., fam. Lamiaceae (Labiatae) | 0.2% |
| Sage, spanish (Hungary) | 8016-65-7 | Salvia lavandulaefolia Vahl., fam. Lamiaceae (Labiatae) | 0.4% |
| Thyme 8 | 8007-46-3 | Thymus vulgaris L., fam. Lamiaceae (Labiatae) | 0.8% |
| Myrtle leaf (Albania) 2 | 8008-46-6 | Myrtus communis L., fam. Myrtaceae | 0.28% |
| Myrtle flower (Albania) | 8008-46-6 | Myrtus communis L., fam. Myrtaceae | 0.1% |
| Myrtle berry (Albania) | 8008-46-6 | Myrtus communis L., fam. Myrtaceae | 0.12% |
| Artemisia verlotiorum (France) | Artemisia verlotiorum Lamotte, fam. Asteraceae (Compositae) | 0.3% | |
| Calycolpus australis leaf | Calycolpus australis Landrum, fam. Myrtaceae | 3.64% | |
| Fennel, bitter (Spain) 3 | 8006-84-6 | Foeniculum vulgare Miller, var. vulgare DC, fam. Apiaceae (Umbelliferae) | 0.2% |
| Kewda (India) | Pandanus fascicularis Lam., var. fascilarris, fam. Pandanaceae | 0.4% | |
| Mullilam seed (India) | Zanthoxylum rhetsa D.C. syn. Z. limonella (Dennst.) Alston, fam. Rutaceae | 0.5% | |
| Prangos uechtritzii (Turkey) fruit | Prangos uechtritzii Boiss. et Hausskn., fam. Apiaceae (Umbelliferae) | 0.3% | |
| Origanum libanoticum (Lebanon) | Origanum libanoticum Boiss., fam. Lamiaceae (Labiatae) | 1.4% | |
| Origanum syriacum (Lebanon) | Origanum syriacum L., fam. Lamiaceae (Labiatae) | 0.3% | |
| Alpinia laosensis (Vietnam) | Alpinia laosensis Gagnep., fam. Zingiberaceae | 0.01% | |
| Bergamot (Turkey) 2 | 8007-75-8 | Citrus bergamia Risso et Poiteau, fam. Rutaceae | 0.2% |
| Hyptis suaveolens (Nigeria) | Hyptis suaveolens (L.) Poit., fam. Lamiaceae (Labiatae) | 0.6% | |
| Abies alba needle (Serbia) | 8021-27-0 | Abies alba Mill., fam. Pinaceae | 2.8% |
| Abies cephalonica needle (Greece) | Abies cephalonica Loud., fam. Pinaceae | 1.2% | |
| Abies borisii-regis needle (Greece) | Abies borisii-regis Mattf., fam. Pinaceae | 1.6% | |
| Cupressus macrocarpa leaf (Argentina) | Cupressus macrocarpa Hartw., fam. Cupressaceae | 1.4% | |
| Artemisia scoparia (India) 2 | Artemisia scoparia Waldst. et Kit., fam. Asteraceae (Compositae) | 0.1% | |
| Bacuri fruit (Brazil) | Platonia insignis M., fam. Guttiferae | 1.1% | |
| Ocimum gratissimum (Benin) 2 | Ocimum gratissimum L., fam. Lamiaceae (Labiatae) | 5.0% | |
| Rosmarinus eriocalyx (Algeria) 2 | Rosmarinus eriocalyx Jordan & Fourr., fam. Lamiaceae (Labiatae) | 0.01% | |
| Rosemary (Algeria) 2 | 8000-25-7 | Rosmarinus officinalis L., fam. Lamiaceae (Labiatae) | 0.01% |
| Ravensara aromatica (Finland) | Ravensara aromatica Sonn., fam. Lauraceae | 1.2% | |
| Tagetes patula (India) | Tagetes patula L., fam. Asteraceae (Compositae) | 0.4% | |
| Curcuma mangga (Malaysia) | Curcuma mangga Val., fam Zingiberaceae | 0.05% | |
| Curcuma xanthorrhiza (Malaysia) | Curcuma xanthorrhiza Roxb., fam. Zingiberaceae | 0.05% | |
| Curcuma aeruginosa (Malaysia) 2 | Curcuma aeruginosa Roxb., fam. Zingiberaceae | 0.05% | |
| Coleus aromaticus (India) 2 | Coleus aromaticus Benth. (wild oregano), fam. Lamiaceae (Labiatae) | 0.7% | |
| Mandarin (Spain) 2 | 8008-31-9 | Citrus deliciosa Tenore (C. reticulata Blanco, cv.mandarin), fam. Rutaceae | 0.4% |
| Mandarin (Uruguay) 3 | 8008-31-9 | Citrus deliciosa Tenore cv. Nova (C. reticulata Blanco), fam. Rutaceae | 0.01% |
| Tansy, moroccan (Morocco) 1 | Tanacetum annuum L., fam. Asteraceae (Compositae) | 0.1% | |
| Tansy, moroccan (Morocco) 2 | Tanacetum annuum L., fam. Asteraceae (Compositae) | 0.7% | |
| Sage, dalmatian (Albany) 3 | 8022-56-8 | Salvia officinalis L., fam. Lamiaceae (Labiatae) | 0.5% |
| Manuka (New Zealand) 1 | Leptospermum scoparium J.R. et F. Forst., fam. Myrtaceae | 0.03% | |
| Marjoram, sweet 4c standard solvent extract | 8015-01-8 | Majorana hortensis Moench, Origanum majorana L., fam. Lamiaceae (Labiatae) | 2.1% |
| Cinnamomum cordatum (Malaysia) 1a leaf | Cinnamomum cordatum Kosterm., fam. Lauraceae | 0.2% | |
| Thymus transcaspicus (Iran) | Thymus transcaspicus Klokov, fam. Lamiaceae (Labiatae) | 0.25% | |
| Origanum glandulosum (Algeria) | Origanum glandulosum Desf., fam. Lamiaceae (Labiatae) | 0.5% | |
| Lanyana (South Afrika) 2 | Artemisia afra Jacq., fam. Asteraceae (Compositae) | 0.2% | |
| Pteronia incana 3 | Pteronia incana, fam. Asteraceae (Compositae) | 1.4% | |
| Savory, summer (Iran) 2 | 8016-68-0 | Satureja hortensis L., fam. Lamiaceae (Labiatae) | 1.7% |
| Orange leaf, sweet (Italy) 3 Valencia late | Citrus sinensis (L.) Osbeck, cultivar Valencia late, fam. Rutaceae | 0.3% | |
| Lemon leaf (petitgrain) (Italy) 5 Femminello | 84929-31-7 | Citrus limon (L.) Burm. f., cultivar Femminello, fam. Rutaceae | 0.05% |
| Citrus cybrid leaf (Italy) | Citrus sinensis (L.) Osbeck x C. limon (L.) Burm. f., fam. Rutaceae | 0.05% | |
| Zataria multiflora (Iran) 1a bud | Zataria multiflora Boiss., fam. Lamiaceae (Labiatae) | 0.01% | |
| Zataria multiflora (Iran) 1b flower | Zataria multiflora Boiss., fam. Lamiaceae (Labiatae) | 0.08% | |
| Baccharis cordobensis (Argentina) | Baccharis cordobensis Heering, fam. Asteraceae (Compisitae) | 0.05% | |
| Seafennel (Turkey) 1a Antalya | 89997-98-8 | Crithmum maritimum L., fam. Apiaceae (Umbelliferae) | 0.2% |
| Seafennel (Turkey) 1b Mersin | 89997-98-8 | Crithmum maritimum L., fam. Apiaceae (Umbelliferae) | 0.7% |
| Oregano, greek (Croatia) | 84012-24-8 | Origanum vulgare L. ssp. hirtum (Link) Ietsw., fam. Lamiaceae (Labiatae) | 0.5% |
| Lippia alba (India) | Lippia alba (Mill.) N.E. Br., fam. Verbenaceae | 0.3% | |
| Orange, sweet (Ethiopia) 1a cv Valencia | 8028-48-6 | Citrus sinensis (L.) Osbeck, fam. Rutaceae | 0.01% |
| Orange, sweet (Ethiopia) 1b cv Hamlin | 8028-48-6 | Citrus sinensis (L.) Osbeck, fam. Rutaceae | 0.01% |
| Ocimum gratissimum (Guinea) | Ocimum gratissimum L., fam. Lamiaceae (Labiatae) | 5.26% | |
| Ocimum suave (Guinea) | Ocimum suave L., fam. Lamiaceae (Labiatae) | 6.26% | |
| Zataria multiflora (Iran) 2 flowering tops | Zataria multiflora Boiss., fam. Lamiaceae (Labiatae) | 0.77% | |
| Pelargonium exstipulatum leaf | Pelargonium exstipulatum (Cav.) L'Herit., fam- Geraniaceae | 25.0% | |
| Pelargonium x fragrans leaf | Pelargonium x fragrans, fam. Geraniaceae | 5.9% | |
| Bergamot (Japan) 1 | 8007-75-8 | Citrus bergamia Risso et Poiteau, fam. Rutaceae | 0.15% |
| Bergamot (Italy, Sicily) 1a Castagnaro | 8007-75-8 | Citrus bergamia Risso et Poiteau, fam. Rutaceae | 0.3% |
| Bergamot (Italy, Sicily) 1b Fantastico | 8007-75-8 | Citrus bergamia Risso et Poiteau, fam. Rutaceae | 0.29% |
| Bergamot (Italy, Sicily) 1c Feminello | 8007-75-8 | Citrus bergamia Risso et Poiteau, fam. Rutaceae | 0.19% |
| Bergamot (Italy, Sicily) 1d PCF | 8007-75-8 | Citrus bergamia Risso et Poiteau, fam. Rutaceae | 0.22% |
| Bergamot (Italy, Calabria) 8 | 8007-75-8 | Citrus bergamia Risso et Poiteau, fam. Rutaceae | 0.32% |
| Bergamot (Italy) 7 | 8007-75-8 | Citrus bergamia Risso et Poiteau, fam. Rutaceae | 0.3% |
| Bergamot (Turkey) 3a green fruit | 8007-75-8 | Citrus bergamia Risso et Poiteau, fam. Rutaceae | 0.1% |
| Bergamot (Turkey) 3b green/yellow fruit | 8007-75-8 | Citrus bergamia Risso et Poiteau, fam. Rutaceae | 0.2% |
| Bergamot (Italy) 5a original oil | 8007-75-8 | Citrus bergamia Risso et Poiteau, fam. Rutaceae | 0.01% |
| Bergamot (Italy) 5b headspace of oil | 8007-75-8 | Citrus bergamia Risso et Poiteau, fam. Rutaceae | 0.01% |
| Bergamot (Italy) 5c headspace heated oil | 8007-75-8 | Citrus bergamia Risso et Poiteau, fam. Rutaceae | 0.01% |
| Bunium persicum fruit (Iran) | Bunium persicum (Boiss.) B. Fedtsch., fam. Apiaceae (Umbelliferae) | 0.3% | |
| Phlomis fruticosa (Yugoslavia) | Phlomis fruticosa L., fam. Lamiaceae (Labiatae) | 0.05% | |
| Peppermint (Mexico) | 8006-90-4 | Mentha piperita L., fam. Lamiaceae (Labiatae) | 0.01% |
| Minthostachys mollis (Argentina) | Minthostachys mollis (Kunth.) Grisebach, fam. Lamiaceae (Labiatae) | 0.37% | |
| Eucalyptus camaldulensis (Congo) | Eucalyptus camaldulensis Dehn., fam. Myrtaceae | 0.6% | |
| Eugenia uruguauensis (Brazil) | Eugenia uruguayensis Camb., fam. Myrtaceae | 23.5% | |
| Eugenia umbelliflora (Brazil) | Eugenia umbelliflora O. Berg, fam. Myrtaceae | 0.9% | |
| Ajowan (Iran) aerial part | Trachyspermum copticum (L.) Link., fam. Apiaceae (Umbelliferae) | 0.3% | |
| Ajowan (Iran) seed | Trachyspermum copticum (L.) Link., fam. Apiaceae (Umbelliferae) | 0.3% | |
| Semenovia tragioides (Iran) | Semenovia tragioides (Boiss.) Manden., fam. Apiaceae (Umbelliferae) | 0.01% | |
| Heracleum persicum (Iran) 1a leaf a | Heracleum persicum L., fam. Apiaceae (Umbelliferae) | 0.01% | |
| Annual wormwood (India) 2 | 84775-74-6 | Artemisia annua L., fam. Asteraceae (Compositae) | 0.1% |
| Sage, dalmatian (Italy) 9 | 8022-56-8 | Salvia officinalis L., fam. Lamiaceae (Labiatae) | 0.01% |
| Rosemary (Italy) 15 | 8000-25-7 | Rosmarinus officinalis L., fam. Lamiaceae (Labiatae) | 0.01% |